Merged #story[1195]

.gitignore

@@ -183,5 +183,4 @@ local.properties
 # IntelliJDEA ignore
 *.iml
 dedicatedServer/.idea/
-.idea/copyright/
 settings/keyBindings.xml

.idea/copyright/profiles_settings.xml

@@ -0,0 +1,3 @@
+<component name="CopyrightManager">
+  <settings default="" />
+</component>

.mailmap

@@ -18,3 +18,4 @@
 Erika Savell <esa46@uclive.ac.nz>
 Connor Taylor-Brown <cbt24@cs17086jp.canterbury.ac.nz> <cbt24@uclive.canterbury.ac.nz>
 Fraser Cope <fjc40@uclive.ac.nz>
+Jessica Syder <jam339@uclive.ac.nz> Jessica Syder <doctorjess@live.com>

matchBrowser/pom.xml

@@ -0,0 +1,89 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<project xmlns="http://maven.apache.org/POM/4.0.0"
+         xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+         xsi:schemaLocation="http://maven.apache.org/POM/4.0.0 http://maven.apache.org/xsd/maven-4.0.0.xsd">
+    <parent>
+        <artifactId>team-7</artifactId>
+        <groupId>seng302</groupId>
+        <version>2.0</version>
+    </parent>
+    <modelVersion>4.0.0</modelVersion>
+
+
+    <packaging>jar</packaging>
+    <name>matchBrowser</name>
+    <artifactId>matchBrowser</artifactId>
+    <version>2.0</version>
+
+    <dependencies>
+        <dependency>
+            <groupId>junit</groupId>
+            <artifactId>junit</artifactId>
+            <version>4.12</version>
+            <scope>test</scope>
+        </dependency>
+
+        <!-- https://mvnrepository.com/artifact/org.mockito/mockito-all -->
+        <dependency>
+            <groupId>org.mockito</groupId>
+            <artifactId>mockito-all</artifactId>
+            <version>1.9.5</version>
+        </dependency>
+
+        <dependency>
+            <groupId>org.testng</groupId>
+            <artifactId>testng</artifactId>
+            <version>6.11</version>
+            <scope>test</scope>
+        </dependency>
+
+        <dependency>
+            <groupId>seng302</groupId>
+            <artifactId>racevisionGame</artifactId>
+            <version>2.0</version>
+        </dependency>
+
+    </dependencies>
+
+    <properties>
+        <maven.compiler.source>1.8</maven.compiler.source>
+        <maven.compiler.target>1.8</maven.compiler.target>
+    </properties>
+
+
+    <build>
+        <plugins>
+            <plugin>
+                <groupId>org.apache.maven.plugins</groupId>
+                <artifactId>maven-compiler-plugin</artifactId>
+                <version>3.5.1</version>
+            </plugin>
+            <plugin>
+                <groupId>org.apache.maven.plugins</groupId>
+                <artifactId>maven-shade-plugin</artifactId>
+                <version>2.4.3</version>
+                <configuration>
+                    <transformers>
+                        <transformer
+                                implementation="org.apache.maven.plugins.shade.resource.ManifestResourceTransformer">
+                            <manifestEntries>
+                                <Main-Class>app.Main</Main-Class>
+                                <X-Compile-Source-JDK>${maven.compiler.source}</X-Compile-Source-JDK>
+                                <X-Compile-Target-JDK>${maven.compiler.target}</X-Compile-Target-JDK>
+                            </manifestEntries>
+                        </transformer>
+                    </transformers>
+                </configuration>
+                <executions>
+                    <execution>
+                        <phase>package</phase>
+                        <goals>
+                            <goal>shade</goal>
+                        </goals>
+                    </execution>
+                </executions>
+            </plugin>
+        </plugins>
+    </build>
+
+</project>

matchBrowser/src/main/java/app/Main.java

@@ -0,0 +1,12 @@
+package app;
+
+import networkInterface.NetworkInterface;
+
+/**
+ * Used when starting the matchmaking browser
+ */
+public class Main {
+    public static void main(String[] args) {
+        NetworkInterface networkInterface = new NetworkInterface();
+    }
+}

matchBrowser/src/main/java/model/ClientAddress.java

@@ -0,0 +1,37 @@
+package model;
+
+public class ClientAddress {
+    private String ip;
+    private int port;
+
+    public ClientAddress(String ip, int port) {
+        this.ip = ip;
+        this.port = port;
+    }
+
+    public String getIp() {
+        return ip;
+    }
+
+    public int getPort() {
+        return port;
+    }
+
+    @Override
+    public boolean equals(Object o) {
+        return o != null && o instanceof ClientAddress && hashCode() == o.hashCode();
+    }
+
+    @Override
+    public int hashCode() {
+        int result = ip != null ? ip.hashCode() : 0;
+        result *= 31;
+        return result;
+    }
+
+    @Override
+    public String toString() {
+        return  "{ip='" + ip + '\'' +
+                ", port=" + port+"}";
+    }
+}

matchBrowser/src/main/java/model/MatchTable.java

@@ -0,0 +1,32 @@
+package model;
+
+
+import network.Messages.HostGame;
+
+import java.util.ArrayList;
+import java.util.HashMap;
+import java.util.List;
+
+/**
+ * Holds a table object that stores current games
+ */
+public class MatchTable {
+    private HashMap<ClientAddress, HostGame> matchTable;
+
+    public MatchTable() {
+        this.matchTable = new HashMap<>();
+    }
+
+    public void addEntry(ClientAddress address, HostGame newEntry) {
+        this.matchTable.put(address, newEntry);
+    }
+
+    public HashMap<ClientAddress, HostGame> getMatchTable() {
+        return matchTable;
+    }
+
+    @Override
+    public String toString() {
+        return  "MatchTable=" + matchTable;
+    }
+}

matchBrowser/src/main/java/model/TableKey.java

@@ -0,0 +1,37 @@
+package model;
+
+/**
+ * Used to create a key made of an ip and port.
+ */
+public class TableKey {
+
+    private final String ip;
+    private final int port;
+
+    public TableKey(String ip, int port) {
+        this.ip = ip;
+        this.port = port;
+    }
+
+    @Override
+    public boolean equals(Object o) {
+        if (this == o) return true;
+        if (!(o instanceof TableKey)) return false;
+        TableKey key = (TableKey) o;
+        return ip.equals(key.ip) && port == key.port;
+    }
+
+    @Override
+    public int hashCode() {
+        int result = port;
+        result = 31 * result + ip.hashCode();
+        return result;
+    }
+
+    @Override
+    public String toString() {
+        return  "[ip='" + ip + '\'' +
+                ", port=" + port +
+                ']';
+    }
+}

matchBrowser/src/main/java/networkInterface/NetworkInterface.java

@@ -0,0 +1,132 @@
+package networkInterface;
+
+import model.ClientAddress;
+import model.MatchTable;
+import network.BinaryMessageDecoder;
+import network.Exceptions.InvalidMessageException;
+import network.MessageDecoders.HostGameMessageDecoder;
+import network.MessageDecoders.HostedGamesRequestDecoder;
+import network.MessageEncoders.HostedGamesRequestEncoder;
+import network.Messages.Enums.MessageType;
+import network.Messages.HostGame;
+import network.Messages.HostGamesRequest;
+
+import java.io.IOException;
+import java.net.DatagramPacket;
+import java.net.DatagramSocket;
+import java.net.InetAddress;
+import java.time.LocalDateTime;
+import java.util.*;
+
+/**
+ * Holds the output for the network for
+ */
+public class NetworkInterface {
+    private Timer scheduler;
+    private DatagramSocket serverSocket;
+    private byte[] receiveData = new byte[1024];
+
+    private Set<ClientAddress> clientsAddresses;
+    private MatchTable matchTable;
+
+
+    public NetworkInterface(){
+        this.clientsAddresses = new HashSet<>();
+        this.matchTable = new MatchTable();
+        this.scheduler = new Timer(true);
+        try {
+            this.serverSocket = new DatagramSocket(3779);
+
+            startBroadcast(5000);
+            scheduleFlush(70000);
+            this.run();
+        } catch (IOException e) {
+            System.err.println("Error listening on port: " +  this.serverSocket.getLocalPort() + ".");
+            System.exit(-1);
+        }
+
+    }
+
+    /**
+     * Broadcasts match table to clients at a requested interval
+     * @param period interval to broadcast table
+     */
+    private void startBroadcast(int period) {
+        scheduler.scheduleAtFixedRate(new TimerTask() {
+            @Override
+            public void run() {
+                List<HostGame> games = new ArrayList<>();
+
+                for(Map.Entry<ClientAddress, HostGame> tableEntry: matchTable.getMatchTable().entrySet()) {
+                    HostGame game = tableEntry.getValue();
+                    if(game != null) {
+                        games.add(game);
+                    }
+                }
+
+                HostedGamesRequestEncoder encoder = new HostedGamesRequestEncoder();
+                try {
+                    byte[] message = encoder.encode(new HostGamesRequest(games));
+                    for(ClientAddress address: clientsAddresses) {
+                        serverSocket.send(new DatagramPacket(message, message.length, InetAddress.getByName(address.getIp()), 4941));
+                    }
+                } catch (InvalidMessageException | IOException e) {
+                    e.printStackTrace();
+                }
+            }
+        }, period, period);
+    }
+
+    /**
+     * Flushes the match table at a requested interval
+     * @param period interval to flush table
+     */
+    private void scheduleFlush(int period) {
+        scheduler.scheduleAtFixedRate(new TimerTask() {
+            @Override
+            public void run() {
+                matchTable.getMatchTable().clear();
+            }
+        }, period, period);
+    }
+
+    private void run() throws IOException{
+        while(true) {
+            DatagramPacket receivePacket = new DatagramPacket(receiveData, receiveData.length);
+            serverSocket.receive(receivePacket);
+
+            BinaryMessageDecoder messageDecoder = new BinaryMessageDecoder(receivePacket.getData());
+            switch (MessageType.fromByte(messageDecoder.getHeaderMessageType())){
+                case HOST_GAME:
+                    //decode and update table
+                    HostGameMessageDecoder decoder = new HostGameMessageDecoder();
+                    HostGame newKnownGame;
+                    try{
+                        newKnownGame = (HostGame) decoder.decode(messageDecoder.getMessageBody());
+                        newKnownGame.setIp(receivePacket.getAddress().getHostAddress());
+                        this.matchTable.addEntry(new ClientAddress(receivePacket.getAddress().getHostAddress(), receivePacket.getPort()), newKnownGame);
+
+                    }catch (InvalidMessageException e){
+                        System.out.println(e);
+                        System.err.println("Message received that is not a hostedGame packet");
+                    }
+                    break;
+                case HOSTED_GAMES_REQUEST:
+                    //update known clients
+                    HostedGamesRequestDecoder decoder2 = new HostedGamesRequestDecoder();
+                    HostGamesRequest newKnownGames;
+                    try{
+                        newKnownGames = (HostGamesRequest) decoder2.decode(messageDecoder.getMessageBody());
+                        if (newKnownGames.getKnownGames().size() == 0){
+                            //this is just an alert message with no content
+                            clientsAddresses.add(new ClientAddress(receivePacket.getAddress().getHostAddress(), receivePacket.getPort()));
+                        }
+                    }catch (InvalidMessageException e){
+                        System.out.println(e);
+                        System.err.println("Message received that is not a hostedGamesRequest packet");
+                    }
+                    break;
+            }
+        }
+    }
+}

matchBrowser/src/test/java/model/MatchTableTest.java

@@ -0,0 +1,29 @@
+package model;
+
+import network.Messages.Enums.RaceStatusEnum;
+import network.Messages.HostGame;
+import org.junit.Before;
+import org.junit.Test;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+
+import static org.junit.Assert.assertEquals;
+
+public class MatchTableTest {
+    private MatchTable testTable;
+
+    @Before
+    public void setUp() {
+        testTable = new MatchTable();
+    }
+
+    @Test
+    public void testTable() {
+        HostGame entry = new HostGame("127.0.0.1", 4942, (byte)1, (byte)1, RaceStatusEnum.PRESTART, (byte)6, (byte)1);
+
+        testTable.addEntry(new ClientAddress("127.0.0.1", 3779), entry);
+
+        assertEquals(testTable.getMatchTable().get(new ClientAddress("127.0.0.1", 4942)), entry);
+    }
+}

pom.xml

@@ -10,6 +10,7 @@
     <modules>
         <module>racevisionGame</module>
         <module>dedicatedServer</module>
+        <module>matchBrowser</module>
     </modules>
 
     <url>https://eng-git.canterbury.ac.nz/SENG302-2016/team-7</url>

racevisionGame/src/main/java/mock/app/Event.java

@@ -2,14 +2,17 @@ package mock.app;
 
 import mock.dataInput.PolarParser;
 import mock.exceptions.EventConstructionException;
-import mock.model.*;
+import mock.model.MockRace;
+import mock.model.Polars;
+import mock.model.RaceLogic;
+import mock.model.SourceIdAllocator;
 import mock.model.commandFactory.CompositeCommand;
-import mock.model.wind.RandomWindGenerator;
 import mock.model.wind.ShiftingWindGenerator;
 import mock.model.wind.WindGenerator;
 import mock.xml.RaceXMLCreator;
+import network.Messages.Enums.RaceStatusEnum;
+import network.Messages.HostGame;
 import network.Messages.LatestMessages;
-import org.xml.sax.SAXException;
 import shared.dataInput.*;
 import shared.enums.XMLFileType;
 import shared.exceptions.InvalidBoatDataException;
@@ -18,19 +21,12 @@ import shared.exceptions.InvalidRegattaDataException;
 import shared.exceptions.XMLReaderException;
 import shared.model.Bearing;
 import shared.model.Constants;
-import shared.xml.XMLUtilities;
 
-import javax.xml.bind.JAXBException;
-import javax.xml.parsers.ParserConfigurationException;
 import java.io.IOException;
+import java.net.Inet4Address;
 import java.nio.charset.StandardCharsets;
 import java.time.ZonedDateTime;
 import java.time.format.DateTimeFormatter;
-import java.util.ArrayList;
-import java.util.List;
-import java.util.concurrent.TimeUnit;
-import java.util.logging.Level;
-import java.util.logging.Logger;
 
 
 /**
@@ -80,6 +76,7 @@ public class Event {
     /**
      * Constructs an event, using various XML files.
      * @param singlePlayer Whether or not to create a single player event.
+     * @param mapIndex Specifies which map to use.
      * @throws EventConstructionException Thrown if we cannot create an Event for any reason.
      */
     public Event(boolean singlePlayer, int mapIndex) throws EventConstructionException {
@@ -111,18 +108,23 @@ public class Event {
             boatsXMLFile = "mock/mockXML/boatsSinglePlayer.xml";
         }
 
+        double windAngle = 300;
+
         //Read XML files.
         try {
             //this.raceXML = RaceXMLCreator.alterRaceToWind(raceXMLFile, 90);
-            this.raceXML = XMLReader.readXMLFileToString(raceXMLFile, StandardCharsets.UTF_8);
             this.raceXML = Event.setRaceXMLAtCurrentTimeToNow(XMLReader.readXMLFileToString(raceXMLFile, StandardCharsets.UTF_8));
             if(mapIndex==4){
-                this.raceXML = Event.setRaceXMLAtCurrentTimeToNow(XMLReader.readXMLFileToString(raceXMLFile, StandardCharsets.UTF_8), 1000, 5000);
+                //this.raceXML = Event.setRaceXMLAtCurrentTimeToNow(XMLReader.readXMLFileToString(raceXMLFile, StandardCharsets.UTF_8), 1000, 5000);
+                this.raceXML = RaceXMLCreator.alterRaceToWind(this.raceXML, XMLFileType.Contents, -1, true);
+            } else {
+                this.raceXML = RaceXMLCreator.alterRaceToWind(this.raceXML, XMLFileType.Contents, windAngle, false);
             }
+
             this.boatXML = XMLReader.readXMLFileToString(boatsXMLFile, StandardCharsets.UTF_8);
             this.regattaXML = XMLReader.readXMLFileToString(regattaXMLFile, StandardCharsets.UTF_8);
 
-        } catch (XMLReaderException e) {
+        } catch (XMLReaderException | InvalidRaceDataException e) {
             throw new EventConstructionException("Could not read XML files.", e);
         }
 
@@ -149,17 +151,26 @@ public class Event {
         this.latestMessages = new LatestMessages();
 
         WindGenerator windGenerator = new ShiftingWindGenerator(
-                Bearing.fromDegrees(225),
+                Bearing.fromDegrees(windAngle),
                 12
         );
-        RaceLogic newRace = new RaceLogic(
-                new MockRace(
+
+        MockRace mockRace = new MockRace(
                 boatDataSource,
                 raceDataSource,
                 regattaDataSource,
                 this.boatPolars,
                 Constants.RaceTimeScale,
-                        windGenerator   ),
+                windGenerator   );
+
+        if(mapIndex==4){
+            mockRace.setRacePreStartTime(1000);
+            mockRace.setRacePreparatoryTime(5000);
+        }
+
+
+        RaceLogic newRace = new RaceLogic(
+                mockRace,
                 this.latestMessages,
                 this.compositeCommand);
 
@@ -194,7 +205,6 @@ public class Event {
 
 
 
-    //TODO remove this after demo on 18th august!
     /**
      * Sets the xml description of the race to show the race was created now, and starts in 4 minutes
      * @param raceXML The race.xml contents.
@@ -210,8 +220,6 @@ public class Event {
         long millisecondsToAdd = racePreStartTime + racePreparatoryTime;
 
         long secondsToAdd = millisecondsToAdd / 1000;
-        //Scale the time using our time scalar.
-        secondsToAdd = secondsToAdd / Constants.RaceTimeScale;
 
         DateTimeFormatter dateFormat = DateTimeFormatter.ofPattern("yyyy-MM-dd'T'HH:mm:ssZ");
         ZonedDateTime creationTime = ZonedDateTime.now();
@@ -221,4 +229,14 @@ public class Event {
         return raceXML;
     }
 
+    /**
+     * Creates the needed data type for a network packet
+     * @return hostGame Ac35DataType
+     * @throws IOException Inet4Address issue
+     */
+    public HostGame getHostedGameData() throws IOException{
+        String ip = Inet4Address.getLocalHost().getHostAddress();
+        return new HostGame(ip, 3779,(byte) 1,(byte) 1, RaceStatusEnum.PRESTART, (byte) 1, (byte) 1);
+    }
+
 }

racevisionGame/src/main/java/mock/app/MockOutput.java

@@ -60,7 +60,6 @@ public class MockOutput implements RunnableWithFramePeriod {
 
             try {
                 Thread.sleep(500);
-
             } catch (InterruptedException e) {
                 //If we get interrupted, exit the function.
                 Logger.getGlobal().log(Level.WARNING, "MockOutput.run().sleep(waitForXMLs) was interrupted on thread: " + Thread.currentThread(), e);
@@ -72,7 +71,6 @@ public class MockOutput implements RunnableWithFramePeriod {
             }
         }
 
-
         long previousFrameTime = System.currentTimeMillis();
 
 

racevisionGame/src/main/java/mock/model/MockBoat.java

@@ -34,7 +34,10 @@ public class MockBoat extends Boat {
      */
     private boolean autoVMG = false;
 
-
+    /**
+     * Indicates whether boat velocity is determined by wind
+     */
+    private boolean velocityDefault = true;
 
     /**
      * Constructs a boat object with a given sourceID, name, country/team abbreviation, and polars table.
@@ -300,4 +303,12 @@ public class MockBoat extends Boat {
     public void setAutoVMG(boolean autoVMG) {
         this.autoVMG = autoVMG;
     }
+
+    public boolean isVelocityDefault() {
+        return velocityDefault;
+    }
+
+    public void setVelocityDefault(boolean velocityDefault) {
+        this.velocityDefault = velocityDefault;
+    }
 }

racevisionGame/src/main/java/mock/model/MockRace.java

@@ -1,18 +1,15 @@
 package mock.model;
 
+import mock.model.commandFactory.ActiveObserverCommand;
+import mock.model.commandFactory.ObserverCommand;
 import mock.model.wind.WindGenerator;
-import javafx.animation.AnimationTimer;
 import mock.model.collider.ColliderRegistry;
-import mock.xml.*;
-import network.Messages.BoatLocation;
-import network.Messages.BoatStatus;
 import network.Messages.Enums.BoatStatusEnum;
 import network.Messages.Enums.RaceStatusEnum;
 import shared.dataInput.BoatDataSource;
 import shared.dataInput.RaceDataSource;
 import shared.dataInput.RegattaDataSource;
 import shared.exceptions.BoatNotFoundException;
-import shared.enums.RoundingType;
 import shared.model.*;
 import shared.model.Bearing;
 
@@ -64,7 +61,11 @@ public class MockRace extends RaceState {
      */
     private Polars polars;
 
+    private ActiveObserverCommand activeObserverCommand;
 
+    private long racePreStartTime = Constants.RacePreStartTime;
+
+    private long racePreparatoryTime = Constants.RacePreparatoryTime;
 
     /**
      * Constructs a race object with a given RaceDataSource, BoatDataSource, and RegattaDataSource and sends events to the given mockOutput.
@@ -81,6 +82,7 @@ public class MockRace extends RaceState {
         this.setRaceDataSource(raceDataSource);
         this.setRegattaDataSource(regattaDataSource);
 
+        this.activeObserverCommand = new ActiveObserverCommand();
         this.polars = polars;
         this.scaleFactor = timeScale;
 
@@ -119,6 +121,7 @@ public class MockRace extends RaceState {
         //Construct a MockBoat using the Boat and Polars.
         MockBoat mockBoat = new MockBoat(boat, polars);
         mockBoat.setCurrentLeg(this.getLegs().get(0));
+        mockBoat.setEstimatedTimeAtNextMark(this.getRaceClock().getCurrentTime());
 
         //Update participant list.
         getRaceDataSource().getParticipants().add(sourceID);
@@ -126,6 +129,7 @@ public class MockRace extends RaceState {
         this.boats.add(mockBoat);
 
         getRaceDataSource().incrementSequenceNumber();
+
     }
 
     /**
@@ -162,15 +166,15 @@ public class MockRace extends RaceState {
         long timeToStart = - this.getRaceClock().getDurationMilli();
 
 
-        if (timeToStart > Constants.RacePreStartTime) {
+        if (timeToStart > racePreStartTime) {
             //Time > 3 minutes is the prestart period.
             this.setRaceStatusEnum(RaceStatusEnum.PRESTART);
 
-        } else if ((timeToStart <= Constants.RacePreStartTime) && (timeToStart >= Constants.RacePreparatoryTime)) {
+        } else if ((timeToStart <= racePreStartTime) && (timeToStart >= racePreparatoryTime)) {
             //Time between [1, 3] minutes is the warning period.
             this.setRaceStatusEnum(RaceStatusEnum.WARNING);
 
-        } else if ((timeToStart <= Constants.RacePreparatoryTime) && (timeToStart > 0)) {
+        } else if ((timeToStart <= racePreparatoryTime) && (timeToStart > 0)) {
             //Time between (0, 1] minutes is the preparatory period.
             this.setRaceStatusEnum(RaceStatusEnum.PREPARATORY);
 
@@ -183,6 +187,13 @@ public class MockRace extends RaceState {
 
     }
 
+    public void setRacePreStartTime(long racePreStartTime) {
+        this.racePreStartTime = racePreStartTime;
+    }
+
+    public void setRacePreparatoryTime(long racePreparatoryTime) {
+        this.racePreparatoryTime = racePreparatoryTime;
+    }
 
     /**
      * Sets the status of all boats in the race to RACING.
@@ -355,70 +366,24 @@ public class MockRace extends RaceState {
         //Checks if the current boat has finished the race or not.
         boolean finish = this.isLastLeg(boat.getCurrentLeg());
 
-        if (!finish && totalElapsedMilliseconds >= updatePeriodMilliseconds && boat.isSailsOut()) {
-
-            checkPosition(boat, totalElapsedMilliseconds);
-
-            if (boat.getCurrentSpeed() == 0) {
-                newOptimalVMG(boat);
-                boat.setBearing(boat.calculateBearingToNextMarker());
-            }
+        if (!finish && totalElapsedMilliseconds >= updatePeriodMilliseconds) {
 
-            setBoatSpeed(boat);
+            if(boat.isVelocityDefault()) setBoatSpeed(boat);
 
             //Calculates the distance travelled, in meters, in the current timeslice.
-            double distanceTravelledMeters = boat.calculateMetersTravelled(updatePeriodMilliseconds);
-
-            //Scale it.
-            distanceTravelledMeters = distanceTravelledMeters * this.scaleFactor;
-
+            double distanceTravelledMeters = boat.calculateMetersTravelled(updatePeriodMilliseconds) * this.scaleFactor;
 
+            checkPosition(boat, totalElapsedMilliseconds);
             //Move the boat forwards that many meters, and advances its time counters by enough milliseconds.
             boat.moveForwards(distanceTravelledMeters);
             boat.setTimeSinceTackChange(boat.getTimeSinceTackChange() + updatePeriodMilliseconds);
-
-            if (boat.getAutoVMG()) {
-                newOptimalVMG(boat);
-                boat.setAutoVMG(false);
-            }
-
-        } else {
-            boat.setCurrentSpeed(0);
         }
 
         this.updateEstimatedTime(boat);
 
     }
 
-    private void newOptimalVMG(MockBoat boat) {
-        long tackPeriod = 1000;
-        if (boat.getTimeSinceTackChange() > tackPeriod) {
-            //System.out.println("optim called");
-            //Calculate the new VMG.
-//            VMG newVMG = boat.getPolars().calculateVMG(
-//                    this.getWindDirection(),
-//                    this.getWindSpeed(),
-//                    boat.calculateBearingToNextMarker(),
-//                    Bearing.fromDegrees(0d),
-//                    Bearing.fromDegrees(359.99999d));
-
-            VMG newVMG = NewPolars.setBestVMG(this.getWindDirection(), this.getWindSpeed(), boat.getBearing());
-            //System.out.println(newVMG);
-            //If the new vmg improves velocity, use it.
-            /*if (improvesVelocity(boat, newVMG)) {
-            }*/
-            boat.setVMG(newVMG);
-        }
-    }
-
     private void setBoatSpeed(MockBoat boat) {
-//        VMG vmg = boat.getPolars().calculateVMG(
-//                this.getWindDirection(),
-//                this.getWindSpeed(),
-//                boat.getBearing(),
-//                Bearing.fromDegrees(boat.getBearing().degrees() - 1),
-//                Bearing.fromDegrees(boat.getBearing().degrees() + 1));
-        //VMG vmg = boat.getPolars().setBestVMG(this.getWindDirection(), this.getWindSpeed(), boat.getBearing());
         VMG vmg = new VMG(NewPolars.calculateSpeed(
                 this.getWindDirection(),
                 this.getWindSpeed(),
@@ -514,22 +479,28 @@ public class MockRace extends RaceState {
     /**
      * Checks to be run on boats rounding marks on the port side
      * @param boat the boat that is rounding a mark
-     * @param roundingChecks the checks to run
-     * @param legBearing the direction of the leg
+     * @param roundingData The data for the current leg's rounding.
      */
-    private void boatRoundingCheckPort(MockBoat boat, List<GPSCoordinate> roundingChecks, Bearing legBearing) {
+    private void boatRoundingCheckPort(MockBoat boat, MarkRoundingData roundingData) {
         //boats must pass all checks in order to round a mark
 
         //boolean for if boat has to/needs to pass through a gate
         boolean gateCheck = boat.getCurrentLeg().getEndCompoundMark().getMark2() == null || boat.isBetweenGate(boat.getCurrentLeg().getEndCompoundMark());
-        Mark roundingMark = boat.getCurrentLeg().getEndCompoundMark().getMarkForRounding(legBearing);
+
+
 
         switch (boat.getRoundingStatus()) {
             case 0://hasn't started rounding
-                if (boat.isPortSide(roundingMark) &&
-                        GPSCoordinate.passesLine(roundingMark.getPosition(),
-                                roundingChecks.get(0), boat.getPosition(), legBearing) &&
-                        gateCheck && boat.isBetweenGate(roundingMark, Mark.tempMark(roundingChecks.get(0)))) {
+                if (boat.isPortSide(roundingData.getMarkToRound()) &&
+                        GPSCoordinate.passesLine(
+                                roundingData.getMarkToRound().getPosition(),
+                                roundingData.getRoundCheck1(),
+                                boat.getPosition(),
+                                roundingData.getLegBearing()) &&
+                        gateCheck &&
+                        boat.isBetweenGate(
+                                roundingData.getMarkToRound(),
+                                Mark.tempMark(roundingData.getRoundCheck1()))   ) {
                     boat.increaseRoundingStatus();
                     if (boat.getCurrentLeg().getLegNumber() + 2 >= getLegs().size()){
                         //boat has finished race
@@ -538,11 +509,18 @@ public class MockRace extends RaceState {
                 }
                 break;
             case 1://has been parallel to the mark;
-                if (boat.isPortSide(roundingMark) &&
-                        GPSCoordinate.passesLine(roundingMark.getPosition(),
-                                roundingChecks.get(1), boat.getPosition(),
-                                Bearing.fromDegrees(legBearing.degrees() - 90)) &&//negative 90 from bearing because of port rounding
-                        boat.isBetweenGate(roundingMark, Mark.tempMark(roundingChecks.get(1)))) {
+                if (boat.isPortSide(roundingData.getMarkToRound()) &&
+                        GPSCoordinate.passesLine(
+                                roundingData.getMarkToRound().getPosition(),
+                                roundingData.getRoundCheck2(),
+                                boat.getPosition(),
+                                Bearing.fromDegrees(
+                                        GPSCoordinate.calculateBearing(
+                                                roundingData.getMarkToRound().getPosition(),
+                                                roundingData.getRoundCheck2()).degrees() - 90)) &&//negative 90 from bearing because of port rounding
+                        boat.isBetweenGate(
+                                roundingData.getMarkToRound(),
+                                Mark.tempMark(roundingData.getRoundCheck2()))) {
                     boat.increaseRoundingStatus();
                 }
                 break;
@@ -558,23 +536,27 @@ public class MockRace extends RaceState {
     /**
      * Checks to be run on boats rounding marks on the starboard side
      * @param boat the boat that is rounding a mark
-     * @param roundingChecks the checks to run
-     * @param legBearing the direction of the leg
+     * @param roundingData The data for the current leg's rounding.
      */
-    private void boatRoundingCheckStarboard(MockBoat boat, List<GPSCoordinate> roundingChecks, Bearing legBearing){
+    private void boatRoundingCheckStarboard(MockBoat boat, MarkRoundingData roundingData){
         //boats must pass all checks in order to round a mark
 
         //boolean for if boat has to/needs to pass through a gate
         boolean gateCheck = boat.getCurrentLeg().getEndCompoundMark().getMark2() == null || boat.isBetweenGate(boat.getCurrentLeg().getEndCompoundMark());
-        Mark roundingMark = boat.getCurrentLeg().getEndCompoundMark().getMarkForRounding(legBearing);
+
 
         switch (boat.getRoundingStatus()) {
             case 0://hasn't started rounding
-                if (boat.isStarboardSide(roundingMark) &&
-                        GPSCoordinate.passesLine(roundingMark.getPosition(),
-                                roundingChecks.get(0), boat.getPosition(), legBearing) &&
+                if (boat.isStarboardSide(roundingData.getMarkToRound()) &&
+                        GPSCoordinate.passesLine(
+                                roundingData.getMarkToRound().getPosition(),
+                                roundingData.getRoundCheck1(),
+                                boat.getPosition(),
+                                roundingData.getLegBearing()) &&
                         gateCheck &&
-                        boat.isBetweenGate(roundingMark, Mark.tempMark(roundingChecks.get(0)))) {
+                        boat.isBetweenGate(
+                                roundingData.getMarkToRound(),
+                                Mark.tempMark(roundingData.getRoundCheck1()))) {
                     boat.increaseRoundingStatus();
                     if (boat.getCurrentLeg().getLegNumber() + 2 >= getLegs().size()){
                         //boat has finished race
@@ -583,10 +565,18 @@ public class MockRace extends RaceState {
                 }
                 break;
             case 1://has been parallel to the mark
-                if (boat.isStarboardSide(roundingMark) &&
-                        GPSCoordinate.passesLine(roundingMark.getPosition(),
-                                roundingChecks.get(1), boat.getPosition(), Bearing.fromDegrees(legBearing.degrees() + 90)) && //positive 90 from bearing because of starboard rounding
-                        boat.isBetweenGate(roundingMark, Mark.tempMark(roundingChecks.get(1)))) {
+                if (boat.isStarboardSide(roundingData.getMarkToRound()) &&
+                        GPSCoordinate.passesLine(
+                                roundingData.getMarkToRound().getPosition(),
+                                roundingData.getRoundCheck2(),
+                                boat.getPosition(),
+                                Bearing.fromDegrees(
+                                        GPSCoordinate.calculateBearing(
+                                                roundingData.getMarkToRound().getPosition(),
+                                                roundingData.getRoundCheck2()  ).degrees() + 90)) && //positive 90 from bearing because of starboard rounding
+                        boat.isBetweenGate(
+                                roundingData.getMarkToRound(),
+                                Mark.tempMark(roundingData.getRoundCheck2()))   ) {
                     boat.increaseRoundingStatus();
                 }
                 break;
@@ -605,55 +595,19 @@ public class MockRace extends RaceState {
      * @param timeElapsed The total time, in milliseconds, that has elapsed since the race started.
      */
     protected void checkPosition(MockBoat boat, long timeElapsed) {
-        //The distance, in nautical miles, within which the boat needs to get in order to consider that it has reached the marker.
-        double epsilonNauticalMiles = boat.getCurrentLeg().getEndCompoundMark().getRoundingDistance(); //250 meters.
-
-        if (boat.calculateDistanceToNextMarker() < epsilonNauticalMiles) {
-            //Boat is within an acceptable distance from the mark.
-
-            GPSCoordinate startDirectionLinePoint = boat.getCurrentLeg().getStartCompoundMark().getMark1Position();
-            GPSCoordinate endDirectionLinePoint = boat.getCurrentLeg().getEndCompoundMark().getMark1Position();
-            Bearing bearingOfDirectionLine = GPSCoordinate.calculateBearing(startDirectionLinePoint, endDirectionLinePoint);
-
-            //use the direction line to create three invisible points that act as crossover lines a boat must cross
-            //to round a mark
-
-            double bearingToAdd;
-            if (boat.getCurrentLeg().getEndCompoundMark().getRoundingType() == RoundingType.Port ||
-                    boat.getCurrentLeg().getEndCompoundMark().getRoundingType() == RoundingType.SP){
-                bearingToAdd = 90;
-            }else{
-                bearingToAdd = -90;
-            }
-
-            GPSCoordinate roundCheck1 = GPSCoordinate.calculateNewPosition(endDirectionLinePoint,
-                    epsilonNauticalMiles, Azimuth.fromDegrees(bearingOfDirectionLine.degrees() + bearingToAdd));
-
-            GPSCoordinate roundCheck2;
-            try{
-                Leg nextLeg = getLegs().get(getLegs().indexOf(boat.getCurrentLeg()) + 1);
-
-                GPSCoordinate startNextDirectionLinePoint = nextLeg.getStartCompoundMark().getMark1Position();
-                GPSCoordinate endNextDirectionLinePoint = nextLeg.getEndCompoundMark().getMark1Position();
-                Bearing bearingOfNextDirectionLine = GPSCoordinate.calculateBearing(startNextDirectionLinePoint, endNextDirectionLinePoint);
-
-                roundCheck2 = GPSCoordinate.calculateNewPosition(endDirectionLinePoint,
-                        epsilonNauticalMiles, Azimuth.fromDegrees(bearingOfNextDirectionLine.degrees() + bearingToAdd));
-            }catch(NullPointerException e){
-                //this is caused by the last leg not being having a leg after it
-                roundCheck2 = roundCheck1;
-            }
-
-            List<GPSCoordinate> roundingChecks = new ArrayList<GPSCoordinate>(Arrays.asList(roundCheck1, roundCheck2));
 
         switch (boat.getCurrentLeg().getEndCompoundMark().getRoundingType()) {
             case SP://Not yet implemented so these gates will be rounded port side
             case Port:
-                    boatRoundingCheckPort(boat, roundingChecks, bearingOfDirectionLine);
+                boatRoundingCheckPort(
+                        boat,
+                        getMarkRoundingSequence().getRoundingData(boat.getCurrentLeg())  );
                 break;
             case PS://not yet implemented so these gates will be rounded starboard side
             case Starboard:
-                    boatRoundingCheckStarboard(boat, roundingChecks, bearingOfDirectionLine);
+                boatRoundingCheckStarboard(
+                        boat,
+                        getMarkRoundingSequence().getRoundingData(boat.getCurrentLeg())  );
                 break;
         }
 
@@ -669,8 +623,6 @@ public class MockRace extends RaceState {
 
     }
 
-    }
-
 
 
 
@@ -754,4 +706,18 @@ public class MockRace extends RaceState {
 
     }
 
+    /**
+     * Made public, so race logic can control it
+     */
+    public void setChanged() {
+        super.setChanged();
+    }
+
+    public void addVelocityCommand(ObserverCommand c) {
+        this.activeObserverCommand.changeVelocityCommand(this, c);
+    }
+
+    public void addAngularCommand(ObserverCommand c) {
+        this.activeObserverCommand.changeAngularCommand(this, c);
+    }
 }

racevisionGame/src/main/java/mock/model/NewPolars.java

@@ -145,8 +145,6 @@ public class NewPolars {
      * @return the best vmg that the boat can change to
      */
     public static VMG setBestVMG(Bearing trueWindAngle, double trueWindSpeed, Bearing boatAngle){
-        //System.out.println("VMG AUTO CALLED");
-        //speed
         double closestSpeed = getClosest(trueWindSpeed, polars.keySet());
 
         double angle = modulateAngle(boatAngle.degrees() - trueWindAngle.degrees());
@@ -181,15 +179,29 @@ public class NewPolars {
 
     }
 
+    /**
+     * gets the angle bound between 0 and 360 following modular arithmetic
+     * @param angle angle to modulate
+     * @return resultant angle after modulation.
+     */
     public static double modulateAngle(double angle){
         return (angle % 360 + 360) % 360;
     }
 
+    /**
+     * DO NOT DELETE THIS FUNCTIONS THEY ARE USED FOR TESTING PURPOSES
+     * @return current polars map
+     */
+    @SuppressWarnings("unused")
     private Map<Double, TreeMap<Double, Double>> getPolars(){
         //this function is just for testing so therefore it is private
         return polars;
     }
 
+    /**
+     * DO NOT DELETE THESE FUNCTIONS THEY ARE USED FOR TESTING PURPOSES
+     */
+    @SuppressWarnings("unused")
     private void printOutLinearInterpolated(){
         for (double tws: polars.keySet()){
             System.out.println("==================================================");

racevisionGame/src/main/java/mock/model/RaceLogic.java

@@ -2,6 +2,7 @@ package mock.model;
 
 import javafx.animation.AnimationTimer;
 import mock.model.collider.Collision;
+import mock.model.commandFactory.CollisionCommand;
 import mock.model.commandFactory.Command;
 import mock.model.commandFactory.CompositeCommand;
 import mock.model.commandFactory.CommandFactory;
@@ -151,6 +152,10 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
             // Execute commands from clients.
             commands.execute();
 
+            // Notify Observers
+            race.setChanged();
+            race.notifyObservers();
+
             //Update race time.
             race.updateRaceTime(currentTime);
 
@@ -234,11 +239,9 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
 
     @Override
     public void update(Observable o, Object arg) {
-        Collision e = (Collision)arg;
-
-//        if(e.getBearing().degrees() == 0) System.out.println("Ahead");
-//        else if(e.getBearing().degrees() < 90) System.out.println("Starboard");
-//        else if(e.getBearing().degrees() > 270) System.out.println("Port");
-//        else System.out.println("Behind");
+        if(arg instanceof Collision) {
+            Collision collision = (Collision)arg;
+            commands.addCommand(new CollisionCommand(race, (MockBoat)collision.getBoat()));
+        }
     }
 }

racevisionGame/src/main/java/mock/model/RaceServer.java

@@ -24,6 +24,7 @@ import java.util.logging.Logger;
 public class RaceServer {
     private MockRace race;
     private LatestMessages latestMessages;
+    private static RaceServer server;
     private List<YachtEvent> collisionEvents = new ArrayList<>();
 
 
@@ -49,10 +50,17 @@ public class RaceServer {
 
 
     public RaceServer(MockRace race, LatestMessages latestMessages) {
+        server = this;
         this.race = race;
         this.latestMessages = latestMessages;
     }
 
+    public static void staticUpdateXML() {
+        if (server != null) {
+            server.updateXMLFiles();
+        }
+    }
+
     /**
      * Parses the race to create a snapshot, and places it in latestMessages.
      */
@@ -84,7 +92,6 @@ public class RaceServer {
 
     }
 
-
     /**
      * Checks if the race/boat/regatta data sources have changed, and if they have, update their xml representations.
      */

racevisionGame/src/main/java/mock/model/SourceIdAllocator.java

@@ -38,7 +38,7 @@ public class SourceIdAllocator {
 
         if (!((mockRace.getRaceStatusEnum() == RaceStatusEnum.PRESTART)
                 || (mockRace.getRaceStatusEnum() == RaceStatusEnum.WARNING))) {
-            throw new SourceIDAllocationException("Could not allocate a source ID. Can only allocate during pre-start period. It is currently: " + mockRace.getRaceStatusEnum());
+            throw new SourceIDAllocationException("Could not allocate a source ID. Can only allocate during pre-start or warning period. It is currently: " + mockRace.getRaceStatusEnum());
         }
 
         List<Integer> allocatedIDs = mockRace.getRaceDataSource().getParticipants();

racevisionGame/src/main/java/mock/model/collider/Collider.java

@@ -25,15 +25,9 @@ public abstract class Collider extends Observable implements Locatable {
         Bearing relative = Bearing.fromDegrees(absolute.degrees() - boat.getBearing().degrees());
 
         if(actualDistance <= distance) {
-            Collision collision = new Collision(relative, distance);
+            Collision collision = new Collision(boat, relative, distance);
             // Notify object of collision
-            onCollisionEnter(boat, collision);
-            // Notify observers of collision
-            notifyObservers(collision);
-            this.setChanged();
-
-            //Send out packet to all boats
-
+            onCollisionEnter(collision);
             return true;
         } else return false;
     }
@@ -47,8 +41,7 @@ public abstract class Collider extends Observable implements Locatable {
 
     /**
      * Handle a collision event
-     * @param collider Boat that is colliding
      * @param e details of collision
      */
-    public abstract void onCollisionEnter(Boat collider, Collision e);
+    public abstract void onCollisionEnter(Collision e);
 }

racevisionGame/src/main/java/mock/model/collider/ColliderRegistry.java

@@ -1,5 +1,6 @@
 package mock.model.collider;
 
+import mock.model.MockBoat;
 import shared.model.Boat;
 import shared.model.GPSCoordinate;
 
@@ -39,7 +40,7 @@ public class ColliderRegistry extends Collider implements Observer {
     }
 
     @Override
-    public void onCollisionEnter(Boat collider, Collision e) {}
+    public void onCollisionEnter(Collision e) {}
 
     @Override
     public GPSCoordinate getPosition() {
@@ -60,7 +61,7 @@ public class ColliderRegistry extends Collider implements Observer {
     public void update(Observable o, Object arg) {
         Collision collision = (Collision)arg;
 
-        notifyObservers(collision);
         this.setChanged();
+        notifyObservers(collision);
     }
 }

racevisionGame/src/main/java/mock/model/collider/Collision.java

@@ -1,6 +1,7 @@
 package mock.model.collider;
 
 import shared.model.Bearing;
+import shared.model.Boat;
 
 /**
  * Data structure for holding collision details for ray casting and event handling.
@@ -14,13 +15,19 @@ public class Collision {
      * Distance from boat centre to target centre
      */
     private double distance;
+    /**
+     * Boat involved in the collision
+     */
+    private Boat boat;
 
     /**
      * Constructor for Collision structure
+     * @param boat involved in collision
      * @param bearing from boat heading to target
      * @param distance from boat centre to target centre
      */
-    public Collision(Bearing bearing, double distance) {
+    public Collision(Boat boat, Bearing bearing, double distance) {
+        this.boat = boat;
         this.bearing = bearing;
         this.distance = distance;
     }
@@ -32,4 +39,8 @@ public class Collision {
     public double getDistance() {
         return distance;
     }
+
+    public Boat getBoat() {
+        return boat;
+    }
 }

racevisionGame/src/main/java/mock/model/commandFactory/ActiveObserverCommand.java

@@ -0,0 +1,27 @@
+package mock.model.commandFactory;
+
+import java.util.Observable;
+
+/**
+ * Used to track the current active observer command. This is to ensure two commands that do similar things do not overlap.
+ */
+public class ActiveObserverCommand {
+    private ObserverCommand currentVelocityCommand;
+    private ObserverCommand currentAngularCommand;
+
+    public ActiveObserverCommand() {
+
+    }
+
+    public void changeVelocityCommand(Observable o, ObserverCommand c) {
+        o.deleteObserver(currentVelocityCommand);
+        o.addObserver(c);
+        currentVelocityCommand = c;
+    }
+
+    public void changeAngularCommand(Observable o, ObserverCommand c) {
+        o.deleteObserver(currentAngularCommand);
+        o.addObserver(c);
+        currentAngularCommand = c;
+    }
+}

racevisionGame/src/main/java/mock/model/commandFactory/CollisionCommand.java

@@ -0,0 +1,45 @@
+package mock.model.commandFactory;
+
+import mock.model.MockBoat;
+import mock.model.MockRace;
+import shared.model.Azimuth;
+import shared.model.GPSCoordinate;
+
+import java.util.Observable;
+
+/**
+ * Command class for collisions
+ */
+public class CollisionCommand extends ObserverCommand {
+    private GPSCoordinate startingPosition;
+    private Azimuth azimuth;
+    private double distance;
+
+    /**
+     * Constructor for class
+     * @param race race context
+     * @param boat boat controlled by command
+     */
+    public CollisionCommand(MockRace race, MockBoat boat) {
+        super(race, boat);
+        race.addObserver(this);
+    }
+
+    @Override
+    public void execute() {
+        this.azimuth = Azimuth.fromDegrees(boat.getBearing().degrees() - 180d);
+        this.startingPosition = boat.getPosition();
+        this.distance = 30;
+        boat.setVelocityDefault(false);
+    }
+
+    @Override
+    public void update(Observable o, Object arg) {
+        if(GPSCoordinate.calculateDistanceMeters(boat.getPosition(), startingPosition) < distance) {
+            boat.setPosition(GPSCoordinate.calculateNewPosition(boat.getPosition(), 2, azimuth));
+        } else {
+            race.deleteObserver(this);
+            boat.setVelocityDefault(true);
+        }
+    }
+}

racevisionGame/src/main/java/mock/model/commandFactory/Command.java

@@ -3,6 +3,8 @@ package mock.model.commandFactory;
 import mock.model.MockBoat;
 import mock.model.MockRace;
 
+import java.util.Observer;
+
 /**
  * Allows RaceLogic to control MockRace state according to the Command pattern
  */

racevisionGame/src/main/java/mock/model/commandFactory/ObserverCommand.java

@@ -0,0 +1,20 @@
+package mock.model.commandFactory;
+
+import mock.model.MockBoat;
+import mock.model.MockRace;
+
+import java.util.Observer;
+
+/**
+ * Command that can observe the race
+ */
+public abstract class ObserverCommand implements Command, Observer {
+    MockRace race;
+    MockBoat boat;
+
+    public ObserverCommand(MockRace race, MockBoat boat) {
+        this.race = race;
+        this.boat = boat;
+        boat.setAutoVMG(false);
+    }
+}

racevisionGame/src/main/java/mock/model/commandFactory/SailsCommand.java

@@ -2,20 +2,50 @@ package mock.model.commandFactory;
 
 import mock.model.MockBoat;
 import mock.model.MockRace;
+import mock.model.NewPolars;
+import mock.model.VMG;
 
-public class SailsCommand implements Command {
-    private MockRace race;
-    private MockBoat boat;
+import java.util.Observable;
+
+public class SailsCommand extends ObserverCommand {
     private boolean sailsOut;
+    private double goalVelocity;
 
-    public SailsCommand(MockRace race, MockBoat boat, Boolean sailsOut) {
-        this.race = race;
-        this.boat = boat;
+    public SailsCommand(MockRace race, MockBoat boat, boolean sailsOut) {
+        super(race, boat);
+        race.addVelocityCommand(this);
         this.sailsOut = sailsOut;
     }
 
     @Override
     public void execute() {
         this.boat.setSailsOut(this.sailsOut);
+        boat.setVelocityDefault(false);
+
+        if(sailsOut) {
+            // Accelerate to VMG speed
+            double polarSpeed = NewPolars.calculateSpeed(race.getWindDirection(), race.getWindSpeed(), boat.getBearing());
+            VMG vmg = new VMG(polarSpeed, boat.getBearing());
+            goalVelocity = vmg.getSpeed();
+        } else {
+            // Decelerate to 0
+            goalVelocity = 0;
+        }
+    }
+
+    @Override
+    public void update(Observable o, Object arg) {
+        double acceleration = 0.5;
+
+        if(sailsOut && boat.getCurrentSpeed() < goalVelocity) {
+            boat.setCurrentSpeed(Math.min(goalVelocity, boat.getCurrentSpeed() + acceleration));
+        } else if (!sailsOut && boat.getCurrentSpeed() > goalVelocity) {
+            // Apply deceleration to strictly 0 speed
+            boat.setCurrentSpeed(Math.max(0, boat.getCurrentSpeed() - acceleration));
+        } else {
+            // Release boat from SailsCommand control
+            if(sailsOut) boat.setVelocityDefault(true);
+            race.deleteObserver(this);
+        }
     }
 }

racevisionGame/src/main/java/mock/model/commandFactory/TackGybeCommand.java

@@ -4,12 +4,16 @@ import mock.model.MockBoat;
 import mock.model.MockRace;
 import shared.model.Bearing;
 
+import java.util.Observable;
+
 /**
  * Command class for tacking and gybing
  */
-public class TackGybeCommand implements Command {
-    private MockRace race;
-    private MockBoat boat;
+public class TackGybeCommand extends ObserverCommand {
+    private double goalRotation;
+    private double totalRotation = 0;
+    private int direction;  // -1 for anticlockwise, 1 for clockwise
+    private double goalAngle;
 
     /**
      * Constructor for class
@@ -17,24 +21,32 @@ public class TackGybeCommand implements Command {
      * @param boat mock boat to update
      */
     public TackGybeCommand(MockRace race, MockBoat boat) {
-        this.race = race;
-        this.boat = boat;
+        super(race, boat);
+        race.addAngularCommand(this);
     }
 
     @Override
     public void execute() {
-
-        boat.setAutoVMG(false);
-
         double boatAngle = boat.getBearing().degrees();
         double windAngle = race.getWindDirection().degrees();
         double differenceAngle = calcDistance(boatAngle, windAngle);
         double angleA = windAngle + differenceAngle;
         double angleB = windAngle - differenceAngle;
         if (angleA % 360 == boatAngle) {
-            boat.setBearing(Bearing.fromDegrees(angleB));
+            goalAngle = angleB % 360;
         } else {
-            boat.setBearing(Bearing.fromDegrees(angleA));
+            goalAngle = angleA % 360;
+        }
+
+        goalRotation = goalAngle - boatAngle;
+        if (goalRotation < 0) {
+            goalRotation += 360;
+        }
+        if (goalRotation > 180) {
+            goalRotation = 360 - goalRotation;
+            direction = -1;
+        } else {
+            direction = 1;
         }
     }
 
@@ -49,5 +61,16 @@ public class TackGybeCommand implements Command {
         return phi > 180 ? 360 - phi : phi;
     }
 
+    @Override
+    public void update(Observable o, Object arg) {
+        double offset = 3.0;
+        if (totalRotation < goalRotation) {
+            boat.setBearing(Bearing.fromDegrees(boat.getBearing().degrees() + offset * direction));
+            totalRotation += offset;
+        } else {
+            boat.setBearing(Bearing.fromDegrees(goalAngle));
+            race.deleteObserver(this);
+        }
+    }
 }
 

racevisionGame/src/main/java/mock/model/commandFactory/VMGCommand.java

@@ -2,13 +2,20 @@ package mock.model.commandFactory;
 
 import mock.model.MockBoat;
 import mock.model.MockRace;
+import mock.model.NewPolars;
+import mock.model.VMG;
+import shared.model.Bearing;
+
+import java.util.Observable;
 
 /**
  * Command class for autoVMG
  */
-public class VMGCommand implements Command {
-    private MockRace race;
-    private MockBoat boat;
+public class VMGCommand extends ObserverCommand {
+    private double goalAngle;
+    private double goalRotation;
+    private double totalRotation = 0;
+    private int direction;
 
     /**
      * Constructor for class
@@ -16,8 +23,8 @@ public class VMGCommand implements Command {
      * @param boat mock boat to update
      */
     public VMGCommand(MockRace race, MockBoat boat) {
-        this.race = race;
-        this.boat = boat;
+        super(race, boat);
+        race.addAngularCommand(this);
     }
 
     @Override
@@ -27,5 +34,37 @@ public class VMGCommand implements Command {
         } else {
             boat.setAutoVMG(true);
         }
+        newOptimalVMG(boat);
+
+        goalRotation = goalAngle - boat.getBearing().degrees();
+        if (goalRotation < 0) {
+            goalRotation += 360;
+        }
+        if (goalRotation > 180) {
+            goalRotation = 360 - goalRotation;
+            direction = -1;
+        } else {
+            direction = 1;
+        }
+    }
+
+    private void newOptimalVMG(MockBoat boat) {
+        long tackPeriod = 1000;
+        if (boat.getTimeSinceTackChange() > tackPeriod) {
+            VMG newVMG = NewPolars.setBestVMG(race.getWindDirection(), race.getWindSpeed(), boat.getBearing());
+            goalAngle = newVMG.getBearing().degrees();
+        }
+    }
+
+    @Override
+    public void update(Observable o, Object arg) {
+        double offset = 3.0;
+        if (totalRotation < goalRotation) {
+            boat.setBearing(Bearing.fromDegrees(boat.getBearing().degrees() + offset * direction));
+            totalRotation += offset;
+        } else {
+            boat.setBearing(Bearing.fromDegrees(goalAngle));
+            race.deleteObserver(this);
+        }
     }
 }

racevisionGame/src/main/java/mock/model/commandFactory/WindCommand.java

@@ -4,17 +4,23 @@ import mock.model.MockBoat;
 import mock.model.MockRace;
 import shared.model.Bearing;
 
+import java.util.Observable;
+
 /**
- * Created by connortaylorbrown on 4/08/17.
+ * Command class for upwind and downwind controls
  */
-public class WindCommand implements Command {
-    private MockRace race;
-    private MockBoat boat;
+public class WindCommand extends ObserverCommand {
     private int direction;
 
+    /**
+     * Constructor for class
+     * @param race race context
+     * @param boat boat controlled by command
+     * @param upwind if true, downwind if false
+     */
     public WindCommand(MockRace race, MockBoat boat, boolean upwind) {
-        this.race = race;
-        this.boat = boat;
+        super(race, boat);
+        race.addAngularCommand(this);
         this.direction = upwind? -1 : 1;
     }
 
@@ -34,4 +40,9 @@ public class WindCommand implements Command {
 
         boat.setBearing(Bearing.fromDegrees(heading + offset));
     }
+
+    @Override
+    public void update(Observable o, Object arg) {
+        race.deleteObserver(this);
+    }
 }

racevisionGame/src/main/java/mock/model/wind/ShiftingWindGenerator.java

@@ -105,7 +105,6 @@ public class ShiftingWindGenerator implements WindGenerator {
             if (shiftedSoFar >= 180){
                 shiftAnticlockwise = Math.random() > 0.5;
                 shiftedSoFar = 0;
-//                System.out.println("Swapping");
             }
 
             timeOfLastShift = System.currentTimeMillis();

racevisionGame/src/main/java/mock/xml/RaceXMLCreator.java

@@ -1,34 +1,23 @@
 package mock.xml;
 
-import org.w3c.dom.Document;
 import org.xml.sax.SAXException;
 import shared.dataInput.RaceXMLReader;
 import shared.enums.XMLFileType;
 import shared.exceptions.InvalidRaceDataException;
 import shared.exceptions.XMLReaderException;
-import shared.model.*;
-import shared.xml.Race.*;
+import shared.model.CompoundMark;
+import shared.model.Constants;
+import shared.model.GPSCoordinate;
+import shared.xml.Race.XMLCompoundMark;
+import shared.xml.Race.XMLLimit;
+import shared.xml.Race.XMLMark;
+import shared.xml.Race.XMLRace;
 import shared.xml.XMLUtilities;
 
-import javax.xml.XMLConstants;
-import javax.xml.bind.JAXBContext;
 import javax.xml.bind.JAXBException;
-import javax.xml.bind.Marshaller;
-import javax.xml.bind.Unmarshaller;
-import javax.xml.bind.util.JAXBSource;
-import javax.xml.parsers.DocumentBuilder;
-import javax.xml.parsers.DocumentBuilderFactory;
 import javax.xml.parsers.ParserConfigurationException;
-import javax.xml.transform.Source;
-import javax.xml.transform.dom.DOMSource;
-import javax.xml.validation.Schema;
-import javax.xml.validation.SchemaFactory;
-import javax.xml.validation.Validator;
-import java.io.File;
 import java.io.IOException;
-import java.io.StringWriter;
-import java.math.BigInteger;
-import java.net.URL;
+import java.io.InputStream;
 import java.time.ZonedDateTime;
 import java.time.format.DateTimeFormatter;
 
@@ -64,33 +53,54 @@ public class RaceXMLCreator {
 
     /**
      * Rotates the race in a specified direction.
-     * @param s xml file name
+     * @param s xml file name or contents.
+     * @param fileType Whether s is a file name or contents.
      * @param degrees degrees to rotate
+     * @param tutorial Whether we wish to run the tutorial - this changes the race start time.
      * @return the new xml file as a string
      * @throws XMLReaderException if the xml is not readable
      * @throws InvalidRaceDataException if the race is invalid
-     * @throws JAXBException if the Race class cannot be parsed into a xml.
-     * @throws IOException if the schema file cannot be found
-     * @throws SAXException error in schema file
-     * @throws ParserConfigurationException error in parsing the schema file
      */
-    public static String alterRaceToWind(String s, double degrees) throws XMLReaderException, InvalidRaceDataException, JAXBException, IOException, SAXException, ParserConfigurationException {
-        RaceXMLReader reader = new RaceXMLReader(s, XMLFileType.ResourcePath);
+    public static String alterRaceToWind(String s, XMLFileType fileType, double degrees, boolean tutorial) throws XMLReaderException, InvalidRaceDataException {
+
+        RaceXMLReader reader = new RaceXMLReader(s, fileType);
+
+        try {
 
             XMLRace race = XMLUtilities.xmlToClass(
-                RaceXMLCreator.class.getClassLoader().getResourceAsStream(s),
+                    s,
                     RaceXMLCreator.class.getClassLoader().getResource("mock/mockXML/schema/raceSchema.xsd"),
                     XMLRace.class);
 
+            if(tutorial){
+                setRaceXMLAtCurrentTimeToNow(race, 1000l, 5000l);
+            } else {
                 setRaceXMLAtCurrentTimeToNow(race);
+            }
+
+
+            CompoundMark leewardGate = getLeewardGate(reader);
+            CompoundMark windwardGate = getWindwardGate(reader);
+
+            double raceOriginalBearing = 0;
 
-        double raceOriginalBearing = getLineAngle(getLeewardGate(reader).getMark1Position(), getWindwardGate(reader).getMark1Position());
+            /*if (leewardGate != null && windwardGate != null) {
+                raceOriginalBearing = getLineAngle(
+                        leewardGate.getMark1Position(),
+                        windwardGate.getMark1Position() );
+            }*/
 
             double degreesToRotate = degrees - raceOriginalBearing;
 
+            if (degrees >= 0) {
                 alterRaceRotation(race, degreesToRotate);
+            }
 
             return XMLUtilities.classToXML(race);
+
+        } catch (ParserConfigurationException | IOException | SAXException | JAXBException e) {
+            throw new InvalidRaceDataException("Could not parse or marshall race data file.", e);
+        }
     }
 
     /**
@@ -180,17 +190,12 @@ public class RaceXMLCreator {
     }
 
 
-    /**
-     * Sets the xml description of the race to show the race was created now, and starts in 4 minutes
-     * @param raceXML The race.xml contents.
-     */
-    public static void setRaceXMLAtCurrentTimeToNow(XMLRace raceXML) {
 
+
+    public static void setRaceXMLAtCurrentTimeToNow(XMLRace raceXML, long racePrestartTime, long racePreparatoryTime){
         //The start time is current time + 4 minutes. prestart is 3 minutes, and we add another minute.
-        long millisecondsToAdd = Constants.RacePreStartTime + 1 * 60 * 1000;
+        long millisecondsToAdd = racePrestartTime + racePreparatoryTime;
         long secondsToAdd = millisecondsToAdd / 1000;
-        //Scale the time using our time scalar.
-        secondsToAdd = secondsToAdd / Constants.RaceTimeScale;
 
         DateTimeFormatter dateFormat = DateTimeFormatter.ofPattern("yyyy-MM-dd'T'HH:mm:ssZ");
         ZonedDateTime creationTime = ZonedDateTime.now();
@@ -198,4 +203,13 @@ public class RaceXMLCreator {
         raceXML.getRaceStartTime().setTime(dateFormat.format(creationTime.plusSeconds(secondsToAdd)));
     }
 
+    /**
+     * Sets the xml description of the race to show the race was created now, and starts in 4 minutes
+     * @param raceXML The race.xml contents.
+     */
+    public static void setRaceXMLAtCurrentTimeToNow(XMLRace raceXML) {
+        setRaceXMLAtCurrentTimeToNow(raceXML, Constants.RacePreStartTime, Constants.RacePreparatoryTime);
+
+    }
+
 }

racevisionGame/src/main/java/network/MessageDecoders/HostGameMessageDecoder.java

@@ -0,0 +1,64 @@
+package network.MessageDecoders;
+
+import network.Exceptions.InvalidMessageException;
+import network.Messages.AC35Data;
+import network.Messages.CourseWinds;
+import network.Messages.Enums.RaceStatusEnum;
+import network.Messages.HostGame;
+import network.Messages.RaceStatus;
+
+import java.util.Arrays;
+
+import static network.Utils.ByteConverter.bytesToInt;
+import static network.Utils.ByteConverter.bytesToLong;
+
+public class HostGameMessageDecoder implements MessageDecoder {
+
+    /**
+     * The encoded message.
+     */
+    private byte[] encodedMessage;
+
+    /**
+     * The decoded message.
+     */
+    private HostGame message;
+
+    /**
+     * Constructor
+     */
+    public HostGameMessageDecoder() {
+    }
+
+    @Override
+    public AC35Data decode(byte[] encodedMessage) throws InvalidMessageException {
+        this.encodedMessage = encodedMessage;
+
+        try{
+            byte ipPart1 = encodedMessage[0];
+            byte ipPart2 = encodedMessage[1];
+            byte ipPart3 = encodedMessage[2];
+            byte ipPart4 = encodedMessage[3];
+            String ipString = bytesToLong(ipPart1) + "." + bytesToLong(ipPart2) + "." + bytesToLong(ipPart3) + "." + bytesToLong(ipPart4);
+//            System.out.println(ipString);
+            int port = bytesToInt(Arrays.copyOfRange(encodedMessage, 4, 8));
+            byte map = encodedMessage[8];
+            byte speed = encodedMessage[9];
+            byte status = encodedMessage[10];
+            byte requiredNumPlayers = encodedMessage[11];
+            byte currentNumPlayers = encodedMessage[12];
+
+
+            message = new HostGame(ipString, port, map,
+                    speed, RaceStatusEnum.fromByte(status),
+                    requiredNumPlayers, currentNumPlayers);
+
+            return message;
+
+        } catch (Exception e) {
+            throw new InvalidMessageException("Could not decode Host game message.", e);
+        }
+    }
+
+
+}

racevisionGame/src/main/java/network/MessageDecoders/HostedGamesRequestDecoder.java

@@ -0,0 +1,35 @@
+package network.MessageDecoders;
+
+import network.Exceptions.InvalidMessageException;
+import network.Messages.AC35Data;
+import network.Messages.HostGame;
+import network.Messages.HostGamesRequest;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.List;
+
+import static network.Utils.ByteConverter.bytesToInt;
+
+public class HostedGamesRequestDecoder  implements MessageDecoder{
+    @Override
+    public AC35Data decode(byte[] encodedMessage) throws InvalidMessageException {
+        try{
+            int numberOfGames = bytesToInt(Arrays.copyOfRange(encodedMessage, 0, 4));
+
+            HostGameMessageDecoder lineDecoder = new HostGameMessageDecoder();
+            List<HostGame> knownGames = new ArrayList<>();
+            int byteIndex = 4;
+            for (int i = 0; i < numberOfGames; i++){
+                knownGames.add((HostGame) lineDecoder.decode(Arrays.copyOfRange(encodedMessage, byteIndex, byteIndex+13)));
+                byteIndex += 13;
+            }
+
+            return new HostGamesRequest(knownGames);
+
+        } catch (Exception e) {
+            e.printStackTrace();
+            throw new InvalidMessageException("Could not decode Host game message.", e);
+        }
+    }
+}

racevisionGame/src/main/java/network/MessageEncoders/HostGameMessageEncoder.java

@@ -0,0 +1,52 @@
+package network.MessageEncoders;
+
+import network.Exceptions.InvalidMessageException;
+import network.Messages.AC35Data;
+import network.Messages.HostGame;
+
+import java.nio.ByteBuffer;
+
+import static network.Utils.ByteConverter.intToBytes;
+
+
+public class HostGameMessageEncoder implements MessageEncoder{
+
+    /**
+     * Constructor
+     */
+    public HostGameMessageEncoder() {
+    }
+
+    @Override
+    public byte[] encode(AC35Data message) throws InvalidMessageException {
+        try{
+            //Downcast
+            HostGame hostGame = (HostGame) message;
+
+            ByteBuffer hostGameMessage = ByteBuffer.allocate(13);
+
+            ByteBuffer ipBytes = ByteBuffer.allocate(4);
+            String ip = hostGame.getIp();
+            String[] ipValues = ip.split("\\.");
+            for(String value:ipValues){
+                ipBytes.put(intToBytes(Integer.parseInt(value), 1)[0]);
+            }
+            byte raceStatus = hostGame.getStatus().getValue();
+
+            hostGameMessage.put(ipBytes.array());
+            hostGameMessage.put(intToBytes(hostGame.getPort()));
+            hostGameMessage.put(hostGame.getMap());
+            hostGameMessage.put(hostGame.getSpeed());
+            hostGameMessage.put(raceStatus);
+            hostGameMessage.put(hostGame.getRequiredNumPlayers());
+            hostGameMessage.put(hostGame.getCurrentNumPlayers());
+
+
+//            System.out.println(hostGameMessage.array()[4]);
+            return hostGameMessage.array();
+
+        } catch (Exception e) {
+            throw new InvalidMessageException("Could not encode Host game message.", e);
+        }
+    }
+}

racevisionGame/src/main/java/network/MessageEncoders/HostedGamesRequestEncoder.java

@@ -0,0 +1,43 @@
+package network.MessageEncoders;
+
+import network.Exceptions.InvalidMessageException;
+import network.Messages.AC35Data;
+import network.Messages.HostGame;
+import network.Messages.HostGamesRequest;
+
+import java.nio.ByteBuffer;
+
+import static network.Utils.ByteConverter.intToBytes;
+
+public class HostedGamesRequestEncoder implements MessageEncoder{
+
+    /**
+     * Constructor
+     */
+    public HostedGamesRequestEncoder() {
+    }
+
+    @Override
+    public byte[] encode(AC35Data message) throws InvalidMessageException {
+        try{
+            //Downcast
+            HostGamesRequest hostGamesRequest = (HostGamesRequest) message;
+
+            int numGames = hostGamesRequest.getKnownGames().size();
+
+            ByteBuffer hostedGamesRequestMessage = ByteBuffer.allocate(4+13*numGames);
+
+            hostedGamesRequestMessage.put(intToBytes(numGames));
+
+            HostGameMessageEncoder lineEncoder = new HostGameMessageEncoder();
+            for (HostGame line: hostGamesRequest.getKnownGames()) {
+                hostedGamesRequestMessage.put(lineEncoder.encode(line));
+            }
+
+            return hostedGamesRequestMessage.array();
+
+        }catch(Exception e){
+            throw new InvalidMessageException("Could not encode Host game message.", e);
+        }
+    }
+}

racevisionGame/src/main/java/network/Messages/Enums/MessageType.java

@@ -39,6 +39,10 @@ public enum MessageType {
      */
     ASSIGN_PLAYER_BOAT(121),
 
+    HOST_GAME(108),
+
+    HOSTED_GAMES_REQUEST(109),
+
     NOTAMESSAGE(0);
 
 

racevisionGame/src/main/java/network/Messages/HostGame.java

@@ -0,0 +1,89 @@
+package network.Messages;
+
+
+import network.Messages.Enums.MessageType;
+import network.Messages.Enums.RaceStatusEnum;
+import network.Utils.ByteConverter;
+
+import java.nio.ByteBuffer;
+
+import static network.Utils.ByteConverter.intToBytes;
+
+public class HostGame extends AC35Data {
+
+    private String ip;
+    private int port;
+    private byte map;
+    private byte speed;
+    private RaceStatusEnum status;
+    private byte requiredNumPlayers;
+    private byte currentNumPlayers;
+
+    public HostGame(String ip, int port, byte map, byte speed,
+                    RaceStatusEnum status, byte requiredNumPlayers,
+                    byte currentNumPlayers) {
+        super(MessageType.HOST_GAME);
+        this.ip = ip;
+        this.port = port;
+        this.map = map;
+        this.speed = speed;
+        this.status = status;
+        this.requiredNumPlayers = requiredNumPlayers;
+        this.currentNumPlayers = currentNumPlayers;
+
+    }
+
+    /**
+     * @return the ip of host
+     */
+    public String getIp() {
+        return ip;
+    }
+
+    /**
+     * @return the port of host
+     */
+    public int getPort() {
+        return port;
+    }
+
+    /**
+     * @return the map index
+     */
+    public byte getMap() {
+        return map;
+    }
+
+    /**
+     * @return the speed value of game
+     */
+    public byte getSpeed() {
+        return speed;
+    }
+
+    /**
+     * @return the status of race
+     */
+    public RaceStatusEnum getStatus() {
+        return status;
+    }
+
+    /**
+     * @return required number of players
+     */
+    public byte getRequiredNumPlayers() {
+        return requiredNumPlayers;
+    }
+
+    /**
+     * @return current number of players
+     */
+    public byte getCurrentNumPlayers() {
+        return currentNumPlayers;
+    }
+
+    public void setIp(String ip) {
+        this.ip = ip;
+    }
+}
+

racevisionGame/src/main/java/network/Messages/HostGamesRequest.java

@@ -0,0 +1,23 @@
+package network.Messages;
+
+import network.Messages.Enums.MessageType;
+
+import java.util.List;
+
+public class HostGamesRequest extends AC35Data{
+
+    private List<HostGame> knownGames;
+
+    /**
+     * Constructor
+     * @param knownGames games known by sender
+     */
+    public HostGamesRequest(List knownGames) {
+        super(MessageType.HOSTED_GAMES_REQUEST);
+        this.knownGames = knownGames;
+    }
+
+    public List<HostGame> getKnownGames() {
+        return knownGames;
+    }
+}

racevisionGame/src/main/java/network/Messages/LatestMessages.java

@@ -1,5 +1,6 @@
 package network.Messages;
 
+import mock.model.RaceServer;
 import network.Messages.Enums.XMLMessageType;
 
 import java.util.*;
@@ -33,9 +34,6 @@ public class LatestMessages extends Observable {
     private XMLMessage regattaXMLMessage;
 
 
-
-
-
     /**
      * Ctor.
      */
@@ -45,6 +43,7 @@ public class LatestMessages extends Observable {
 
     /**
      * Returns a copy of the race snapshot.
+     *
      * @return Copy of the race snapshot.
      */
     public List<AC35Data> getSnapshot() {
@@ -54,6 +53,7 @@ public class LatestMessages extends Observable {
 
     /**
      * Sets the snapshot of the race.
+     *
      * @param snapshot New snapshot of race.
      */
     public void setSnapshot(List<AC35Data> snapshot) {
@@ -61,12 +61,9 @@ public class LatestMessages extends Observable {
     }
 
 
-
-
-
-
     /**
      * Returns the latest race xml message.
+     *
      * @return The latest race xml message.
      */
     public XMLMessage getRaceXMLMessage() {
@@ -75,6 +72,7 @@ public class LatestMessages extends Observable {
 
     /**
      * Sets the latest race xml message to a specified race XML message.
+     *
      * @param raceXMLMessage The new race XML message to use.
      */
     public void setRaceXMLMessage(XMLMessage raceXMLMessage) {
@@ -87,6 +85,7 @@ public class LatestMessages extends Observable {
 
     /**
      * Returns the latest boat xml message.
+     *
      * @return The latest boat xml message.
      */
     public XMLMessage getBoatXMLMessage() {
@@ -95,6 +94,7 @@ public class LatestMessages extends Observable {
 
     /**
      * Sets the latest boat xml message to a specified boat XML message.
+     *
      * @param boatXMLMessage The new boat XML message to use.
      */
     public void setBoatXMLMessage(XMLMessage boatXMLMessage) {
@@ -107,6 +107,7 @@ public class LatestMessages extends Observable {
 
     /**
      * Returns the latest regatta xml message.
+     *
      * @return The latest regatta xml message.
      */
     public XMLMessage getRegattaXMLMessage() {
@@ -115,6 +116,7 @@ public class LatestMessages extends Observable {
 
     /**
      * Sets the latest regatta xml message to a specified regatta XML message.
+     *
      * @param regattaXMLMessage The new regatta XML message to use.
      */
     public void setRegattaXMLMessage(XMLMessage regattaXMLMessage) {
@@ -126,6 +128,7 @@ public class LatestMessages extends Observable {
 
     /**
      * Checks the type of xml message, and places it in this LatestMessages object.
+     *
      * @param xmlMessage The new xml message to use.
      */
     public void setXMLMessage(XMLMessage xmlMessage) {
@@ -145,13 +148,16 @@ public class LatestMessages extends Observable {
 
     /**
      * Returns whether or not there is an xml message for each message type.
+     *
      * @return True if race, boat, and regatta have an xml message, false otherwise.
      */
     public boolean hasAllXMLMessages() {
-        if (this.regattaXMLMessage == null || this.boatXMLMessage == null || this.raceXMLMessage == null) {
+        if (this.regattaXMLMessage == null || this.boatXMLMessage == null ||
+                this.raceXMLMessage == null) {
             return false;
 
         } else {
+            RaceServer.staticUpdateXML();
             return true;
 
         }

racevisionGame/src/main/java/network/PacketDump/AC35DumpReader.java

@@ -41,7 +41,6 @@ public class AC35DumpReader {
             messLen[1] = dump[pointer + 13];
             messLen[0] = dump[pointer + 14];
             int messageLength = ByteBuffer.wrap(messLen).getShort();
-            //System.out.println(messageLength);
 
             packets.add(new AC35Packet(Arrays.copyOfRange(dump, pointer, pointer + messageLength + 19)));
 

racevisionGame/src/main/java/shared/model/Boat.java

@@ -403,22 +403,20 @@ public class Boat extends Collider {
     public boolean isSailsOut() {
         return sailsOut;
     }
-    public void bounce(double repulsionRadius) {
-        Azimuth reverseAzimuth = Azimuth.fromDegrees(getBearing().degrees() - 180d);
-        setPosition(GPSCoordinate.calculateNewPosition(getPosition(), 2 * repulsionRadius, reverseAzimuth));
-    }
 
     @Override
     public boolean rayCast(Boat boat) {
         if(boat != this) {
-            return rayCast(boat, 15);
+            return rayCast(boat, 100);
         } else return false;
     }
 
     @Override
-    public void onCollisionEnter(Boat collider, Collision e) {
+    public void onCollisionEnter(Collision e) {
         if(e.getBearing().degrees() > 270 || e.getBearing().degrees() < 90) {
-            collider.bounce(15);
+            // Notify observers of collision
+            this.setChanged();
+            notifyObservers(e);
         }
     }
 }

racevisionGame/src/main/java/shared/model/CompoundMark.java

@@ -187,7 +187,7 @@ public class CompoundMark extends XMLCompoundMark{
         }
 
         //finds the mark furthest west and east
-        if(this.getMark1Position().getLongitude() > this.getMark2Position().getLongitude()){
+        if(this.getMark1Position().getLongitude() < this.getMark2Position().getLongitude()){
             westMostMark = this.mark1;
             eastMostMark = this.mark2;
         }else{

racevisionGame/src/main/java/shared/model/Constants.java

@@ -5,7 +5,6 @@ package shared.model;
  * Created by Erika on 19-Mar-17.
  */
 public class Constants {
-
     /**
     * Multiply by this factor to convert nautical miles to meters.
     * <br>
@@ -15,8 +14,6 @@ public class Constants {
     */
     public static final int NMToMetersConversion = 1852;
 
-
-
     /**
     * Multiply by this factor to convert Knots to millimeters per second.
      * <br>
@@ -26,33 +23,24 @@ public class Constants {
     */
     public static final double KnotsToMMPerSecond = 514.444;
 
-
-
     /**
      * The scale factor of the race.
      * Frame periods are multiplied by this to get the amount of time a single frame represents.
      * E.g., frame period = 20ms, scale = 5, frame represents 20 * 5 = 100ms, and so boats are simulated for 100ms, even though only 20ms actually occurred.
      */
-    public static final int RaceTimeScale = 2;//10;
+    public static final int RaceTimeScale = 10;
 
     /**
-     * The race pre-start time, in milliseconds. 3 minutes (30 seconds for development).
+     * The race pre-start time, in milliseconds. 30 seconds.
+     * Official time is 3 minutes.
      */
-//    public static final long RacePreStartTime = 30 * 1000;
-    public static final long RacePreStartTime = 1000;
-
+    public static final long RacePreStartTime = 30 * 1000;
 
     /**
-     * The race preparatory time, in milliseconds. 1 minute.
+     * The race preparatory time, in milliseconds. 10 seconds.
+     * Official time is 1 minute.
      */
-//    public static final long RacePreparatoryTime = 60 * 1000;
-    public static final long RacePreparatoryTime = 1 * 60 * 1000;
-
-
-
-
-
-
+    public static final long RacePreparatoryTime = 10 * 1000;
     /**
      * The number of milliseconds in one hour.
      * <br>
@@ -70,7 +58,4 @@ public class Constants {
      * Divide by this factor to convert hours to seconds.
      */
     public static long OneHourSeconds = 1 * 60 * 60;
-
-
-
 }

racevisionGame/src/main/java/shared/model/Mark.java

@@ -29,6 +29,11 @@ public class Mark extends Collider{
      */
     private GPSCoordinate position;
 
+    /**
+     * Repulsion radius of the mark
+     */
+    private double repulsionRadius = 50;
+
     /**
      * Constructs a mark with a given source ID, name, and position.
      * @param sourceID The source ID of the mark.
@@ -92,11 +97,12 @@ public class Mark extends Collider{
 
     @Override
     public boolean rayCast(Boat boat) {
-        return rayCast(boat, 15);
+        return rayCast(boat, repulsionRadius);
     }
 
     @Override
-    public void onCollisionEnter(Boat collider, Collision e) {
-        collider.bounce(15);
+    public void onCollisionEnter(Collision e) {
+        this.setChanged();
+        notifyObservers(e);
     }
 }

racevisionGame/src/main/java/shared/model/MarkRoundingData.java

@@ -0,0 +1,118 @@
+package shared.model;
+
+
+
+/**
+ * Contains data related to mark rounding for a specific leg.
+ */
+public class MarkRoundingData {
+
+    /**
+     * The leg this relates to.
+     */
+    private Leg leg;
+
+    /**
+     * The mark that should be rounded.
+     */
+    private Mark markToRound;
+
+    /**
+     * The bearing of the leg.
+     */
+    private Bearing legBearing;
+
+    /**
+     * The bearing of the next leg.
+     */
+    private Bearing nextLegBearing;
+
+    /**
+     * The location of the first rounding check point.
+     */
+    private GPSCoordinate roundCheck1;
+
+    /**
+     * The location of the second rounding check point.
+     */
+    private GPSCoordinate roundCheck2;
+
+    /**
+     * A halfway point between mark to round and roundCheck1.
+     */
+    private GPSCoordinate roundCheck1Halfway;
+
+    /**
+     * A halfway point between mark to round and roundCheck2.
+     */
+    private GPSCoordinate roundCheck2Halfway;
+
+
+    public MarkRoundingData() {
+    }
+
+
+    public Leg getLeg() {
+        return leg;
+    }
+
+    public void setLeg(Leg leg) {
+        this.leg = leg;
+    }
+
+    public Mark getMarkToRound() {
+        return markToRound;
+    }
+
+    public void setMarkToRound(Mark markToRound) {
+        this.markToRound = markToRound;
+    }
+
+    public Bearing getLegBearing() {
+        return legBearing;
+    }
+
+    public void setLegBearing(Bearing legBearing) {
+        this.legBearing = legBearing;
+    }
+
+    public Bearing getNextLegBearing() {
+        return nextLegBearing;
+    }
+
+    public void setNextLegBearing(Bearing nextLegBearing) {
+        this.nextLegBearing = nextLegBearing;
+    }
+
+    public GPSCoordinate getRoundCheck1() {
+        return roundCheck1;
+    }
+
+    public void setRoundCheck1(GPSCoordinate roundCheck1) {
+        this.roundCheck1 = roundCheck1;
+    }
+
+    public GPSCoordinate getRoundCheck2() {
+        return roundCheck2;
+    }
+
+    public void setRoundCheck2(GPSCoordinate roundCheck2) {
+        this.roundCheck2 = roundCheck2;
+    }
+
+    public GPSCoordinate getRoundCheck1Halfway() {
+        return roundCheck1Halfway;
+    }
+
+    public void setRoundCheck1Halfway(GPSCoordinate roundCheck1Halfway) {
+        this.roundCheck1Halfway = roundCheck1Halfway;
+    }
+
+    public GPSCoordinate getRoundCheck2Halfway() {
+        return roundCheck2Halfway;
+    }
+
+    public void setRoundCheck2Halfway(GPSCoordinate roundCheck2Halfway) {
+        this.roundCheck2Halfway = roundCheck2Halfway;
+    }
+}

racevisionGame/src/main/java/shared/model/MarkRoundingSequence.java

@@ -0,0 +1,210 @@
+package shared.model;
+
+import java.util.*;
+
+import static shared.enums.RoundingType.*;
+
+/**
+ * This class contains a sequence of points that describe the mark rounding order for a course.
+ */
+public class MarkRoundingSequence {
+
+
+    /**
+     * Legs in the race.
+     */
+    private List<Leg> legs;
+
+    /**
+     * For each leg, mark rounding information.
+     */
+    private Map<Leg, MarkRoundingData> roundingPoints;
+
+
+
+    public MarkRoundingSequence(List<Leg> legs) {
+        this.legs = legs;
+        generateRoundingPoints();
+    }
+
+
+    /**
+     * Returns the rounding points for a given leg.
+     * @param leg Leg to check.
+     * @return Rounding points for leg.
+     */
+    public MarkRoundingData getRoundingData(Leg leg) {
+        return roundingPoints.get(leg);
+    }
+
+
+    /**
+     * Generates the rounding points for all legs in the race.
+     */
+    private void generateRoundingPoints() {
+        this.roundingPoints = new HashMap<>(this.legs.size());
+
+        for (int i = 0; i < this.legs.size(); i++) {
+            Leg currentLeg = this.legs.get(i);
+
+            Optional<Leg> nextLeg = Optional.empty();
+            if (i < legs.size() - 1) {
+                nextLeg = Optional.of(this.legs.get(i + 1));
+            }
+
+            generateRoundingPoint(currentLeg, nextLeg);
+        }
+
+    }
+
+
+    /**
+     * Generates the rounding points for a specific leg.
+     * @param currentLeg The leg to generate rounding points for.
+     * @param nextLeg The following leg, used to help generate rounding points. Final leg of race doesn't have a following leg.
+     */
+    private void generateRoundingPoint(Leg currentLeg, Optional<Leg> nextLeg) {
+
+        Bearing bearingToAddFirstPoint = calculateBearingToAdd(currentLeg);
+
+        GPSCoordinate startCoord = currentLeg.getStartCompoundMark().getAverageGPSCoordinate();
+        GPSCoordinate endCoord = currentLeg.getEndCompoundMark().getAverageGPSCoordinate();
+        Bearing legBearing = GPSCoordinate.calculateBearing(startCoord, endCoord);
+        Bearing nextBearing = legBearing;
+
+        Mark markToRound = currentLeg.getEndCompoundMark().getMarkForRounding(legBearing);
+
+        GPSCoordinate roundCheck1;
+        if (currentLeg.getEndCompoundMark().getMark2() == null) {
+            //End is a single mark.
+            roundCheck1 = calculateRoundingCheckPoint(
+                    currentLeg,
+                    markToRound,
+                    legBearing,
+                    bearingToAddFirstPoint);
+        } else {
+            //End is a gate.
+            if (markToRound == currentLeg.getEndCompoundMark().getMark1()) {
+                roundCheck1 = currentLeg.getEndCompoundMark().getMark2().getPosition();
+            } else {
+                roundCheck1 = currentLeg.getEndCompoundMark().getMark1().getPosition();
+            }
+        }
+
+        //TODO the halfway points currently haven't been done properly.
+
+        GPSCoordinate roundCheck1Halfway = calculateRoundingCheckPoint(
+                currentLeg,
+                markToRound,
+                legBearing,
+                bearingToAddFirstPoint);
+
+
+        GPSCoordinate roundCheck2 = roundCheck1;
+        GPSCoordinate roundCheck2Halfway = roundCheck1Halfway;
+        if (nextLeg.isPresent()) {
+
+            Bearing bearingToAddSecondPoint = bearingToAddFirstPoint;//calculateBearingToAdd(nextLeg.get());
+
+            GPSCoordinate startCoord2 = nextLeg.get().getStartCompoundMark().getAverageGPSCoordinate();
+            GPSCoordinate endCoord2 = nextLeg.get().getEndCompoundMark().getAverageGPSCoordinate();
+            nextBearing = GPSCoordinate.calculateBearing(startCoord2, endCoord2);
+
+            roundCheck2 = calculateRoundingCheckPoint(
+                    currentLeg,
+                    markToRound,
+                    nextBearing,
+                    bearingToAddSecondPoint);
+
+            roundCheck2Halfway = calculateRoundingCheckPoint(
+                    currentLeg,
+                    markToRound,
+                    nextBearing,
+                    bearingToAddSecondPoint);
+        }
+
+
+        MarkRoundingData roundingData = new MarkRoundingData();
+        roundingData.setLeg(currentLeg);
+
+        roundingData.setLegBearing(legBearing);
+        roundingData.setNextLegBearing(nextBearing);
+
+        roundingData.setMarkToRound(markToRound);
+
+        roundingData.setRoundCheck1(roundCheck1);
+        roundingData.setRoundCheck1Halfway(roundCheck1Halfway);
+
+        roundingData.setRoundCheck2(roundCheck2);
+        roundingData.setRoundCheck2Halfway(roundCheck2Halfway);
+
+
+        this.roundingPoints.put(currentLeg, roundingData);
+
+
+        //Rounding points:
+
+        //each mark/gate has a specific mark to round. Call this ROUNDINGMARK
+        //  with a mark, it is the mark
+        //  with a gate, it depends if it is a starboard or port gate.
+        //  it is the mark that allows the boat to enter between both marks of the gate, whilst obeying the starboard/port requirement.
+
+        //let the bearing between start of leg and end of leg be called LEGBEARING
+
+        //the first rounding point is ROUNDINGDISTANCE units away from the ROUNDINGMARK, on an angle perpendicular to LEGBEARING.
+        // the angle means that the rounding mark is at the center of a gate, for gates.
+
+        //the second rounding point is the same as the first, except LEGBEARING is the bearing between end of current leg, and start of next leg.
+    }
+
+
+
+    /**
+     * Calculates the location of the rounding check point, which together with the mark to round, forms a line that the boat must cross to round the mark.
+     * @param leg Leg of race to check.
+     * @param markToRound Mark at end of leg to round.
+     * @param legBearing The bearing of the nearest leg. For the first rounding point this is the leg's bearing, for the second rounding point it is the next leg's bearing.
+     * @param bearingToAdd The bearing to add to the leg bearing to get a perpendicular bearing.
+     * @return The location of the rounding point, which together with the mark to round forms a line the boat must cross.
+     */
+    private GPSCoordinate calculateRoundingCheckPoint(Leg leg, Mark markToRound, Bearing legBearing, Bearing bearingToAdd) {
+
+
+        double roundingDistanceMeters = leg.getEndCompoundMark().getRoundingDistance();
+
+
+        //We project from rounding mark to get the second point which forms the line the boat must cross.
+        /*
+               c2
+               |
+               |
+               r------c1
+                  b
+         */
+        GPSCoordinate roundCheck = GPSCoordinate.calculateNewPosition(
+                markToRound.getPosition(),
+                roundingDistanceMeters,
+                Azimuth.fromDegrees(legBearing.degrees() + bearingToAdd.degrees())    );
+
+        return roundCheck;
+    }
+
+
+    /**
+     * Calculates the bearing that must be added to a leg's bearing to calculate a perpendicular bearing, used for finding rounding points.
+     * @param leg Leg to check.
+     * @return Bearing to add. Will be either +90 or -90.
+     */
+    private Bearing calculateBearingToAdd(Leg leg) {
+
+        if (leg.getEndCompoundMark().getRoundingType() == Port ||
+                leg.getEndCompoundMark().getRoundingType() == SP) {
+            return Bearing.fromDegrees(90);
+        } else {
+            return Bearing.fromDegrees(-90);
+        }
+
+    }
+
+
+}

racevisionGame/src/main/java/shared/model/RaceClock.java

@@ -3,6 +3,7 @@ package shared.model;
 import javafx.beans.property.SimpleStringProperty;
 import javafx.beans.property.StringProperty;
 import org.jetbrains.annotations.Nullable;
+import visualiser.Controllers.RaceStartController;
 import visualiser.model.ResizableRaceCanvas;
 
 import java.time.Duration;
@@ -15,8 +16,8 @@ import java.util.Date;
  * This class is used to implement a clock which keeps track of and
  * displays times relevant to a race. This is displayed on the
  * {@link ResizableRaceCanvas} via the
- * {@link visualiser.Controllers.RaceController} and the
- * {@link visualiser.Controllers.StartController}.
+ * {@link visualiser.Controllers.RaceViewController} and the
+ * {@link RaceStartController}.
  */
 public class RaceClock {
 

racevisionGame/src/main/java/shared/model/RaceState.java

@@ -13,6 +13,7 @@ import shared.dataInput.RegattaDataSource;
 import java.time.ZonedDateTime;
 import java.util.ArrayList;
 import java.util.List;
+import java.util.Observable;
 
 
 /**
@@ -20,7 +21,7 @@ import java.util.List;
  * This is a base class inherited by {@link mock.model.MockRace} and {@link visualiser.model.VisualiserRaceState}.
  * Has a course, state, wind, boundaries, etc.... Boats are added by inheriting classes (see {@link Boat}, {@link mock.model.MockBoat}, {@link visualiser.model.VisualiserBoat}.
  */
-public abstract class RaceState {
+public abstract class RaceState extends Observable{
 
 
 
@@ -46,6 +47,12 @@ public abstract class RaceState {
     private ObservableList<Leg> legs;
 
 
+    /**
+     * The sequence of rounding points for each leg/mark.
+     */
+    private MarkRoundingSequence markRoundingSequence;
+
+
 
     /**
      * The clock which tracks the race's start time, current time, and elapsed duration.
@@ -102,10 +109,15 @@ public abstract class RaceState {
      */
     protected void useLegsList(List<Leg> legs) {
         this.legs.setAll(legs);
+
+        //We create this before adding the extra finish leg, as it doesn't contain compound marks.
+        this.markRoundingSequence = new MarkRoundingSequence(getLegs());
+
         //We add a "dummy" leg at the end of the race.
         if (getLegs().size() > 0) {
             getLegs().add(new Leg("Finish", getLegs().size()));
         }
+
     }
 
 
@@ -367,6 +379,11 @@ public abstract class RaceState {
     }
 
 
-
-
+    /**
+     * Returns the rounding sequences for each leg.
+     * @return Rounding sequence for each leg.
+     */
+    public MarkRoundingSequence getMarkRoundingSequence() {
+        return markRoundingSequence;
+    }
 }

racevisionGame/src/main/java/shared/xml/Race/XMLParticipants.java

@@ -50,7 +50,7 @@ import javax.xml.bind.annotation.XmlType;
 })
 public class XMLParticipants {
 
-    @XmlElement(name = "Yacht", required = true)
+    @XmlElement(name = "Yacht", required = false)
     protected List<XMLYacht> yacht;
 
     /**

racevisionGame/src/main/java/shared/xml/XMLUtilities.java

@@ -49,7 +49,7 @@ public class XMLUtilities {
         return xmlToClass(document, schemaURL, c);
     }
 
-    public static Object xmlToClass(String xml, URL schemaURL, Class c) throws ParserConfigurationException, IOException, SAXException, JAXBException {
+    public static <T> T xmlToClass(String xml, URL schemaURL, Class<T> c) throws ParserConfigurationException, IOException, SAXException, JAXBException {
         DocumentBuilder parser = DocumentBuilderFactory.newInstance().newDocumentBuilder();
         Document document = parser.parse(new InputSource(new ByteArrayInputStream(xml.getBytes("utf-8"))));
 
@@ -63,10 +63,10 @@ public class XMLUtilities {
      * @param c The XML class to convert to.
      * @param <T> The XML class to convert to.
      * @return The XML class object.
-     * @throws ParserConfigurationException
-     * @throws IOException
-     * @throws SAXException
-     * @throws JAXBException
+     * @throws ParserConfigurationException Thrown if input cannot be converted to class.
+     * @throws IOException Thrown if input cannot be converted to class.
+     * @throws SAXException Thrown if input cannot be converted to class.
+     * @throws JAXBException Thrown if input cannot be converted to class.
      */
     public static <T> T xmlToClass(InputStream i, URL schemaURL, Class<T> c) throws ParserConfigurationException, IOException, SAXException, JAXBException {
         DocumentBuilder parser = DocumentBuilderFactory.newInstance().newDocumentBuilder();

racevisionGame/src/main/java/shared/xml/boats/BoatConfig.java

@@ -184,7 +184,7 @@ public class BoatConfig {
          * Objects of the following type(s) are allowed in the list
          * {@link BoatConfig.Boats.Boat }
          * 
-         * 
+         * @return List of Boat entries.
          */
         public List<BoatConfig.Boats.Boat> getBoat() {
             if (boat == null) {
@@ -327,7 +327,7 @@ public class BoatConfig {
 
             /**
              * Gets the value of the sourceID property.
-             * 
+             * @return source id.
              */
             public int getSourceID() {
                 return sourceID;
@@ -335,7 +335,7 @@ public class BoatConfig {
 
             /**
              * Sets the value of the sourceID property.
-             * 
+             * @param value new source id.
              */
             public void setSourceID(int value) {
                 this.sourceID = value;
@@ -494,7 +494,7 @@ public class BoatConfig {
 
                 /**
                  * Gets the value of the y property.
-                 * 
+                 * @return Y value.
                  */
                 public double getY() {
                     return y;
@@ -502,7 +502,7 @@ public class BoatConfig {
 
                 /**
                  * Sets the value of the y property.
-                 * 
+                 * @param value new y value.
                  */
                 public void setY(double value) {
                     this.y = value;
@@ -510,7 +510,7 @@ public class BoatConfig {
 
                 /**
                  * Gets the value of the z property.
-                 * 
+                 * @return z value.
                  */
                 public double getZ() {
                     return z;
@@ -518,7 +518,7 @@ public class BoatConfig {
 
                 /**
                  * Sets the value of the z property.
-                 * 
+                 * @param value new z value.
                  */
                 public void setZ(double value) {
                     this.z = value;

racevisionGame/src/main/java/shared/xml/boats/ObjectFactory.java

@@ -38,7 +38,7 @@ public class ObjectFactory {
 
     /**
      * Create an instance of {@link BoatConfig }
-     * 
+     * @return BoatConfig.
      */
     public BoatConfig createBoatConfig() {
         return new BoatConfig();
@@ -46,7 +46,7 @@ public class ObjectFactory {
 
     /**
      * Create an instance of {@link BoatConfig.Boats }
-     * 
+     * @return Boats.
      */
     public BoatConfig.Boats createBoatConfigBoats() {
         return new BoatConfig.Boats();
@@ -54,7 +54,7 @@ public class ObjectFactory {
 
     /**
      * Create an instance of {@link BoatConfig.Boats.Boat }
-     * 
+     * @return Boat.
      */
     public BoatConfig.Boats.Boat createBoatConfigBoatsBoat() {
         return new BoatConfig.Boats.Boat();
@@ -62,7 +62,7 @@ public class ObjectFactory {
 
     /**
      * Create an instance of {@link BoatConfig.Boats.Boat.GPSposition }
-     * 
+     * @return GPSposition.
      */
     public BoatConfig.Boats.Boat.GPSposition createBoatConfigBoatsBoatGPSposition() {
         return new BoatConfig.Boats.Boat.GPSposition();

racevisionGame/src/main/java/shared/xml/regatta/ObjectFactory.java

@@ -38,7 +38,7 @@ public class ObjectFactory {
 
     /**
      * Create an instance of {@link RegattaConfig }
-     * 
+     * @return RegattaConfig.
      */
     public RegattaConfig createRegattaConfig() {
         return new RegattaConfig();

racevisionGame/src/main/java/shared/xml/regatta/RegattaConfig.java

@@ -74,7 +74,7 @@ public class RegattaConfig {
 
     /**
      * Gets the value of the regattaID property.
-     * 
+     * @return regatta id.
      */
     public int getRegattaID() {
         return regattaID;
@@ -82,7 +82,7 @@ public class RegattaConfig {
 
     /**
      * Sets the value of the regattaID property.
-     * 
+     * @param value new regatta id.
      */
     public void setRegattaID(int value) {
         this.regattaID = value;
@@ -138,7 +138,7 @@ public class RegattaConfig {
 
     /**
      * Gets the value of the centralLatitude property.
-     * 
+     * @return central latitude.
      */
     public double getCentralLatitude() {
         return centralLatitude;
@@ -146,7 +146,7 @@ public class RegattaConfig {
 
     /**
      * Sets the value of the centralLatitude property.
-     * 
+     * @param value new central latitude.
      */
     public void setCentralLatitude(double value) {
         this.centralLatitude = value;
@@ -154,7 +154,7 @@ public class RegattaConfig {
 
     /**
      * Gets the value of the centralLongitude property.
-     * 
+     * @return central longitude.
      */
     public double getCentralLongitude() {
         return centralLongitude;
@@ -162,7 +162,7 @@ public class RegattaConfig {
 
     /**
      * Sets the value of the centralLongitude property.
-     * 
+     * @param value new central longitude.
      */
     public void setCentralLongitude(double value) {
         this.centralLongitude = value;
@@ -170,7 +170,7 @@ public class RegattaConfig {
 
     /**
      * Gets the value of the centralAltitude property.
-     * 
+     * @return central altitude.
      */
     public double getCentralAltitude() {
         return centralAltitude;
@@ -178,7 +178,7 @@ public class RegattaConfig {
 
     /**
      * Sets the value of the centralAltitude property.
-     * 
+     * @param value new central altitude.
      */
     public void setCentralAltitude(double value) {
         this.centralAltitude = value;
@@ -186,7 +186,7 @@ public class RegattaConfig {
 
     /**
      * Gets the value of the utcOffset property.
-     * 
+     * @return utc offset.
      */
     public double getUtcOffset() {
         return utcOffset;
@@ -194,7 +194,7 @@ public class RegattaConfig {
 
     /**
      * Sets the value of the utcOffset property.
-     * 
+     * @param value new utc offset.
      */
     public void setUtcOffset(double value) {
         this.utcOffset = value;
@@ -202,7 +202,7 @@ public class RegattaConfig {
 
     /**
      * Gets the value of the magneticVariation property.
-     * 
+     * @return magnetic variation.
      */
     public double getMagneticVariation() {
         return magneticVariation;
@@ -210,7 +210,7 @@ public class RegattaConfig {
 
     /**
      * Sets the value of the magneticVariation property.
-     * 
+     * @param value new magnetic variation.
      */
     public void setMagneticVariation(double value) {
         this.magneticVariation = value;

racevisionGame/src/main/java/visualiser/Commands/VisualiserRaceCommands/BoatCollisionCommand.java

@@ -3,6 +3,8 @@ package visualiser.Commands.VisualiserRaceCommands;
 import javafx.scene.media.AudioClip;
 import mock.model.commandFactory.Command;
 import network.Messages.YachtEvent;
+import shared.exceptions.BoatNotFoundException;
+import visualiser.model.VisualiserBoat;
 import visualiser.model.VisualiserRaceState;
 
 /**
@@ -34,6 +36,11 @@ public class BoatCollisionCommand implements Command {
             sound.play();
         }
 
-        //System.out.println("Collision command executed!");
+        try {
+            VisualiserBoat boat = visualiserRace.getBoat(yachtEvent.getSourceID());
+            boat.setHasCollided(true);
+        } catch (BoatNotFoundException e) {
+            e.printStackTrace();
+        }
     }
 }

racevisionGame/src/main/java/visualiser/Controllers/ArrowController.java

@@ -1,65 +1,31 @@
 package visualiser.Controllers;
 
-
 import javafx.application.Platform;
 import javafx.beans.property.Property;
 import javafx.fxml.FXML;
 import javafx.scene.control.Label;
 import javafx.scene.image.ImageView;
-import javafx.scene.layout.Pane;
 import javafx.scene.layout.StackPane;
-import javafx.scene.shape.Circle;
 import shared.model.Bearing;
 import shared.model.Wind;
 
 /**
- * Controller for the arrow.fxml view.
+ * Controller for the wind direction arrow on the race screen.
  */
 public class ArrowController {
-
-
-    @FXML
-    private Pane compass;
-
-    @FXML
-    private StackPane arrowStackPane;
-
-    @FXML
-    private ImageView arrowImage;
-
-    @FXML
-    private Circle circle;
-
-    @FXML
-    private Label northLabel;
-
-    @FXML
-    private Label windLabel;
-
-    @FXML
-    private Label speedLabel;
-
-
-    /**
-     * This is the property our arrow control binds to.
-     */
-    private Property<Wind> wind;
-
-
-    /**
-     * Constructor.
-     */
-    public ArrowController() {
-    }
-
+    private @FXML StackPane arrowStackPane;
+    private @FXML ImageView arrowImage;
+    private @FXML Label speedLabel;
+    private final static Integer MIN_KNOTS = 2;     // knots for min_height
+    private final static Integer MAX_KNOTS = 30;    // knots for max_height
+    private final static Integer MIN_HEIGHT = 25;   // min arrow height
+    private final static Integer MAX_HEIGHT = 75;   // max arrow height
 
     /**
      * Sets which wind property the arrow control should bind to.
      * @param wind The wind property to bind to.
      */
     public void setWindProperty(Property<Wind> wind) {
-        this.wind  = wind;
-
         wind.addListener((observable, oldValue, newValue) -> {
             if (newValue != null) {
                 Platform.runLater(() -> updateWind(newValue));
@@ -67,7 +33,6 @@ public class ArrowController {
         });
     }
 
-
     /**
      * Updates the control to use the new wind value.
      * This updates the arrow direction (due to bearing), arrow length (due to speed), and label (due to speed).
@@ -78,7 +43,6 @@ public class ArrowController {
         updateWindSpeed(wind.getWindSpeed());
     }
 
-
     /**
      * Updates the control to account for the new wind speed.
      * This changes the length (height) of the wind arrow, and updates the speed label.
@@ -94,29 +58,22 @@ public class ArrowController {
      * @param speedKnots Wind speed, in knots.
      */
     private void updateWindArrowLength(double speedKnots) {
-
-        //At 2 knots, the arrow reaches its minimum height, and at 30 knots it reaches its maximum height.
-        double minKnots = 2;
-        double maxKnots = 30;
-        double deltaKnots = maxKnots - minKnots;
-
-        double minHeight = 25;
-        double maxHeight = 75;
-        double deltaHeight = maxHeight - minHeight;
+        double deltaKnots = MAX_KNOTS - MIN_KNOTS;
+        double deltaHeight = MAX_HEIGHT - MIN_HEIGHT;
 
         //Clamp speed.
-        if (speedKnots > maxKnots) {
-            speedKnots = maxKnots;
-        } else if (speedKnots < minKnots) {
-            speedKnots = minKnots;
+        if (speedKnots > MAX_KNOTS) {
+            speedKnots = MAX_KNOTS;
+        } else if (speedKnots < MIN_KNOTS) {
+            speedKnots = MIN_KNOTS;
         }
 
         //How far between the knots bounds is the current speed?
-        double currentDeltaKnots = speedKnots - minKnots;
+        double currentDeltaKnots = speedKnots - MIN_KNOTS;
         double currentKnotsScalar = currentDeltaKnots / deltaKnots;
 
         //Thus, how far between the pixel height bounds should the arrow height be?
-        double newHeight = minHeight + (currentKnotsScalar * deltaHeight);
+        double newHeight = MIN_HEIGHT + (currentKnotsScalar * deltaHeight);
 
         arrowImage.setFitHeight(newHeight);
     }
@@ -129,7 +86,6 @@ public class ArrowController {
         speedLabel.setText(String.format("%.1fkn", speedKnots));
     }
 
-
     /**
      * Updates the control to account for a new wind bearing.
      * This rotates the arrow according to the bearing.
@@ -140,7 +96,4 @@ public class ArrowController {
         arrowStackPane.setRotate(bearing.degrees());
     }
 
-
-
-
 }

racevisionGame/src/main/java/visualiser/Controllers/ConnectionController.java

@@ -1,147 +0,0 @@
-package visualiser.Controllers;
-
-import javafx.collections.FXCollections;
-import javafx.collections.ObservableList;
-import javafx.fxml.FXML;
-import javafx.scene.control.*;
-import javafx.scene.layout.AnchorPane;
-import mock.app.Event;
-import org.xml.sax.SAXException;
-import shared.exceptions.InvalidBoatDataException;
-import shared.exceptions.InvalidRaceDataException;
-import shared.exceptions.InvalidRegattaDataException;
-import shared.exceptions.XMLReaderException;
-import visualiser.model.RaceConnection;
-
-import javax.xml.bind.JAXBException;
-import javax.xml.parsers.ParserConfigurationException;
-import javax.xml.soap.Text;
-import java.io.IOException;
-import java.net.Socket;
-import java.net.URL;
-import java.net.UnknownHostException;
-import java.util.ResourceBundle;
-
-//TODO it appears this view/controller was replaced by Lobby.fxml. Remove?
-/**
- * Controls the connection that the VIsualiser can connect to.
- */
-public class ConnectionController extends Controller {
-    @FXML
-    private AnchorPane connectionWrapper;
-    @FXML
-    private TableView<RaceConnection> connectionTable;
-    @FXML
-    private TableColumn<RaceConnection, String> hostnameColumn;
-    @FXML
-    private TableColumn<RaceConnection, String> statusColumn;
-    @FXML
-    private Button connectButton;
-
-    @FXML
-    private TextField urlField;
-    @FXML
-    private TextField portField;
-
-
-    /*Title Screen fxml items*/
-    @FXML
-    private Button hostGameTitleBtn;
-    @FXML
-    private Button connectGameBtn;
-    @FXML
-    private RadioButton nightRadioBtn;
-    @FXML
-    private RadioButton dayRadioButton;
-
-    /*Lobby fxml items*/
-    @FXML
-    private TableView lobbyTable;
-    @FXML
-    private TableColumn gameNameColumn;
-    @FXML
-    private TableColumn hostNameColumn;
-    @FXML
-    private TableColumn playerCountColumn;
-    @FXML
-    private TextField playerNameField;
-    @FXML
-    private Button joinGameBtn;
-
-    /*Host game fxml items*/
-    @FXML
-    private TextField gameNameField;
-    @FXML
-    private TextField hostNameField;
-    @FXML
-    private TextField hostGameBtn;
-
-
-
-
-
-
-
-
-    private ObservableList<RaceConnection> connections;
-
-
-
-    @Override
-    public void initialize(URL location, ResourceBundle resources) {
-        // TODO - replace with config file
-        connections = FXCollections.observableArrayList();
-
-        connectionTable.setItems(connections);
-        hostnameColumn.setCellValueFactory(cellData -> cellData.getValue().hostnameProperty());
-        statusColumn.setCellValueFactory(cellData -> cellData.getValue().statusProperty());
-
-        connectionTable.getSelectionModel().selectedItemProperty().addListener((obs, prev, curr) -> {
-            if (curr != null && curr.check()) connectButton.setDisable(false);
-            else connectButton.setDisable(true);
-        });
-        connectButton.setDisable(true);
-    }
-
-    /**
-     * Sets current status of all connections.
-     */
-    public void checkConnections() {
-        for(RaceConnection connection: connections) {
-            connection.check();
-        }
-    }
-
-    public AnchorPane startWrapper(){
-        return connectionWrapper;
-    }
-
-    /**
-     * Connects to host currently selected in table. Button enabled only if host is ready.
-     */
-    public void connectSocket() {
-        try{
-            RaceConnection connection = connectionTable.getSelectionModel().getSelectedItem();
-            Socket socket = new Socket(connection.getHostname(), connection.getPort());
-            socket.setKeepAlive(true);
-            connectionWrapper.setVisible(false);
-            //parent.enterLobby(socket);
-        } catch (IOException e) { /* Never reached */ }
-    }
-
-    /**
-     * adds a new connection
-     */
-    public void addConnection(){
-        String hostName = urlField.getText();
-        String portString = portField.getText();
-        try{
-            int port = Integer.parseInt(portString);
-            connections.add(new RaceConnection(hostName, port, null));
-        }catch(NumberFormatException e){
-            System.err.println("Port number entered is not a number");
-        }
-    }
-
-
-}

racevisionGame/src/main/java/visualiser/Controllers/Controller.java

@@ -1,32 +1,108 @@
 package visualiser.Controllers;
 
-import javafx.fxml.Initializable;
+import javafx.fxml.FXMLLoader;
+import javafx.scene.Parent;
+import javafx.scene.Scene;
+import javafx.scene.image.Image;
+import javafx.stage.Modality;
+import javafx.stage.Stage;
+import visualiser.app.App;
+import java.io.IOException;
 
-import java.net.URL;
-import java.util.ResourceBundle;
+/**
+ * Abstract controller class to give each subclass the functionality to load
+ * a new scene into the existing stage, or create a new popup window.
+ */
+public abstract class Controller {
+    private Stage stage = App.getStage();
 
     /**
- * Controller parent for app controllers.
- * Created by fwy13 on 15/03/2017.
+     * Loads the title screen again when app is already running.
+     * @throws IOException if a problem with the title.fxml
      */
-public abstract class Controller implements Initializable {
-    protected MainController parent;
+    protected void loadTitleScreen() throws IOException {
+        FXMLLoader loader = new FXMLLoader(getClass().getResource("/visualiser/scenes/title.fxml"));
+        Parent root = loader.load();
+        stage.setResizable(false);
+        Scene scene = new Scene(root);
+        addCssStyle(scene);
+        stage.setScene(scene);
+        stage.show();
+    }
 
     /**
-     * Sets the parent of the application
-     *
-     * @param parent controller
+     * Used to load a new scene in the currently open stage.
+     * @param fxmlUrl the URL of the FXML file to be loaded
+     * @return the controller of the new scene
+     * @throws IOException if there is an issue with the fxmlUrl
      */
-    public void setParent(MainController parent) {
-        this.parent = parent;
+    protected Controller loadScene(String fxmlUrl) throws IOException {
+        // load the correct fxml file
+        FXMLLoader loader = new FXMLLoader();
+        loader.setLocation(getClass().getResource
+                ("/visualiser/scenes/"+fxmlUrl));
+        Parent root = loader.load();
+
+        // reuse previous stage and it's window size
+        Stage stage = App.getStage();
+        Double stageHeight = stage.getHeight();
+        Double stageWidth = stage.getWidth();
+
+        // set new scene into existing window
+        Scene scene = new Scene(root, stageWidth, stageHeight);
+        addCssStyle(scene);
+        stage.setScene(scene);
+        stage.setResizable(true);
+        stage.show();
+        stage.setHeight(stageHeight);
+        stage.setWidth(stageWidth);
+        stage.sizeToScene();
+
+        // return controller for the loaded fxml scene
+        return loader.getController();
     }
 
     /**
-     * Initialisation class that is run on start up.
-     *
-     * @param location  resources location
-     * @param resources resources bundle
+     * Used to load a scene in a new separate popup stage.
+     * @param fxmlUrl the URL of the FXML file to be loaded
+     * @param title title for the new window
+     * @param modality modality settings for popup window
+     * @return the controller of the new scene
+     * @throws IOException if there is an issue with the fxmlUrl
      */
-    @Override
-    public abstract void initialize(URL location, ResourceBundle resources);
+    protected Controller loadPopupScene(String fxmlUrl, String title, Modality
+            modality) throws IOException {
+        // load the correct fxml scene
+        FXMLLoader loader = new FXMLLoader();
+        loader.setLocation(getClass().getResource(
+                "/visualiser/scenes/" + fxmlUrl));
+        Parent root = loader.load();
+
+        // create a new 'pop-up' window
+        Stage stage = new Stage();
+        stage.initModality(modality);
+        stage.setTitle(title);
+        stage.centerOnScreen();
+        stage.getIcons().add(new Image(getClass().getClassLoader().getResourceAsStream("images/SailIcon.png")));
+        Scene scene = new Scene(root);
+        addCssStyle(scene);
+        stage.setScene(scene);
+        stage.show();
+
+        // return controller for the loaded fxml scene
+        return loader.getController();
+    }
+
+    /**
+     * Adds the relevant CSS styling to the scene being loaded.
+     * @param scene new scene to be loaded and displayed
+     */
+    private void addCssStyle(Scene scene){
+        if (App.dayMode) {
+            scene.getStylesheets().add("/css/dayMode.css");
+        } else {
+            scene.getStylesheets().add("/css/nightMode.css");
+        }
+    }
+
 }

racevisionGame/src/main/java/visualiser/Controllers/FinishController.java

@@ -1,92 +0,0 @@
-package visualiser.Controllers;
-
-
-import javafx.collections.ObservableList;
-import javafx.fxml.FXML;
-import javafx.scene.control.Label;
-import javafx.scene.control.TableColumn;
-import javafx.scene.control.TableView;
-import javafx.scene.layout.AnchorPane;
-import visualiser.model.VisualiserBoat;
-
-import java.net.URL;
-import java.util.ResourceBundle;
-
-
-/**
- * Finish Screen for when the race finishes.
- */
-public class FinishController extends Controller {
-
-    @FXML
-    AnchorPane finishWrapper;
-
-    @FXML
-    TableView<VisualiserBoat> boatInfoTable;
-
-    @FXML
-    TableColumn<VisualiserBoat, String> boatRankColumn;
-
-    @FXML
-    TableColumn<VisualiserBoat, String> boatNameColumn;
-
-    @FXML
-    Label raceWinnerLabel;
-
-
-    /**
-     * The boats to display on the table.
-     */
-    private ObservableList<VisualiserBoat> boats;
-
-
-    /**
-     * Ctor.
-     */
-    public FinishController() {
-    }
-
-
-    @Override
-    public void initialize(URL location, ResourceBundle resources){
-    }
-
-
-
-    /**
-     * Sets up the finish table
-     * @param boats Boats to display
-     */
-    private void setFinishTable(ObservableList<VisualiserBoat> boats) {
-        this.boats = boats;
-
-        //Set contents.
-        boatInfoTable.setItems(boats);
-
-        //Name.
-        boatNameColumn.setCellValueFactory(cellData -> cellData.getValue().nameProperty());
-
-        //Rank/position.
-        boatRankColumn.setCellValueFactory(cellData -> cellData.getValue().placingProperty());
-
-
-        //Winner label.
-        if (boats.size() > 0) {
-            raceWinnerLabel.setText("Winner: " + boatNameColumn.getCellObservableValue(0).getValue());
-            raceWinnerLabel.setWrapText(true);
-        }
-
-    }
-
-
-
-    /**
-     * Display the table
-     * @param boats boats to display on the table.
-     */
-    public void enterFinish(ObservableList<VisualiserBoat> boats){
-        finishWrapper.setVisible(true);
-        setFinishTable(boats);
-    }
-
-}

racevisionGame/src/main/java/visualiser/Controllers/HostController.java

@@ -1,148 +0,0 @@
-package visualiser.Controllers;
-
-import javafx.fxml.FXML;
-import javafx.scene.control.Button;
-import javafx.scene.control.TextField;
-import javafx.scene.image.Image;
-import javafx.scene.image.ImageView;
-import javafx.scene.layout.AnchorPane;
-import javafx.scene.layout.GridPane;
-import javafx.stage.Stage;
-import javafx.scene.media.AudioClip;
-import mock.app.Event;
-import org.xml.sax.SAXException;
-import mock.exceptions.EventConstructionException;
-import shared.exceptions.InvalidBoatDataException;
-import shared.exceptions.InvalidRaceDataException;
-import shared.exceptions.InvalidRegattaDataException;
-import shared.exceptions.XMLReaderException;
-
-import javax.xml.bind.JAXBException;
-import javax.xml.parsers.ParserConfigurationException;
-import java.io.IOException;
-import java.net.Socket;
-import java.net.URL;
-import java.util.ArrayList;
-import java.util.Arrays;
-import java.util.ResourceBundle;
-import java.util.logging.Level;
-import java.util.logging.Logger;
-
-/**
- * Controller for Hosting a game.
- */
-public class HostController extends Controller {
-
-
-    @FXML
-    TextField gameNameField;
-
-    @FXML
-    TextField hostNameField;
-
-    @FXML
-    AnchorPane hostWrapper;
-
-    @FXML
-    Button previousButton;
-
-    @FXML
-    Button nextButton;
-
-    @FXML
-    ImageView mapImage;
-
-    private Event game;
-
-    private ArrayList<Image> listOfMaps;
-    private int currentMapIndex = 0;
-
-
-    @Override
-    public void initialize(URL location, ResourceBundle resources){
-        Image ac35Map = new Image(getClass().getClassLoader().getResourceAsStream("images/AC35_Racecourse_MAP.png"));
-        Image oMap = new Image(getClass().getClassLoader().getResourceAsStream("images/oMapLayout.png"));
-        Image iMap = new Image(getClass().getClassLoader().getResourceAsStream("images/iMapLayout.png"));
-        Image mMap = new Image(getClass().getClassLoader().getResourceAsStream("images/mMapLayout.png"));
-
-        listOfMaps = new ArrayList(Arrays.asList(ac35Map, oMap, iMap, mMap));
-        mapImage.setImage(listOfMaps.get(currentMapIndex));
-    }
-
-    /**
-     * Hosts a game
-     * @throws IOException if socket cannot be connected to
-     */
-    public void hostGamePressed() throws IOException{
-        try {
-            this.game = new Event(false, currentMapIndex);
-            connectSocket("localhost", 4942);
-        } catch (EventConstructionException e) {
-            Logger.getGlobal().log(Level.SEVERE, "Could not create Event.", e);
-            throw new RuntimeException(e);
-        }
-    }
-
-    public void endEvent() throws IOException {
-        game.endEvent();
-    }
-
-    /**
-     * Connect to a socket
-     * @param address address of the server
-     * @param port port that the server is run off
-     */
-    public void connectSocket(String address, int port) {
-        try{
-            Socket socket = new Socket(address, port);
-            hostWrapper.setVisible(false);
-            parent.enterLobby(socket, true);
-        } catch (IOException e) { /* Never reached */ }
-    }
-
-    public AnchorPane startWrapper(){
-        return hostWrapper;
-    }
-
-    /**
-     * Hosts a game.
-     */
-    public void hostGame(){
-        mapImage.fitWidthProperty().bind(((Stage) mapImage.getScene().getWindow()).widthProperty().multiply(0.6));
-        hostWrapper.setVisible(true);
-    }
-
-    /**
-     * Menu button pressed. Prompt alert then return to menu
-     */
-    public void menuBtnPressed(){
-        AudioClip sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
-        sound.play();
-        hostWrapper.setVisible(false);
-        parent.enterTitle();
-    }
-
-    public void nextImage(){
-        increaseIndex();
-        mapImage.setImage(listOfMaps.get(currentMapIndex));
-    }
-
-    public void previousImage(){
-        decreaseIndex();
-        mapImage.setImage(listOfMaps.get(currentMapIndex));
-    }
-    private void increaseIndex(){
-        currentMapIndex = (currentMapIndex + 1)%listOfMaps.size();
-    }
-
-    private void decreaseIndex(){
-        currentMapIndex = ((((currentMapIndex - 1)%listOfMaps.size())+listOfMaps.size())%listOfMaps.size());
-    }
-
-    public void setGameType(int gameType){
-        this.currentMapIndex = gameType;
-    }
-
-    public int getGameType(){ return this.currentMapIndex; }
-
-}

racevisionGame/src/main/java/visualiser/Controllers/HostGameController.java

@@ -0,0 +1,143 @@
+package visualiser.Controllers;
+
+import javafx.application.Platform;
+import javafx.fxml.FXML;
+import javafx.scene.control.Alert;
+import javafx.scene.control.ButtonType;
+import javafx.scene.image.Image;
+import javafx.scene.image.ImageView;
+import mock.app.Event;
+import mock.exceptions.EventConstructionException;
+import visualiser.app.App;
+import visualiser.app.MatchBrowserSingleton;
+import visualiser.network.MatchBrowserInterface;
+
+import java.io.IOException;
+import java.net.DatagramSocket;
+import java.net.Socket;
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.Optional;
+import java.util.logging.Level;
+import java.util.logging.Logger;
+
+/**
+ * Controller for Hosting a game.
+ */
+public class HostGameController extends Controller {
+    private @FXML ImageView mapImage;
+    private ArrayList<Image> listOfMaps;
+    private int currentMapIndex = 0;
+    private DatagramSocket udpSocket;
+    private MatchBrowserInterface matchBrowserInterface;
+
+    public void initialize() {
+        loadMaps();
+        this.udpSocket = MatchBrowserSingleton.getInstance().getUdpSocket();
+        this.matchBrowserInterface = MatchBrowserSingleton.getInstance().getMatchBrowserInterface();
+    }
+
+
+
+    /**
+     * Loads in the list of playable maps to be selected from.
+     */
+    private void loadMaps(){
+        // image preview of maps
+        Image ac35Map = new Image(getClass().getClassLoader().getResourceAsStream("images/AC35_Racecourse_MAP.png"));
+        Image oMap = new Image(getClass().getClassLoader().getResourceAsStream("images/oMapLayout.png"));
+        Image iMap = new Image(getClass().getClassLoader().getResourceAsStream("images/iMapLayout.png"));
+        Image mMap = new Image(getClass().getClassLoader().getResourceAsStream("images/mMapLayout.png"));
+
+        listOfMaps = new ArrayList(Arrays.asList(ac35Map, oMap, iMap, mMap));
+        mapImage.setImage(listOfMaps.get(currentMapIndex));
+        Platform.runLater(() -> {
+            mapImage.fitWidthProperty()
+                    .bind(mapImage.getScene().getWindow().widthProperty().multiply(0.6));
+        });
+    }
+
+    /**
+     * Hosts a game
+     */
+    public void hostGamePressed() {
+        try {
+            App.game = new Event(false, currentMapIndex);
+            App.gameType = currentMapIndex;
+            connectSocket("localhost", 4942);
+            alertMatchBrowser();
+
+        } catch (EventConstructionException e) {
+            Logger.getGlobal().log(Level.SEVERE, "Could not create Event.", e);
+            throw new RuntimeException(e);
+        } catch (IOException e) {
+            e.printStackTrace();
+        }
+    }
+
+    /**
+     * Sends info to the match browser so clients can see it
+     */
+    public void alertMatchBrowser(){
+        try{
+            matchBrowserInterface.startSendingHostData(App.game.getHostedGameData(), udpSocket);
+        }catch (IOException e){
+            System.err.println("failed to send out hosted game info");
+        }
+    }
+
+    /**
+     * Connect to a socket
+     * @param address address of the server
+     * @param port port that the server is run off
+     * @throws IOException socket error
+     */
+    public void connectSocket(String address, int port) throws IOException {
+        Socket socket = new Socket(address, port);
+        InGameLobbyController iglc = (InGameLobbyController)loadScene("gameLobby.fxml");
+        iglc.enterGameLobby(socket, true);
+    }
+
+    /**
+     * Menu button pressed. Prompt alert then return to menu
+     * @throws IOException socket error
+     */
+    public void menuBtnPressed() throws Exception {
+        Alert alert = new Alert(Alert.AlertType.CONFIRMATION);
+        alert.setTitle("Quitting race");
+        alert.setContentText("Do you wish to quit the race?");
+        alert.setHeaderText("You are about to quit the race");
+        Optional<ButtonType> result = alert.showAndWait();
+        if(result.get() == ButtonType.OK){
+            loadTitleScreen();
+        }
+    }
+
+    /**
+     * Method called when the 'next' arrow button is pressed. It is used to
+     * change the currently displayed map preview to the next in the list.
+     */
+    public void nextImage(){
+        // increase index
+        currentMapIndex = (currentMapIndex + 1) % listOfMaps.size();
+        // update map preview
+        mapImage.setImage(listOfMaps.get(currentMapIndex));
+    }
+
+    /**
+     * Method called when the 'previous' arrow button is pressed. It is used to
+     * change the currently displayed map preview to the previous in the list.
+     */
+    public void previousImage(){
+        // decrease index
+        currentMapIndex = ((((currentMapIndex - 1) % listOfMaps.size()) +
+                listOfMaps.size()) % listOfMaps.size());
+        // update map preview
+        mapImage.setImage(listOfMaps.get(currentMapIndex));
+    }
+
+    public void setCurrentMapIndex(Integer index){
+        this.currentMapIndex = index;
+    }
+
+}

racevisionGame/src/main/java/visualiser/Controllers/InGameLobbyController.java

@@ -0,0 +1,365 @@
+package visualiser.Controllers;
+
+import com.interactivemesh.jfx.importer.stl.StlMeshImporter;
+import javafx.animation.AnimationTimer;
+import javafx.application.Platform;
+import javafx.collections.FXCollections;
+import javafx.collections.ListChangeListener;
+import javafx.collections.ObservableList;
+import javafx.fxml.FXML;
+import javafx.geometry.Insets;
+import javafx.scene.Node;
+import javafx.scene.control.Alert;
+import javafx.scene.control.ButtonType;
+import javafx.scene.control.Label;
+import javafx.scene.image.ImageView;
+import javafx.scene.layout.AnchorPane;
+import javafx.scene.layout.GridPane;
+import javafx.scene.shape.MeshView;
+import mock.app.Event;
+import network.Messages.Enums.RaceStatusEnum;
+import network.Messages.Enums.RequestToJoinEnum;
+import visualiser.app.App;
+import visualiser.gameController.ControllerClient;
+import visualiser.layout.SeaSurface;
+import visualiser.layout.Subject3D;
+import visualiser.layout.View3D;
+import visualiser.model.VisualiserBoat;
+import visualiser.model.VisualiserRaceEvent;
+import visualiser.model.VisualiserRaceState;
+
+import java.io.IOException;
+import java.net.Socket;
+import java.net.URL;
+import java.time.temporal.ChronoUnit;
+import java.util.*;
+import java.util.logging.Level;
+import java.util.logging.Logger;
+
+/**
+ * Controller for Hosting a game.
+ */
+public class InGameLobbyController extends Controller {
+    @FXML
+    private ImageView imageView;
+
+    @FXML
+    GridPane playerContainer;
+
+
+    @FXML
+    private Label playerLabel;
+
+    @FXML
+    private Label playerLabel2;
+
+    @FXML
+    private Label playerLabel3;
+
+    @FXML
+    private Label playerLabel4;
+
+    @FXML
+    private Label playerLabel5;
+
+    @FXML
+    private Label playerLabel6;
+
+    @FXML
+    private Label countdownLabel;
+
+    @FXML
+    private AnchorPane countdownTenPane;
+
+    @FXML
+    private Label countdownTenText;
+
+    private Event game;
+
+    private View3D playerBoat;
+
+    private VisualiserRaceEvent visualiserRaceEvent;
+
+    private boolean isHost;
+
+    private ControllerClient controllerClient;
+
+    private ArrayList<Label> allPlayerLabels;
+
+    private ObservableList<Subject3D> subjects = FXCollections.observableArrayList();
+
+    private StlMeshImporter importer;
+
+    private PopulatePlayers lobbyUpdateListener;
+
+
+    public void initialize() {
+        allPlayerLabels = new ArrayList(Arrays.asList(playerLabel, playerLabel2,
+                playerLabel3,
+                playerLabel4,
+                playerLabel5,
+                playerLabel6));
+
+        URL asset = HostGameController.class.getClassLoader().getResource("assets/V1.2 Complete Boat.stl");
+        importer = new StlMeshImporter();
+        importer.read(asset);
+        lobbyUpdateListener = new PopulatePlayers();
+
+    }
+
+    private void resetLobby(){
+        for (Label label: allPlayerLabels){
+            label.setText("No Player");
+        }
+        List<Node> nodeCopy = new ArrayList(playerContainer.getChildren());
+        for (Node node: nodeCopy){
+            if (node instanceof View3D){
+                playerContainer.getChildren().remove(node);
+            }
+        }
+    }
+
+    public class PopulatePlayers implements ListChangeListener {
+
+        @Override
+        public void onChanged(Change change) {
+            Platform.runLater(
+                    () -> {
+                        while (change.next()){
+                            if (change.wasAdded() || change.wasRemoved() || change.wasUpdated()){
+                                try{
+                                    resetLobby();
+                                    int count = 0;
+                                    int row = 0;
+                                    for (VisualiserBoat boat :visualiserRaceEvent.getVisualiserRaceState().getBoats()) {
+                                        View3D playerBoatToSet = new View3D();
+                                        playerBoatToSet.setItems(subjects);
+
+                                        playerContainer.add(playerBoatToSet, (count % 3) , row);
+                                        playerContainer.setMargin(playerBoatToSet, new Insets(10, 10, 10, 10));
+
+                                        SeaSurface sea = new SeaSurface(750, 200);
+                                        sea.setX(250);
+                                        sea.setZ(210);
+                                        subjects.add(sea);
+
+                                        MeshView mesh = new MeshView(importer.getImport());
+                                        Subject3D subject = new Subject3D(mesh,0);
+                                        subjects.add(subject);
+
+                                        playerBoatToSet.setDistance(50);
+                                        playerBoatToSet.setYaw(45);
+                                        playerBoatToSet.setPitch(20);
+
+
+
+                                        AnimationTimer rotate = new AnimationTimer() {
+                                            @Override
+                                            public void handle(long now) {
+                                                subject.setHeading(subject.getHeading().getAngle() + 0.1);
+                                            }
+                                        };
+                                        rotate.start();
+
+                                        allPlayerLabels.get(count).setText("Player: " + boat.getSourceID());
+                                        allPlayerLabels.get(count).toFront();
+                                        count += 1;
+                                        if (count > 2){
+                                            row = 1;
+                                        }
+                                    }
+                                }
+                                catch(ConcurrentModificationException e){
+                                }
+                            }
+                        }
+                    }
+            );
+        }
+    }
+    /*
+    private void populatePlayers(ListChangeListener.Change change){
+    }*/
+
+    /**
+     * Starts the race.
+     */
+    private void startRace() {
+         //Initialises the race clock.
+        initialiseRaceClock(this.visualiserRaceEvent.getVisualiserRaceState());
+
+
+        //Starts the race countdown timer.
+        countdownTimer();
+    }
+
+    /**
+     * Initialises the race clock/timer labels for the start time, current time, and remaining time.
+     * @param visualiserRace The race to get data from.
+     */
+    private void initialiseRaceClock(VisualiserRaceState visualiserRace) {
+        //Remaining time.
+        initialiseRaceClockDuration(visualiserRace);
+
+    }
+
+
+    /**
+     * Initialises the race duration label.
+     * @param visualiserRace The race to get data from.
+     */
+    private void initialiseRaceClockDuration(VisualiserRaceState visualiserRace) {
+
+        visualiserRace.getRaceClock().durationProperty().addListener((observable, oldValue, newValue) -> {
+            Platform.runLater(() -> {
+                countdownLabel.setText(newValue);
+            });
+        });
+
+    }
+    /**
+     * Countdown timer until race starts.
+     */
+    private void countdownTimer() {
+        new AnimationTimer() {
+            @Override
+            public void handle(long arg0) {
+
+                //Get the current race status.
+                RaceStatusEnum raceStatus = visualiserRaceEvent.getVisualiserRaceState().getRaceStatusEnum();
+
+                //Try catch for getting interval times
+                try {
+                    long interval = ChronoUnit.MILLIS.between(visualiserRaceEvent.getVisualiserRaceState().getRaceClock().getCurrentTime(), visualiserRaceEvent.getVisualiserRaceState().getRaceClock().getStartingTime());
+                    if(interval<=10000){
+                        countdownLabel.setVisible(false);
+                        countdownTenPane.setVisible(true);
+                        countdownTenText.setVisible(true);
+                    }
+                    countdownText(interval);
+                } catch (Exception e){
+
+                }
+
+
+                //If the race has reached the preparatory phase, or has started...
+                if (raceStatus == RaceStatusEnum.PREPARATORY || raceStatus == RaceStatusEnum.STARTED) {
+                    //Stop this timer.
+                    stop();
+
+                    //Hide this, and display the race controller.
+                    try {
+                        visualiserRaceEvent.getVisualiserRaceState().getBoats().removeListener(lobbyUpdateListener);
+
+                        RaceViewController rvc = (RaceViewController)
+                                loadScene("raceView.fxml");
+                        rvc.startRace(visualiserRaceEvent, controllerClient,
+                                isHost);
+                    } catch (IOException e) {
+                        e.printStackTrace();
+                    }
+
+                }
+            }
+        }.start();
+    }
+
+    public void enterGameLobby(Socket socket, boolean isHost){
+        try {
+
+            this.visualiserRaceEvent = new VisualiserRaceEvent(socket, RequestToJoinEnum.PARTICIPANT);
+            this.isHost = isHost;
+            this.controllerClient = visualiserRaceEvent.getControllerClient();
+
+            this.visualiserRaceEvent.getVisualiserRaceState().getBoats().addListener(this.lobbyUpdateListener);
+
+            startRace();
+        } catch (IOException e) {
+            //TODO should probably let this propagate, so that we only enter this scene if everything works
+            Logger.getGlobal().log(Level.WARNING, "Could not connect to server.", e);
+        }
+    }
+
+    /**
+     * Menu button pressed. Prompt alert then return to menu
+     * @throws IOException socket erro
+     */
+    public void menuBtnPressed() throws IOException {
+        Alert alert = new Alert(Alert.AlertType.CONFIRMATION);
+        alert.setTitle("Quitting race");
+        alert.setContentText("Do you wish to quit the race?");
+        alert.setHeaderText("You are about to quit the race");
+        Optional<ButtonType> result = alert.showAndWait();
+        if(result.get() == ButtonType.OK){
+            visualiserRaceEvent.terminate();
+
+            try{
+                if(isHost) {
+                    App.game.endEvent();
+                }
+                loadScene("title.fxml");
+
+            }catch (IOException ignore){};
+        }
+    }
+
+    /**
+     * Start button pressed. Currently only prints out start
+     */
+    public void startBtnPressed(){
+        //System.out.println("Should start the race. This button is only visible for the host");
+    }
+
+    public void joinSpecPressed(){
+        //System.out.println("Spectator list pressed. Joining spectators");
+    }
+
+    public void joinRacePressed(){
+        //System.out.println("Empty race user pane pressed. Joining racers");
+    }
+
+    /**
+     * Countdown interval checker that updates the countdown text
+     * @param interval Countdown interval to check
+     */
+    private void countdownText(long interval){
+
+        //Do nothing if 5 seconds or less to go
+        if (interval <=5000){
+            countdownTenPane.setVisible(false);
+            //countdownTenText.setText("5");
+            return;
+        }
+
+        //6 seconds left. Display 1 second for countdown
+        if (interval <=6000){
+            countdownTenText.setText("1");
+            return;
+        }
+
+        //7 seconds left. Display 2 seconds for countdown
+        if (interval <=7000){
+            countdownTenText.setText("2");
+            return;
+        }
+
+        //8 seconds left. Display 3 seconds for countdown
+        if (interval <=8000){
+            countdownTenText.setText("3");
+            return;
+        }
+
+        //9 seconds left. Display 4 seconds for countdown
+        if (interval <=9000){
+            countdownTenText.setText("4");
+            return;
+        }
+
+        //10 seconds left. Display 5 seconds for countdown
+        if (interval <=10000){
+            countdownTenText.setText("5");
+            return;
+        }
+    }
+
+}

racevisionGame/src/main/java/visualiser/Controllers/KeyBindingsController.java

@@ -2,9 +2,6 @@ package visualiser.Controllers;
 
 import javafx.application.Platform;
 import javafx.fxml.FXML;
-import javafx.fxml.FXMLLoader;
-import javafx.scene.Parent;
-import javafx.scene.Scene;
 import javafx.scene.control.Button;
 import javafx.scene.control.ListView;
 import javafx.scene.input.KeyCode;
@@ -20,12 +17,10 @@ import java.io.IOException;
 import java.util.HashMap;
 import java.util.Map;
 
-import static visualiser.app.App.keyFactory;
-
 /**
  * Controller for the scene used to display and update current key bindings.
  */
-public class KeyBindingsController {
+public class KeyBindingsController extends Controller {
     private @FXML Button btnSave;
     private @FXML Button btnCancel;
     private @FXML Button btnReset;
@@ -33,23 +28,27 @@ public class KeyBindingsController {
     private @FXML ListView lstKey;
     private @FXML ListView lstDescription;
     private @FXML AnchorPane anchor;
+    private KeyFactory existingKeyFactory;
     private KeyFactory newKeyFactory;
     private Boolean changed = false;    // keyBindings have been modified
     private Button currentButton = null;    // last button clicked
 
     public void initialize(){
         // create new key factory to modify, keeping the existing one safe
+        existingKeyFactory = new KeyFactory();
+        existingKeyFactory.load();
         newKeyFactory = copyExistingFactory();
         initializeTable();
         populateTable();
         setKeyListener();
+        setClosedListener();
     }
 
     /**
      * Sets up table before populating it.
      * Set up includes headings, CSS styling and modifying default properties.
      */
-    public void initializeTable(){
+    private void initializeTable(){
         // set the headings for each column
         lstKey.getItems().add("Key");
         lstControl.getItems().add("Command");
@@ -67,15 +66,15 @@ public class KeyBindingsController {
 
         // stop the columns from being selectable, so only the buttons are
         lstKey.getSelectionModel().selectedItemProperty()
-                .addListener((observable, oldvalue, newValue) ->
+                .addListener((observable, oldValue, newValue) ->
                         Platform.runLater(() ->
                         lstKey.getSelectionModel().select(0)));
         lstDescription.getSelectionModel().selectedItemProperty()
-                .addListener((observable, oldvalue, newValue) ->
+                .addListener((observable, oldValue, newValue) ->
                         Platform.runLater(() ->
                         lstDescription.getSelectionModel().select(0)));
         lstControl.getSelectionModel().selectedItemProperty()
-                .addListener((observable, oldvalue, newValue) ->
+                .addListener((observable, oldValue, newValue) ->
                         Platform.runLater(() ->
                         lstControl.getSelectionModel().select(0)));
     }
@@ -83,7 +82,7 @@ public class KeyBindingsController {
     /**
      * Populates the table with commands and their key binding details.
      */
-    public void populateTable(){
+    private void populateTable(){
         // add each command to the table
         for (Map.Entry<String, ControlKey> entry : newKeyFactory.getKeyState().entrySet()) {
             // create button for command
@@ -100,11 +99,11 @@ public class KeyBindingsController {
 
     /**
      * Makes a copy of the {@link KeyFactory} that does not modify the original.
-     * @return new keyfactory to be modified
+     * @return new keyFactory to be modified
      */
-    public KeyFactory copyExistingFactory(){
+    private KeyFactory copyExistingFactory(){
         newKeyFactory = new KeyFactory();
-        Map<String, ControlKey> oldKeyState = keyFactory.getKeyState();
+        Map<String, ControlKey> oldKeyState = existingKeyFactory.getKeyState();
         Map<String, ControlKey> newKeyState = new HashMap<>();
 
         // copy over commands and their keys
@@ -116,11 +115,32 @@ public class KeyBindingsController {
     }
 
     /**
-     * Creates a listener for the base anchorpane for key presses.
+     * Creates a listener for when a user tries to close the current window.
+     */
+    private void setClosedListener(){
+        anchor.sceneProperty().addListener((obsS, oldS, newS) -> {
+            if (newS != null) {
+                newS.windowProperty().addListener((obsW, oldW, newW) -> {
+                    if (newW != null) {
+                        Stage stage = (Stage)newW;
+                        // WE is processed by onExit method
+                        stage.setOnCloseRequest(we -> {
+                            if (we.getEventType() == WindowEvent.WINDOW_CLOSE_REQUEST) {
+                                onExit(we);
+                            }
+                        });
+                    }
+                });
+            }
+        });
+    }
+
+    /**
+     * Creates a listener for the base anchorPane for key presses.
      * It updates the current key bindings of the {@link KeyFactory} if
      * required.
      */
-    public void setKeyListener(){
+    private void setKeyListener(){
         anchor.addEventFilter(KeyEvent.KEY_PRESSED, event -> {
             // if esc, cancel current button click
             if (event.getCode() == KeyCode.ESCAPE){
@@ -179,15 +199,16 @@ public class KeyBindingsController {
      */
     public void save(){
         if (isFactoryValid()) {
-            keyFactory = newKeyFactory;
+            existingKeyFactory = newKeyFactory;
             newKeyFactory = new KeyFactory();
             changed = false;
-            keyFactory.save();  // save persistently
+            existingKeyFactory.save();  // save persistently
             loadNotification("Key bindings were successfully saved.", false);
         } else {
             loadNotification("One or more key bindings are missing. " +
                     "Failed to save.", true);
         }
+        ((Stage)btnCancel.getScene().getWindow()).close();
     }
 
     /**
@@ -195,10 +216,10 @@ public class KeyBindingsController {
      * commands are missing a key binding.
      * @return True if valid, false if invalid
      */
-    public Boolean isFactoryValid(){
+    private Boolean isFactoryValid(){
         for (Map.Entry<String, ControlKey> entry : newKeyFactory.getKeyState().entrySet
                 ()) {
-            if (entry.getKey().toString()==entry.getValue().toString()){
+            if (entry.getKey().equals(entry.getValue().toString())){
                 return false;
             }
         }
@@ -211,7 +232,7 @@ public class KeyBindingsController {
      * @param we {@link WindowEvent} close request to be consumed if settings
      *                             have not been successfully saved.
      */
-    public void onExit(WindowEvent we){
+    private void onExit(WindowEvent we){
         // if modified KeyFactory hasn't been saved
         if (changed){
             loadNotification("Please cancel or save your changes before exiting" +
@@ -225,23 +246,15 @@ public class KeyBindingsController {
      * @param message the message to be displayed to the user
      * @param warning true if the message to be displayed is due to user error
      */
-    public void loadNotification(String message, Boolean warning){
-        Parent root = null;
-        FXMLLoader loader = new FXMLLoader(getClass().getResource
-                ("/visualiser/scenes/notification.fxml"));
+    private void loadNotification(String message, Boolean warning){
         try {
-            root = loader.load();
+            NotificationController nc = (NotificationController)
+                    loadPopupScene("notification.fxml",
+                    "", Modality.APPLICATION_MODAL);
+            nc.setMessage(message, warning);
         } catch (IOException e) {
             e.printStackTrace();
         }
-        NotificationController controller = loader.getController();
-        Stage stage = new Stage();
-        stage.setScene(new Scene(root));
-        stage.centerOnScreen();
-        stage.initModality(Modality.APPLICATION_MODAL);
-        stage.show();
-        // displays given message in the window
-        controller.setMessage(message, warning);
     }
 
 }

racevisionGame/src/main/java/visualiser/Controllers/LobbyController.java

@@ -9,47 +9,47 @@ import javafx.scene.control.TableView;
 import javafx.scene.control.TextField;
 import javafx.scene.layout.AnchorPane;
 import javafx.scene.media.AudioClip;
+import network.Messages.HostGame;
+import visualiser.app.MatchBrowserSingleton;
 import visualiser.model.RaceConnection;
+import visualiser.network.MatchBrowserLobbyInterface;
 
 import java.io.IOException;
+import java.net.DatagramSocket;
 import java.net.Socket;
-import java.net.URL;
-import java.util.ResourceBundle;
+import java.net.SocketException;
+import java.util.Observable;
+import java.util.Observer;
 
 /**
  * Controller for the Lobby for entering games
  */
 public class LobbyController extends Controller {
-
-    @FXML
-    private AnchorPane lobbyWrapper;
-    @FXML
-    private TableView<RaceConnection> lobbyTable;
-    @FXML
-    private TableColumn<RaceConnection, String> gameNameColumn;
-    @FXML
-    private TableColumn<RaceConnection, String> hostNameColumn;
-    @FXML
-    private TableColumn<RaceConnection, String> statusColumn;
-    @FXML
-    private Button joinGameBtn;
-    @FXML
-    private TextField addressFld;
-    @FXML
-    private TextField portFld;
+    private @FXML TableView<RaceConnection> lobbyTable;
+    private @FXML TableColumn<RaceConnection, String> gameNameColumn;
+    private @FXML TableColumn<RaceConnection, String> hostNameColumn;
+    private @FXML TableColumn<RaceConnection, String> statusColumn;
+    private @FXML Button joinGameBtn;
+    private @FXML TextField addressFld;
+    private @FXML TextField portFld;
 
     private ObservableList<RaceConnection> connections;
+    private ObservableList<RaceConnection> customConnections;
 
     private AudioClip sound;
 
+    //the socket for match browser
+    private DatagramSocket udpSocket;
+    private MatchBrowserLobbyInterface matchBrowserLobbyInterface;
 
-    @Override
-    public void initialize(URL location, ResourceBundle resources) {
+
+    public void initialize() {
+        // set up the connection table
         connections = FXCollections.observableArrayList();
+        customConnections = FXCollections.observableArrayList();
         //connections.add(new RaceConnection("localhost", 4942, "Local Game"));
 
         lobbyTable.setItems(connections);
-
         gameNameColumn.setCellValueFactory(cellData -> cellData.getValue().gamenameProperty());
         hostNameColumn.setCellValueFactory(cellData -> cellData.getValue().hostnameProperty());
         statusColumn.setCellValueFactory(cellData -> cellData.getValue().statusProperty());
@@ -57,12 +57,14 @@ public class LobbyController extends Controller {
         lobbyTable.getSelectionModel().selectedItemProperty().addListener((obs, prev, curr) -> {
             if (curr != null && curr.statusProperty().getValue().equals("Ready")) {
                 joinGameBtn.setDisable(false);
-            }
-            else {
+            } else {
                 joinGameBtn.setDisable(true);
             }
         });
         joinGameBtn.setDisable(true);
+
+        this.udpSocket = MatchBrowserSingleton.getInstance().getUdpSocket();
+        receiveMatchData();
     }
 
     /**
@@ -71,6 +73,7 @@ public class LobbyController extends Controller {
     public void refreshBtnPressed(){
         sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
         sound.play();
+        addServerGames();
         for(RaceConnection connection: connections) {
             connection.check();
         }
@@ -80,28 +83,25 @@ public class LobbyController extends Controller {
             } else {
                 joinGameBtn.setDisable(true);
             }
-        } catch (Exception e){}
+        } catch (Exception ignored){}
     }
 
     /**
      * Connect to a connection.
+     * @throws IOException socket error
      */
-    public void connectSocket() {
-        try{
+    public void connectSocket() throws IOException {
         RaceConnection connection = lobbyTable.getSelectionModel().getSelectedItem();
         Socket socket = new Socket(connection.getHostname(), connection.getPort());
-            lobbyWrapper.setVisible(false);
-            parent.enterLobby(socket, false);
-        } catch (IOException e) { /* Never reached */
-            e.printStackTrace();
-        }
+        InGameLobbyController iglc = (InGameLobbyController)loadScene("gameLobby.fxml");
+        iglc.enterGameLobby(socket, false);
     }
 
-    public void menuBtnPressed(){
+    public void menuBtnPressed() throws IOException {
         sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
         sound.play();
-        lobbyWrapper.setVisible(false);
-        parent.enterTitle();
+        matchBrowserLobbyInterface.closeSocket();
+        loadScene("title.fxml");
     }
 
     /**
@@ -114,7 +114,8 @@ public class LobbyController extends Controller {
         String portString = portFld.getText();
         try {
             int port = Integer.parseInt(portString);
-            connections.add(new RaceConnection(hostName, port, "Boat Game"));
+            customConnections.add(new RaceConnection(hostName, port, "Boat Game"));
+            connections.addAll(customConnections);
             addressFld.clear();
             portFld.clear();
         } catch (NumberFormatException e) {
@@ -122,14 +123,30 @@ public class LobbyController extends Controller {
         }
     }
 
-    public AnchorPane startWrapper(){
-        return lobbyWrapper;
+    public void receiveMatchData(){
+        matchBrowserLobbyInterface = new MatchBrowserLobbyInterface();
+        try {
+            matchBrowserLobbyInterface.startReceivingHostData(new DatagramSocket(4941));
+            Observer o = new Observer() {
+                @Override
+                public void update(Observable o, Object arg) {
+                    refreshBtnPressed();
+                }
+            };
+            matchBrowserLobbyInterface.addObserver(o);
+        } catch (SocketException e) {
+            System.err.println("Socket 4941 in use");
+        }
     }
 
     /**
-     * Enter the lobby page.
+     * Adds the games received from the server
      */
-    public void enterLobby(){
-        lobbyWrapper.setVisible(true);
+    private void addServerGames() {
+        connections.clear();
+        connections.addAll(customConnections);
+        for (HostGame game : matchBrowserLobbyInterface.getGames()) {
+            connections.add(new RaceConnection(game.getIp(), 4942, "Boat Game"));
+        }
     }
 }

racevisionGame/src/main/java/visualiser/Controllers/MainController.java

@@ -1,158 +0,0 @@
-package visualiser.Controllers;
-
-import javafx.collections.ObservableList;
-import javafx.fxml.FXML;
-import javafx.scene.layout.AnchorPane;
-import javafx.scene.media.AudioClip;
-import visualiser.app.App;
-import visualiser.gameController.ControllerClient;
-import visualiser.model.VisualiserBoat;
-import visualiser.model.VisualiserRaceEvent;
-
-import java.io.IOException;
-import java.net.Socket;
-import java.net.URL;
-import java.util.ResourceBundle;
-
-
-/**
- * Controller that everything is overlayed onto. This makes it so that changing scenes does not resize your stage.
- */
-public class MainController extends Controller {
-
-    @FXML private StartController startController;
-    @FXML private RaceController raceController;
-    @FXML private ConnectionController connectionController;
-    @FXML private FinishController finishController;
-    @FXML private TitleController titleController;
-    @FXML private HostController hostController;
-    @FXML private LobbyController lobbyController;
-
-    private AudioClip sound;
-
-
-    /**
-     * Ctor.
-     */
-    public MainController() {
-    }
-
-
-
-    /**
-     * Transitions from the StartController screen (displays pre-race information) to the RaceController (displays the actual race).
-     * @param visualiserRace The object modelling the race.
-     * @param controllerClient Socket Client that manipulates the controller.
-     * @param isHost if the client is the host of a race or not.
-     */
-    public void beginRace(VisualiserRaceEvent visualiserRace, ControllerClient controllerClient, Boolean isHost) {
-        raceController.startRace(visualiserRace, controllerClient, isHost);
-    }
-
-    public void endEvent() throws IOException { hostController.endEvent(); }
-
-    /**
-     * Transitions from the server selection screen to the pre-race lobby for a given server.
-     * @param socket The server to read data from.
-     * @param isHost is connection a host
-     */
-    public void enterLobby(Socket socket, Boolean isHost) {
-        sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
-        sound.play();
-        startController.enterLobby(socket, isHost);
-    }
-
-    /**
-     * Transitions from the {@link RaceController} screen to the {@link FinishController} screen.
-     * @param boats The boats to display on the finish screen.
-     */
-    public void enterFinish(ObservableList<VisualiserBoat> boats) {
-        finishController.enterFinish(boats);
-    }
-
-    /**
-     * Transitions into the title screen
-     */
-    public void enterTitle() {
-        titleController.enterTitle();
-    }
-
-    /**
-     * Transitions into lobby screen
-     */
-    public void enterLobby(){
-        sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
-        sound.play();
-        lobbyController.enterLobby(); }
-
-    /**
-     * Transitions into host game screen
-     */
-    public void hostGame(){
-        sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
-        sound.play();
-        hostController.hostGame(); }
-
-    /**
-     * Sets up the css for the start of the program
-     */
-    public void startCss(){titleController.setDayMode();}
-
-    /**
-     * host controller host a game
-     * @throws IOException throws exception
-     */
-    public void beginGame() throws IOException {
-        hostController.hostGamePressed();
-    }
-
-    public void setGameType(int gameType){
-        hostController.setGameType(gameType);
-    }
-
-    public int getGameType(){ return hostController.getGameType(); }
-
-    /**
-     * Main Controller for the applications will house the menu and the displayed pane.
-     *
-     * @param location  of resources
-     * @param resources bundle
-     */
-    @Override
-    public void initialize(URL location, ResourceBundle resources) {
-
-        startController.setParent(this);
-        raceController.setParent(this);
-        connectionController.setParent(this);
-        finishController.setParent(this);
-        titleController.setParent(this);
-        hostController.setParent(this);
-        lobbyController.setParent(this);
-
-
-        AnchorPane.setTopAnchor(startController.startWrapper(), 0.0);
-        AnchorPane.setBottomAnchor(startController.startWrapper(), 0.0);
-        AnchorPane.setLeftAnchor(startController.startWrapper(), 0.0);
-        AnchorPane.setRightAnchor(startController.startWrapper(), 0.0);
-
-        AnchorPane.setTopAnchor(lobbyController.startWrapper(), 0.0);
-        AnchorPane.setBottomAnchor(lobbyController.startWrapper(), 0.0);
-        AnchorPane.setLeftAnchor(lobbyController.startWrapper(), 0.0);
-        AnchorPane.setRightAnchor(lobbyController.startWrapper(), 0.0);
-
-        AnchorPane.setTopAnchor(hostController.startWrapper(), 0.0);
-        AnchorPane.setBottomAnchor(hostController.startWrapper(), 0.0);
-        AnchorPane.setLeftAnchor(hostController.startWrapper(), 0.0);
-        AnchorPane.setRightAnchor(hostController.startWrapper(), 0.0);
-
-        AnchorPane.setTopAnchor(finishController.finishWrapper, 0.0);
-        AnchorPane.setBottomAnchor(finishController.finishWrapper, 0.0);
-        AnchorPane.setLeftAnchor(finishController.finishWrapper, 0.0);
-        AnchorPane.setRightAnchor(finishController.finishWrapper, 0.0);
-
-        AnchorPane.setTopAnchor(titleController.titleWrapper, 0.0);
-        AnchorPane.setBottomAnchor(titleController.titleWrapper, 0.0);
-        AnchorPane.setLeftAnchor(titleController.titleWrapper, 0.0);
-        AnchorPane.setRightAnchor(titleController.titleWrapper, 0.0);
-    }
-}

racevisionGame/src/main/java/visualiser/Controllers/NotificationController.java

@@ -9,7 +9,7 @@ import javafx.stage.Stage;
 /**
  * Controller for a popup notification regarding user activity.
  */
-public class NotificationController {
+public class NotificationController extends Controller{
     private @FXML Label lblDescription;
     private @FXML Text txtMessage;
 

racevisionGame/src/main/java/visualiser/Controllers/RaceFinishController.java

@@ -0,0 +1,39 @@
+package visualiser.Controllers;
+
+import javafx.collections.ObservableList;
+import javafx.fxml.FXML;
+import javafx.scene.control.Label;
+import javafx.scene.control.TableColumn;
+import javafx.scene.control.TableView;
+import visualiser.model.VisualiserBoat;
+
+/**
+ * Finish Screen for when the race finishes.
+ */
+public class RaceFinishController extends Controller {
+    private @FXML TableView<VisualiserBoat> boatInfoTable;
+    private @FXML TableColumn<VisualiserBoat, String> boatRankColumn;
+    private @FXML TableColumn<VisualiserBoat, String> boatNameColumn;
+    private @FXML Label raceWinnerLabel;
+
+    /**
+     * Display the table
+     * @param boats boats to display on the table.
+     */
+    public void loadFinish(ObservableList<VisualiserBoat> boats) {
+        // set table contents
+        boatInfoTable.setItems(boats);
+        //Name.
+        boatNameColumn.setCellValueFactory(cellData -> cellData.getValue().nameProperty());
+        //Rank/position.
+        boatRankColumn.setCellValueFactory(cellData -> cellData.getValue().placingProperty());
+
+        //Winner label.
+        if (boats.size() > 0) {
+            raceWinnerLabel.setText("Winner: " +
+                    boatNameColumn.getCellObservableValue(0).getValue());
+            raceWinnerLabel.setWrapText(true);
+        }
+    }
+
+}

racevisionGame/src/main/java/visualiser/Controllers/RaceStartController.java

@@ -0,0 +1,141 @@
+package visualiser.Controllers;
+
+import javafx.animation.AnimationTimer;
+import javafx.application.Platform;
+import javafx.collections.ObservableList;
+import javafx.fxml.FXML;
+import javafx.scene.control.Label;
+import javafx.scene.control.TableColumn;
+import javafx.scene.control.TableView;
+import network.Messages.Enums.RaceStatusEnum;
+import network.Messages.Enums.RequestToJoinEnum;
+import visualiser.gameController.ControllerClient;
+import visualiser.model.VisualiserBoat;
+import visualiser.model.VisualiserRaceEvent;
+import visualiser.model.VisualiserRaceState;
+
+import java.io.IOException;
+import java.net.Socket;
+import java.util.logging.Level;
+import java.util.logging.Logger;
+
+/**
+ * Controller to for waiting for the race to start.
+ */
+public class RaceStartController extends Controller {
+    private @FXML Label raceTitleLabel;
+    private @FXML Label raceStartLabel;
+    private @FXML Label timeZoneTime;
+    private @FXML Label timer;
+    private @FXML TableView<VisualiserBoat> boatNameTable;
+    private @FXML TableColumn<VisualiserBoat, String> boatNameColumn;
+    private @FXML TableColumn<VisualiserBoat, String> boatCodeColumn;
+    private @FXML Label raceStatusLabel;
+
+    private VisualiserRaceEvent visualiserRaceEvent;
+    private VisualiserRaceState raceState;
+    private ControllerClient controllerClient;
+    private boolean isHost;
+
+    /**
+     * Show starting information for a race given a socket.
+     * Intended to be called on loading the scene.
+     * @param socket network source of information
+     * @param isHost is user a host
+     */
+    public void enterLobby(Socket socket, Boolean isHost) {
+        try {
+            this.isHost = isHost;
+            this.visualiserRaceEvent = new VisualiserRaceEvent(socket, RequestToJoinEnum.PARTICIPANT);
+            this.controllerClient = visualiserRaceEvent.getControllerClient();
+            this.raceState = visualiserRaceEvent.getVisualiserRaceState();
+            showRaceDetails();
+        } catch (IOException e) {
+            //TODO should probably let this propagate, so that we only enter this scene if everything works
+            Logger.getGlobal()
+                    .log(Level.WARNING, "Could not connect to server.", e);
+        }
+    }
+
+    /**
+     * Displays details and starts the timer for the race being started
+     */
+    private void showRaceDetails() {
+        raceTitleLabel.setText(this.raceState.getRegattaName());
+        initialiseBoatTable();
+        initialiseRaceClock();
+        countdownTimer();
+    }
+
+    /**
+     * Initialises the boat table that is to be shown on the pane.
+     */
+    private void initialiseBoatTable() {
+        //Get the boats.
+        ObservableList<VisualiserBoat> boats =
+                this.raceState.getBoats();
+
+        //Populate table.
+        boatNameTable.setItems(boats);
+        boatNameColumn.setCellValueFactory(cellData -> cellData.getValue().nameProperty());
+        boatCodeColumn.setCellValueFactory(cellData -> cellData.getValue().countryProperty());
+    }
+
+    /**
+     * Initialises the race clock/timer labels for the start time, current time, and remaining time.
+     */
+    private void initialiseRaceClock() {
+        raceStartLabel.setText(
+                this.raceState.getRaceClock().getStartingTimeString());
+
+        // init clock start time
+        this.raceState.getRaceClock().startingTimeProperty().addListener((observable, oldValue, newValue) -> {
+            Platform.runLater(() -> {
+                raceStartLabel.setText(newValue);
+            });
+        });
+
+        // init clock current time
+        this.raceState.getRaceClock().currentTimeProperty().addListener((observable, oldValue, newValue) -> {
+            Platform.runLater(() -> {
+                timeZoneTime.setText(newValue);
+            });
+        });
+
+        // init clock remaining time
+        this.raceState.getRaceClock().durationProperty().addListener((observable, oldValue, newValue) -> {
+            Platform.runLater(() -> {
+                timer.setText(newValue);
+            });
+        });
+    }
+
+    /**
+     * Countdown timer until race starts.
+     */
+    private void countdownTimer() {
+        new AnimationTimer() {
+            @Override
+            public void handle(long arg0) {
+                // display current race status
+                RaceStatusEnum raceStatus = raceState.getRaceStatusEnum();
+                raceStatusLabel.setText("Race Status: " + raceStatus.name());
+
+                // if race is in PREPARATORY or STARTED status
+                if (raceStatus == RaceStatusEnum.PREPARATORY || raceStatus == RaceStatusEnum.STARTED) {
+                    stop(); // stop this timer
+                    // load up the race scene
+                    try {
+                        RaceViewController rvc = (RaceViewController)
+                                loadScene("raceView.fxml");
+                        rvc.startRace(visualiserRaceEvent, controllerClient,
+                                isHost);
+                    } catch (IOException e) {
+                        e.printStackTrace();
+                    }
+                }
+            }
+        }.start();
+    }
+
+}

racevisionGame/src/main/java/visualiser/Controllers/RaceViewController.java

@@ -21,10 +21,7 @@ import javafx.scene.layout.StackPane;
 import javafx.scene.paint.Color;
 import javafx.scene.paint.Material;
 import javafx.scene.paint.PhongMaterial;
-import javafx.scene.shape.Box;
-import javafx.scene.shape.MeshView;
-import javafx.scene.shape.Shape3D;
-import javafx.scene.shape.Sphere;
+import javafx.scene.shape.*;
 import javafx.scene.transform.Translate;
 import javafx.util.Callback;
 import network.Messages.Enums.RaceStatusEnum;
@@ -37,111 +34,120 @@ import visualiser.gameController.ControllerClient;
 import visualiser.gameController.Keys.ControlKey;
 import visualiser.layout.*;
 import visualiser.model.*;
+import visualiser.gameController.Keys.KeyFactory;
+import visualiser.layout.Subject3D;
+import visualiser.layout.View3D;
+import visualiser.model.Sparkline;
+import visualiser.model.VisualiserBoat;
+import visualiser.model.VisualiserRaceEvent;
+import visualiser.model.VisualiserRaceState;
 import visualiser.utils.GPSConverter;
 
 import java.io.IOException;
 import java.net.URL;
-import java.util.*;
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.Map;
+import java.util.Optional;
 import java.util.logging.Level;
 import java.util.logging.Logger;
 
-import static visualiser.app.App.keyFactory;
-
-
 /**
  * Controller used to display a running race.
  */
-public class RaceController extends Controller {
-    /**
-     * The race object which describes the currently occurring race.
-     */
+public class RaceViewController extends Controller {
     private VisualiserRaceEvent visualiserRace;
-
-    /**
-     * Service for sending keystrokes to server
-     */
+    private VisualiserRaceState raceState;
     private ControllerClient controllerClient;
-
+    private KeyFactory keyFactory = new KeyFactory();
+    private boolean infoTableShow = true;  // shown or hidden
     private boolean isHost;
-
     private TutorialState currentState;
-
     private ArrayList<TutorialState> tutorialStates;
-
     private boolean isTutorial = false;
-
     private String keyToPress;
-
-
-    /**
-     * state of the info table
-     */
-    private boolean infoTableShow;
-
     private View3D view3D;
     private ObservableList<Subject3D> viewSubjects;
 
+    /**
+     * Arrow pointing to next mark in third person
+     */
     private Subject3D nextMarkArrow;
-    private ChangeListener<? super GPSCoordinate> pointToMark;
-
     /**
-     * The arrow controller.
+     * Animation loop for rotating mark arrow
      */
-    @FXML private ArrowController arrowController;
-
-    @FXML private GridPane canvasBase;
-
-    @FXML private SplitPane racePane;
-
-    @FXML private Label tutorialText;
-
+    private AnimationTimer pointToMark;
+
+    // note: it says it's not used but it is! do not remove :)
+    private @FXML ArrowController arrowController;
+    private @FXML GridPane canvasBase;
+    private @FXML SplitPane racePane;
+    private @FXML StackPane arrowPane;
+    private @FXML Label timer;
+    private @FXML Label FPS;
+    private @FXML Label timeZone;
+    private @FXML CheckBox showFPS;
+    private @FXML TableView<VisualiserBoat> boatInfoTable;
+    private @FXML TableColumn<VisualiserBoat, String> boatPlacingColumn;
+    private @FXML TableColumn<VisualiserBoat, String> boatTeamColumn;
+    private @FXML TableColumn<VisualiserBoat, Leg> boatMarkColumn;
+    private @FXML TableColumn<VisualiserBoat, Number> boatSpeedColumn;
+    private @FXML LineChart<Number, Number> sparklineChart;
+    private @FXML Label tutorialText;
 
     /**
-     * This is the pane we place the actual arrow control inside of.
+     * Displays a specified race.
+     * Intended to be called on loading the scene.
+     * @param visualiserRace   Object modelling the race.
+     * @param controllerClient Socket Client that manipulates the controller.
+     * @param isHost           is user a host
      */
-    @FXML private StackPane arrowPane;
-    @FXML private Label timer;
-    @FXML private Label FPS;
-    @FXML private Label timeZone;
-    @FXML private CheckBox showFPS;
-    @FXML private TableView<VisualiserBoat> boatInfoTable;
-    @FXML private TableColumn<VisualiserBoat, String> boatPlacingColumn;
-    @FXML private TableColumn<VisualiserBoat, String> boatTeamColumn;
-    @FXML private TableColumn<VisualiserBoat, Leg> boatMarkColumn;
-    @FXML private TableColumn<VisualiserBoat, Number> boatSpeedColumn;
-    @FXML private LineChart<Number, Number> sparklineChart;
+    public void startRace(VisualiserRaceEvent visualiserRace, ControllerClient controllerClient, Boolean isHost) {
+        this.visualiserRace = visualiserRace;
+        this.raceState = visualiserRace.getVisualiserRaceState();
+        this.controllerClient = controllerClient;
+        this.isHost = isHost;
+        keyFactory.load();
 
-    private AnimationTimer arrowToNextMark;
+        tutorialCheck();
+        initKeypressHandler();
+        initialiseRaceVisuals();
+    }
 
     /**
-     * Ctor.
+     * Checks if the current game is a tutorial race and sets up initial
+     * tutorial displays if it is.
      */
-    public RaceController() {
-
-        // Import arrow mesh
-        URL asset = HostController.class.getClassLoader().getResource("assets/arrow V1.0.4.stl");
-        StlMeshImporter importer = new StlMeshImporter();
-        importer.read(asset);
+    private void tutorialCheck(){
+        if (App.gameType == 4) {
+            isTutorial = true;
+            tutorialText.setVisible(true);
+            tutorialStates = new ArrayList<>(Arrays.asList(TutorialState.values()));
 
-        MeshView arrow = new MeshView(importer.getImport());
-        PhongMaterial arrowMat = new PhongMaterial(Color.RED);
-        arrow.setMaterial(arrowMat);
+            currentState = tutorialStates.get(0);
+            tutorialStates.remove(0);
+            searchMapForKey("Upwind");
 
-        this.nextMarkArrow = new Annotation3D(arrow);
-        this.nextMarkArrow.setScale(0.1);
+            tutorialText.setText(
+                    "Welcome to the tutorial! Exit at anytime with ESC. \nWe will first learn how to turn upwind. Press " +
+                            keyToPress + " to turn upwind.");
 
+        } else {
+            isTutorial = false;
+            tutorialText.setVisible(false);
+        }
     }
 
-    @Override
-    public void initialize(URL location, ResourceBundle resources) {
-        infoTableShow = true;
+    private AnimationTimer arrowToNextMark;
 
-        // Initialise keyboard handler
+    private void initKeypressHandler() {
         racePane.addEventFilter(KeyEvent.KEY_PRESSED, event -> {
             String codeString = event.getCode().toString();
 
+            // tab key
             if (codeString.equals("TAB")){toggleTable();}
 
+            // any key pressed
             ControlKey controlKey = keyFactory.getKey(codeString);
             if(controlKey != null) {
                 try {
@@ -160,15 +166,15 @@ public class RaceController extends Controller {
                     event.consume();
                 } catch (InterruptedException e) {
                     Thread.currentThread().interrupt();
+                    Logger.getGlobal().log(Level.WARNING, "RaceViewController was interrupted on thread: " + Thread.currentThread() + "while sending: " + controlKey, e);
                     Logger.getGlobal().log(Level.WARNING, "RaceController was interrupted on thread: " + Thread.currentThread() + "while sending: " + controlKey, e);
                 } catch (Exception e) {
                     e.printStackTrace();
                 }
             }
 
-
+            // escape key
             if(event.getCode() == KeyCode.ESCAPE) {
-
                 try {
                     if (isHost) {
                         Alert alert = new Alert(Alert.AlertType.CONFIRMATION);
@@ -176,9 +182,8 @@ public class RaceController extends Controller {
                         alert.setContentText("Do you wish to quit the race? You are the host");
                         Optional<ButtonType> result = alert.showAndWait();
                         if (result.get() == ButtonType.OK) {
-                            parent.endEvent();
-                            racePane.setVisible(false);
-                            App.app.showMainStage(App.getStage());
+                            App.game.endEvent();
+                            loadTitleScreen();
                         }
                     } else {
                         Alert alert = new Alert(Alert.AlertType.CONFIRMATION);
@@ -186,12 +191,9 @@ public class RaceController extends Controller {
                         alert.setContentText("Do you wish to quit the race?");
                         Optional<ButtonType> result = alert.showAndWait();
                         if (result.get() == ButtonType.OK) {
-                            racePane.setVisible(false);
-                            App.app.showMainStage(App.getStage());
+                            loadTitleScreen();
                         }
                     }
-                } catch (IOException e) {
-                    e.printStackTrace();
                 } catch (Exception e) {
                     e.printStackTrace();
                 }
@@ -199,30 +201,32 @@ public class RaceController extends Controller {
         });
     }
 
-
     /**
      * Initialises the various UI components to listen to the {@link #visualiserRace}.
      */
-    private void initialiseRace() {
-        //Fps display.
-        initialiseFps(this.visualiserRace);
-
-        //Information table.
-        initialiseInfoTable(this.visualiserRace);
+    private void initialiseRaceVisuals() {
 
-        //Arrow.
-        initialiseArrow(this.visualiserRace);
-
-        initialiseView3D(this.visualiserRace);
+        // Import arrow mesh
+        URL asset = this.getClass().getClassLoader().getResource("assets/arrow V1.0.4.stl");
+        StlMeshImporter importer = new StlMeshImporter();
+        importer.read(asset);
 
-        //Race timezone label.
-        initialiseRaceTimezoneLabel(this.visualiserRace);
+        MeshView arrow = new MeshView(importer.getImport());
+        PhongMaterial arrowMat = new PhongMaterial(Color.RED);
+        arrow.setMaterial(arrowMat);
 
-        //Race clock.
-        initialiseRaceClock(this.visualiserRace);
+        this.nextMarkArrow = new Annotation3D(arrow);
+        this.nextMarkArrow.setScale(0.1);
 
-        //Start the race animation timer.
-        raceTimer();
+        // initialise displays
+        initialiseFps();
+        initialiseInfoTable();
+        initialiseView3D(this.visualiserRace);
+        initialiseRaceClock();
+        raceTimer();    // start the timer
+        new Sparkline(this.raceState, this.sparklineChart);
+        timeZone.setText(this.raceState.getRaceClock().getTimeZone());
+        arrowController.setWindProperty(this.raceState.windProperty());
     }
 
     private void initialiseView3D(VisualiserRaceEvent race) {
@@ -239,16 +243,16 @@ public class RaceController extends Controller {
         pointLight.setLightOn(true);
 
         // Import boat mesh
-        URL asset = HostController.class.getClassLoader().getResource("assets/V1.2 Complete Boat.stl");
+        URL asset = RaceViewController.class.getClassLoader().getResource("assets/V1.2 Complete Boat.stl");
         StlMeshImporter importer = new StlMeshImporter();
         importer.read(asset);
 
         // Configure camera angles and control
-        URL markerAsset = HostController.class.getClassLoader().getResource("assets/Bouy V1.1.stl");
+        URL markerAsset = RaceViewController.class.getClassLoader().getResource("assets/Bouy V1.1.stl");
         StlMeshImporter importerMark = new StlMeshImporter();
         importerMark.read(markerAsset);
 
-        URL alternateBoatAsset = HostController.class.getClassLoader().getResource("assets/V1.3 BurgerBoat.stl");
+        URL alternateBoatAsset = RaceViewController.class.getClassLoader().getResource("assets/V1.3 BurgerBoat.stl");
         StlMeshImporter importerBurgerBoat = new StlMeshImporter();
         importerBurgerBoat.read(alternateBoatAsset);
 
@@ -323,8 +327,12 @@ public class RaceController extends Controller {
             if(nextMark.getMark2() != null) {
                 view3D.getShape(nextMark.getMark2().getSourceID()).setMaterial(markColor);
             }
+            Subject3D shockwave = new Shockwave(10);
+
+            viewSubjects.add(shockwave);
 
             boat.legProperty().addListener((o, prev, curr) -> swapColours(curr));
+            boat.hasCollidedProperty().addListener((o, prev, curr) -> showCollision(boatModel, shockwave));
         }
         // Fix initial bird's-eye position
         view3D.updatePivot(new Translate(250, 0, 210));
@@ -382,6 +390,29 @@ public class RaceController extends Controller {
         });
     }
 
+    private void showCollision(Subject3D boat, Subject3D shockwave) {
+        AnimationTimer shockFront = new AnimationTimer() {
+            double opacity = 1;
+
+            @Override
+            public void handle(long now) {
+                shockwave.setX(boat.getPosition().getX());
+                shockwave.setY(boat.getPosition().getY());
+                shockwave.setZ(boat.getPosition().getZ());
+
+                if(opacity <= 0) {
+                    shockwave.getMesh().setMaterial(new PhongMaterial(new Color(1,0,0,0)));
+                    this.stop();
+                }
+                else {
+                    shockwave.getMesh().setMaterial(new PhongMaterial(new Color(1,0,0,opacity)));
+                    opacity -= 0.1;
+                }
+            }
+        };
+        shockFront.start();
+    }
+
     private void addThirdPersonAnnotations(Subject3D subject3D) {
         viewSubjects.add(nextMarkArrow);
         final VisualiserBoat boat;
@@ -407,7 +438,9 @@ public class RaceController extends Controller {
         /*
         try {
             VisualiserBoat boat = visualiserRace.getVisualiserRaceState().getBoat(subject3D.getSourceID());
-            this.pointToMark = (o, prev, curr) -> {
+            this.pointToMark = new AnimationTimer() {
+                @Override
+                public void handle(long now) {
                     CompoundMark target = boat.getCurrentLeg().getEndCompoundMark();
                     Bearing headingToMark = GPSCoordinate.calculateBearing(boat.getPosition(), target.getAverageGPSCoordinate());
 
@@ -415,9 +448,9 @@ public class RaceController extends Controller {
                     nextMarkArrow.setY(view3D.getPivot().getY());
                     nextMarkArrow.setZ(view3D.getPivot().getZ() + 10);
                     nextMarkArrow.setHeading(headingToMark.degrees());
+                }
             };
-
-            boat.positionProperty().addListener(pointToMark);
+            pointToMark.start();
         } catch (BoatNotFoundException e) {
             e.printStackTrace();
         }*/
@@ -433,6 +466,7 @@ public class RaceController extends Controller {
         } catch (BoatNotFoundException e) {
             e.printStackTrace();
         }*/
+        //pointToMark.stop();
     }
 
     /**
@@ -463,86 +497,57 @@ public class RaceController extends Controller {
     }
 
     /**
-     * Initialises the frame rate functionality. This allows for toggling the frame rate, and connect the fps label to the race's fps property.
-     * @param visualiserRace The race to connect the fps label to.
-     */
-    private void initialiseFps(VisualiserRaceEvent visualiserRace) {
-
-        //On/off toggle.
-        initialiseFpsToggle();
-
-        //Label value.
-        initialiseFpsLabel(visualiserRace);
-    }
-
-    /**
-     * Initialises a listener for the fps toggle.
+     * Initialises the frame rate functionality. This allows for toggling the
+     * frame rate, and connect the fps label to the race's fps property.
      */
-    private void initialiseFpsToggle() {
-
+    private void initialiseFps() {
+        // fps toggle listener
         showFPS.selectedProperty().addListener((ov, old_val, new_val) -> {
             if (showFPS.isSelected()) {
                 FPS.setVisible(true);
-
             } else {
                 FPS.setVisible(false);
-
             }
         });
 
-    }
-
-    /**
-     * Initialises the fps label to update when the race fps changes.
-     * @param visualiserRace The race to monitor the frame rate of.
-     */
-    private void initialiseFpsLabel(VisualiserRaceEvent visualiserRace) {
-
-        visualiserRace.getFrameRateProperty().addListener((observable, oldValue, newValue) -> {
-            Platform.runLater(() ->  this.FPS.setText("FPS: " + newValue.toString()));
+        // fps label display
+        this.visualiserRace.getFrameRateProperty().addListener((observable,
+                oldValue, newValue) -> {
+            Platform.runLater(() ->
+                    this.FPS.setText("FPS: " + newValue.toString()));
         });
-
     }
 
-
-
     /**
      * Initialises the information table view to listen to a given race.
-     * @param race Race to listen to.
      */
-    public void initialiseInfoTable(VisualiserRaceEvent race) {
-
-        //Copy list of boats.
-        ObservableList<VisualiserBoat> boats = FXCollections.observableArrayList(race.getVisualiserRaceState().getBoats());
+    private void initialiseInfoTable() {
+        // list of boats to display data for
+        ObservableList<VisualiserBoat> boats = FXCollections
+                .observableArrayList(this.visualiserRace.getVisualiserRaceState().getBoats());
         SortedList<VisualiserBoat> sortedBoats = new SortedList<>(boats);
         sortedBoats.comparatorProperty().bind(boatInfoTable.comparatorProperty());
 
-        //Update copy when original changes.
-        race.getVisualiserRaceState().getBoats().addListener((ListChangeListener.Change<? extends VisualiserBoat> c) -> Platform.runLater(() -> {
-            boats.setAll(race.getVisualiserRaceState().getBoats());
+        // update list when boat information changes
+        this.visualiserRace.getVisualiserRaceState().getBoats().addListener(
+                (ListChangeListener.Change<? extends VisualiserBoat> c) -> Platform.runLater(() -> {
+            boats.setAll(this.visualiserRace.getVisualiserRaceState().getBoats());
         }));
 
-
-        //Set up table.
+        // set table data
         boatInfoTable.setItems(sortedBoats);
-
-
-        //Set up each column.
-
-        //Name.
         boatTeamColumn.setCellValueFactory(
                 cellData -> cellData.getValue().nameProperty());
-
-        //Speed.
         boatSpeedColumn.setCellValueFactory(
                 cellData -> cellData.getValue().currentSpeedProperty());
+        boatMarkColumn.setCellValueFactory(
+                cellData -> cellData.getValue().legProperty());
+        boatPlacingColumn.setCellValueFactory(
+                cellData -> cellData.getValue().placingProperty());
 
         //Kind of ugly, but allows for formatting an observed speed.
         boatSpeedColumn.setCellFactory(
-                //Callback object.
                 new Callback<TableColumn<VisualiserBoat, Number>, TableCell<VisualiserBoat, Number>>() {
-
-                    //Callback function.
                     @Override
                     public TableCell<VisualiserBoat, Number> call(TableColumn<VisualiserBoat, Number> param) {
                         //We return a table cell that populates itself with a Number, and formats it.
@@ -551,30 +556,18 @@ public class RaceController extends Controller {
                             //Function to update the cell text.
                             @Override
                             protected void updateItem(Number item, boolean empty) {
-
                                 if (item != null) {
                                     super.updateItem(item, empty);
-
                                     setText(String.format("%.2fkn", item.doubleValue()));
                                 }
                             }
                         };
-
                     }
-
                 });
 
-
-        //Last mark.
-        boatMarkColumn.setCellValueFactory(
-                cellData -> cellData.getValue().legProperty()   );
-
         //Kind of ugly, but allows for turning an observed Leg into a string.
         boatMarkColumn.setCellFactory(
-                //Callback object.
                 new Callback<TableColumn<VisualiserBoat, Leg>, TableCell<VisualiserBoat, Leg>>() {
-
-                    //Callback function.
                     @Override
                     public TableCell<VisualiserBoat, Leg> call(TableColumn<VisualiserBoat, Leg> param) {
                         //We return a table cell that populates itself with a Leg's name.
@@ -583,105 +576,37 @@ public class RaceController extends Controller {
                             //Function to update the cell text.
                             @Override
                             protected void updateItem(Leg item, boolean empty) {
-
                                 if (item != null) {
                                     super.updateItem(item, empty);
-
                                     setText(item.getName());
                                 }
                             }
                         };
-
                     }
-
                 });
-
-        //Current place within race.
-        boatPlacingColumn.setCellValueFactory(
-                cellData -> cellData.getValue().placingProperty()  );
-
-    }
-
-    /**
-     * Initialises the race time zone label with the race's time zone.
-     * @param race The race to get time zone from.
-     */
-    private void initialiseRaceTimezoneLabel(VisualiserRaceEvent race) {
-        timeZone.setText(race.getVisualiserRaceState().getRaceClock().getTimeZone());
     }
 
     /**
      * Initialises the race clock to listen to the specified race.
-     * @param race The race to listen to.
      */
-    private void initialiseRaceClock(VisualiserRaceEvent race) {
-
-        //RaceClock.duration isn't necessarily being changed in the javaFX thread, so we need to runlater the update.
-        race.getVisualiserRaceState().getRaceClock().durationProperty().addListener((observable, oldValue, newValue) -> {
+    private void initialiseRaceClock() {
+        raceState.getRaceClock().durationProperty().addListener((observable,
+                oldValue, newValue) -> {
             Platform.runLater(() -> {
                 timer.setText(newValue);
             });
         });
     }
 
-
-
-    /**
-     * Displays a specified race.
-     * @param visualiserRace Object modelling the race.
-     * @param controllerClient Socket Client that manipulates the controller.
-     * @param isHost is user a host
-     */
-    public void startRace(VisualiserRaceEvent visualiserRace, ControllerClient controllerClient, Boolean isHost) {
-
-        this.visualiserRace = visualiserRace;
-        this.controllerClient = controllerClient;
-        this.isHost = isHost;
-
-
-        //Check if the game is a tutorial
-        if (parent.getGameType()==4){
-            isTutorial = true;
-            tutorialText.setVisible(true);
-            tutorialStates = new ArrayList<>(Arrays.asList(TutorialState.values()));
-
-            currentState = tutorialStates.get(0);
-            tutorialStates.remove(0);
-
-            searchMapForKey("Upwind");
-
-            tutorialText.setText("Welcome to the tutorial! Exit at anytime with ESC. \nWe will first learn how to turn upwind. Press " + keyToPress + " to turn upwind.");
-
-        } else {
-            isTutorial = false;
-            tutorialText.setVisible(false);
-        }
-
-        initialiseRace();
-
-        //Display this controller.
-        racePane.setVisible(true);
-    }
-
     /**
      * Transition from the race view to the finish view.
-     * @param boats boats there are in the race.
-     */
-    public void finishRace(ObservableList<VisualiserBoat> boats) {
-        racePane.setVisible(false);
-        parent.enterFinish(boats);
-    }
-
-
-    /**
-     * Initialises the arrow controller with data from the race to observe.
-     * @param race The race to observe.
      */
-    private void initialiseArrow(VisualiserRaceEvent race) {
-        arrowController.setWindProperty(race.getVisualiserRaceState().windProperty());
+    private void finishRace() throws IOException {
+        RaceFinishController fc =
+                (RaceFinishController)loadScene("raceFinish.fxml");
+        fc.loadFinish(raceState.getBoats());
     }
 
-
     /**
      * Timer which monitors the race.
      */
@@ -689,40 +614,28 @@ public class RaceController extends Controller {
         new AnimationTimer() {
             @Override
             public void handle(long arg0) {
-
-                //Get the current race status.
-                RaceStatusEnum raceStatus = visualiserRace.getVisualiserRaceState().getRaceStatusEnum();
-
-
                 //If the race has finished, go to finish view.
-                if (raceStatus == RaceStatusEnum.FINISHED) {
-                    //Stop this timer.
-                    stop();
-
-                    //Hide this, and display the finish controller.
-                    finishRace(visualiserRace.getVisualiserRaceState().getBoats());
-
+                if (raceState.getRaceStatusEnum() == RaceStatusEnum.FINISHED) {
+                    stop(); // stop the timer
+                    try {
+                        finishRace();
+                    } catch (IOException e) {
+                        e.printStackTrace();
+                    }
                 } else {
-                    //Sort the tableview. Doesn't automatically work for all columns.
                     boatInfoTable.sort();
                 }
 
                 //Return to main screen if we lose connection.
                 if (!visualiserRace.getServerConnection().isAlive()) {
-                    racePane.setVisible(false);
-                    //parent.enterTitle();
                     try {
-                        App.app.showMainStage(App.getStage());
-                    } catch (IOException e) {
-                        e.printStackTrace();
+                        loadTitleScreen();
                     } catch (Exception e) {
                         e.printStackTrace();
                     }
-                    //TODO currently this doesn't work correctly - the title screen remains visible after clicking join game
                     //TODO we should display an error to the user
                     //TODO also need to "reset" any state (race, connections, etc...).
                 }
-
             }
         }.start();
     }
@@ -731,24 +644,22 @@ public class RaceController extends Controller {
      * toggles if the info table is shown
      */
     private void toggleTable() {
-        double tablePercent = 1 - (boatPlacingColumn.getPrefWidth() + boatTeamColumn.getPrefWidth() + boatMarkColumn.getPrefWidth() + boatSpeedColumn.getPrefWidth())/racePane.getWidth();
+        double tablePercent = 1 - (boatPlacingColumn.getPrefWidth() +
+                boatTeamColumn.getPrefWidth() + boatMarkColumn.getPrefWidth()
+                + boatSpeedColumn.getPrefWidth())/racePane.getWidth();
 
         if (infoTableShow) {
             racePane.setDividerPositions(tablePercent);
-
             arrowPane.setScaleX(0.5);
             arrowPane.setScaleY(0.5);
             arrowPane.setTranslateX(0 + (arrowPane.getScene().getWidth()/4)*tablePercent);
             arrowPane.setTranslateY(0 - arrowPane.getScene().getHeight()/4);
-
         } else {
             racePane.setDividerPositions(1);
-
             arrowPane.setScaleX(1);
             arrowPane.setScaleY(1);
             arrowPane.setTranslateX(0);
             arrowPane.setTranslateY(0);
-
         }
         boatInfoTable.refresh();
         infoTableShow = !infoTableShow;
@@ -831,7 +742,7 @@ public class RaceController extends Controller {
                 //Set next key to press as the zoom-out key
                 searchMapForKey("Zoom Out");
                 //Update tutorial text
-                tutorialText.setText("Nice! You will also be able to zoom into boats and marks by clicking them. To zoom out press " + keyToPress + ".");
+                tutorialText.setText("Nice! You will also be able to zoom into boats and marks by clicking them. \nTo zoom out press " + keyToPress + ".");
                 updateTutorialState();
                 break;
             case ZOOMOUT:
@@ -843,19 +754,16 @@ public class RaceController extends Controller {
                 alert.setContentText("Now you know the controls you are ready to race!");
                 Optional<ButtonType> result = alert.showAndWait();
                 if (result.get() == ButtonType.OK) {
-                    parent.endEvent();
-                    racePane.setVisible(false);
-                    App.app.showMainStage(App.getStage());
+                    App.game.endEvent();
+                    loadTitleScreen();
                 }
                 break;
             default:
                 //State not found. Exit tutorial to title menu
-                parent.endEvent();
-                racePane.setVisible(false);
-                App.app.showMainStage(App.getStage());
+                App.game.endEvent();
+                loadTitleScreen();
                 break;
         }
-
     }
 
 }

racevisionGame/src/main/java/visualiser/Controllers/StartController.java

@@ -1,271 +0,0 @@
-package visualiser.Controllers;
-
-import javafx.animation.AnimationTimer;
-import javafx.application.Platform;
-import javafx.collections.ObservableList;
-import javafx.fxml.FXML;
-import javafx.scene.control.Label;
-import javafx.scene.control.TableColumn;
-import javafx.scene.control.TableView;
-import javafx.scene.layout.AnchorPane;
-import javafx.scene.layout.GridPane;
-import mock.model.commandFactory.CompositeCommand;
-import network.Messages.Enums.RaceStatusEnum;
-import network.Messages.Enums.RequestToJoinEnum;
-import network.Messages.LatestMessages;
-import shared.dataInput.*;
-import shared.enums.XMLFileType;
-import shared.exceptions.InvalidBoatDataException;
-import shared.exceptions.InvalidRaceDataException;
-import shared.exceptions.InvalidRegattaDataException;
-import shared.exceptions.XMLReaderException;
-import visualiser.gameController.ControllerClient;
-import visualiser.model.VisualiserRaceState;
-import visualiser.network.ServerConnection;
-import visualiser.model.VisualiserBoat;
-import visualiser.model.VisualiserRaceEvent;
-
-import java.io.IOException;
-import java.net.Socket;
-import java.net.URL;
-import java.util.*;
-import java.util.logging.Level;
-import java.util.logging.Logger;
-
-
-/**
- * Controller to for waiting for the race to start.
- */
-public class StartController extends Controller {
-
-    @FXML private GridPane start;
-    @FXML private AnchorPane startWrapper;
-
-    /**
-     * The name of the race/regatta.
-     */
-    @FXML private Label raceTitleLabel;
-
-    /**
-     * The time the race starts at.
-     */
-    @FXML private Label raceStartLabel;
-
-    /**
-     * The current time at the race location.
-     */
-    @FXML private Label timeZoneTime;
-
-    /**
-     * Time until the race starts.
-     */
-    @FXML private Label timer;
-
-    @FXML private TableView<VisualiserBoat> boatNameTable;
-    @FXML private TableColumn<VisualiserBoat, String> boatNameColumn;
-    @FXML private TableColumn<VisualiserBoat, String> boatCodeColumn;
-
-    /**
-     * The status of the race.
-     */
-    @FXML private Label raceStatusLabel;
-
-
-    /**
-     * The race + connection to server.
-     */
-    private VisualiserRaceEvent visualiserRaceEvent;
-
-
-    /**
-     * Writes BoatActions to outgoing message queue.
-     */
-    private ControllerClient controllerClient;
-
-    private boolean isHost;
-
-
-
-    /**
-     * Ctor.
-     */
-    public StartController() {
-    }
-
-    @Override
-    public void initialize(URL location, ResourceBundle resources) {
-    }
-
-
-    /**
-     * Starts the race.
-     */
-    private void startRace() {
-
-        //Initialise the boat table.
-        initialiseBoatTable(this.visualiserRaceEvent.getVisualiserRaceState());
-
-        //Initialise the race name.
-        initialiseRaceName(this.visualiserRaceEvent.getVisualiserRaceState());
-
-        //Initialises the race clock.
-        initialiseRaceClock(this.visualiserRaceEvent.getVisualiserRaceState());
-
-        //Starts the race countdown timer.
-        countdownTimer();
-    }
-
-
-
-
-    public AnchorPane startWrapper(){
-        return startWrapper;
-    }
-
-
-    /**
-     * Initialises the boat table that is to be shown on the pane.
-     * @param visualiserRace The race to get data from.
-     */
-    private void initialiseBoatTable(VisualiserRaceState visualiserRace) {
-
-        //Get the boats.
-        ObservableList<VisualiserBoat> boats = visualiserRace.getBoats();
-
-        //Populate table.
-        boatNameTable.setItems(boats);
-        boatNameColumn.setCellValueFactory(cellData -> cellData.getValue().nameProperty());
-        boatCodeColumn.setCellValueFactory(cellData -> cellData.getValue().countryProperty());
-    }
-
-    /**
-     * Initialises the race name which is shown on the pane.
-     * @param visualiserRace The race to get data from.
-     */
-    private void initialiseRaceName(VisualiserRaceState visualiserRace) {
-
-        raceTitleLabel.setText(visualiserRace.getRegattaName());
-
-    }
-
-    /**
-     * Initialises the race clock/timer labels for the start time, current time, and remaining time.
-     * @param visualiserRace The race to get data from.
-     */
-    private void initialiseRaceClock(VisualiserRaceState visualiserRace) {
-
-        //Start time.
-        initialiseRaceClockStartTime(visualiserRace);
-
-        //Current time.
-        initialiseRaceClockCurrentTime(visualiserRace);
-
-        //Remaining time.
-        initialiseRaceClockDuration(visualiserRace);
-
-    }
-
-
-    /**
-     * Initialises the race current time label.
-     * @param visualiserRace The race to get data from.
-     */
-    private void initialiseRaceClockStartTime(VisualiserRaceState visualiserRace) {
-
-        raceStartLabel.setText(visualiserRace.getRaceClock().getStartingTimeString());
-
-        visualiserRace.getRaceClock().startingTimeProperty().addListener((observable, oldValue, newValue) -> {
-            Platform.runLater(() -> {
-                raceStartLabel.setText(newValue);
-            });
-        });
-
-    }
-
-
-    /**
-     * Initialises the race current time label.
-     * @param visualiserRace The race to get data from.
-     */
-    private void initialiseRaceClockCurrentTime(VisualiserRaceState visualiserRace) {
-
-        visualiserRace.getRaceClock().currentTimeProperty().addListener((observable, oldValue, newValue) -> {
-            Platform.runLater(() -> {
-                timeZoneTime.setText(newValue);
-            });
-        });
-
-    }
-
-    /**
-     * Initialises the race duration label.
-     * @param visualiserRace The race to get data from.
-     */
-    private void initialiseRaceClockDuration(VisualiserRaceState visualiserRace) {
-
-        visualiserRace.getRaceClock().durationProperty().addListener((observable, oldValue, newValue) -> {
-            Platform.runLater(() -> {
-                timer.setText(newValue);
-            });
-        });
-
-    }
-
-    /**
-     * Countdown timer until race starts.
-     */
-    private void countdownTimer() {
-            new AnimationTimer() {
-                @Override
-                public void handle(long arg0) {
-
-                    //Get the current race status.
-                    RaceStatusEnum raceStatus = visualiserRaceEvent.getVisualiserRaceState().getRaceStatusEnum();
-
-                    //If the race has reached the preparatory phase, or has started...
-                    if (raceStatus == RaceStatusEnum.WARNING
-                            || raceStatus == RaceStatusEnum.PREPARATORY
-                            || raceStatus == RaceStatusEnum.STARTED) {
-                        //Stop this timer.
-                        stop();
-
-                        //Hide this, and display the race controller.
-                        startWrapper.setVisible(false);
-                        //start.setVisible(false);//TODO is this needed?
-
-                        parent.beginRace(visualiserRaceEvent, controllerClient, isHost);
-
-                    }
-                }
-            }.start();
-
-    }
-
-
-
-    /**
-     * Show starting information for a race given a socket.
-     * @param socket network source of information
-     * @param isHost is user a host
-     */
-    public void enterLobby(Socket socket, Boolean isHost) {
-        try {
-
-            this.isHost = isHost;
-
-            this.visualiserRaceEvent = new VisualiserRaceEvent(socket, RequestToJoinEnum.PARTICIPANT);
-
-            this.controllerClient = visualiserRaceEvent.getControllerClient();
-
-
-            startWrapper.setVisible(true);
-
-            startRace();
-
-        } catch (IOException e) {
-            //TODO should probably let this propagate, so that we only enter this scene if everything works
-            Logger.getGlobal().log(Level.WARNING, "Could not connect to server.", e);
-        }
-    }
-
-}

racevisionGame/src/main/java/visualiser/Controllers/TitleController.java

@@ -1,25 +1,16 @@
 package visualiser.Controllers;
 
-import javafx.event.EventHandler;
 import javafx.fxml.FXML;
-import javafx.fxml.FXMLLoader;
-import javafx.scene.Parent;
-import javafx.scene.Scene;
-import javafx.scene.control.Button;
 import javafx.scene.control.Label;
 import javafx.scene.control.RadioButton;
 import javafx.scene.image.Image;
 import javafx.scene.image.ImageView;
-import javafx.scene.layout.AnchorPane;
 import javafx.scene.layout.Pane;
 import javafx.scene.media.AudioClip;
 import javafx.scene.media.Media;
 import javafx.scene.media.MediaPlayer;
 import javafx.stage.Modality;
-import javafx.stage.Stage;
-import mock.app.Event;
 import mock.exceptions.EventConstructionException;
-import javafx.stage.WindowEvent;
 import visualiser.app.App;
 
 import java.io.File;
@@ -37,21 +28,11 @@ import java.util.logging.Logger;
  * the game.
  */
 public class TitleController extends Controller {
-    //FXML stuff
-    @FXML
-    Button btnJoin;
-    @FXML
-    AnchorPane titleWrapper;
-    @FXML
-    RadioButton dayModeRD;
-    @FXML
-    RadioButton nightModeRD;
-    @FXML
-    Label tutorialLabel;
-    @FXML
-    Pane menuPane;
-    @FXML
-    ImageView imgSun;
+    private @FXML RadioButton dayModeRD;
+    private @FXML RadioButton nightModeRD;
+    private @FXML Label tutorialLabel;
+    private @FXML Pane menuPane;
+    private @FXML ImageView imgSun;
 
     /**
      * Method called when the 'host a game' button is pressed.
@@ -59,28 +40,17 @@ public class TitleController extends Controller {
      * Currently used to run the RaceVision mock.
      * @throws IOException if main has problems
      */
-    public void hostAGame() throws IOException, URISyntaxException {
-        titleWrapper.setVisible(false);
-        parent.setGameType(0);
-        parent.hostGame();
-        App.getStage().setResizable(true);
-    }
-
-    /**
-     * Switch the scene to the title page.
-     */
-    public void enterTitle(){
-        titleWrapper.setVisible(true);
+    public void hostAGame() throws IOException {
+        loadScene("hostGame.fxml");
     }
 
     /**
      * To be implemented at a later date- will open the next scene displaying
      * games a player can join. Place holder method for now!
+     * @throws IOException socket error
      */
-    public void joinAGame() {
-        titleWrapper.setVisible(false);
-        parent.enterLobby();
-        App.getStage().setResizable(true);
+    public void joinAGame() throws IOException {
+        loadScene("lobby.fxml");
     }
 
     /**
@@ -93,6 +63,7 @@ public class TitleController extends Controller {
         dayModeRD.getScene().getStylesheets().add("/css/dayMode.css");
         menuPane.setStyle("-fx-background-color:  #6be6ff;");
         nightModeRD.setSelected(false);
+        App.dayMode = true;
     }
 
     /**
@@ -105,51 +76,27 @@ public class TitleController extends Controller {
         nightModeRD.getScene().getStylesheets().add("/css/nightMode.css");
         menuPane.setStyle("-fx-background-color: #1f2c60;");
         dayModeRD.setSelected(false);
-    }
-
-    @Override
-    public void initialize(URL location, ResourceBundle resources) {
-        tutorialLabel.setWrapText(true);
-
+        App.dayMode = false;
     }
 
     /**
      * Called when control button is pressed. New pop up window displaying controls
      */
-    public void controlBtnPressed(){
+    public void showControls(){
         try {
-            AudioClip sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
-            sound.play();
-            FXMLLoader loader = new FXMLLoader();
-            loader.setLocation(getClass().getResource("/visualiser/scenes/keyBindings.fxml"));
-            Parent layout = loader.load();
-            Scene scene = new Scene(layout);
-            Stage popupStage = new Stage();
-            popupStage.setResizable(false);
-            popupStage.setTitle("Game Controls");
-            popupStage.initModality(Modality.WINDOW_MODAL);
-            popupStage.centerOnScreen();
-            popupStage.setScene(scene);
-            popupStage.show();
-            KeyBindingsController controller = loader.getController();
-            popupStage.setOnCloseRequest(new EventHandler<WindowEvent>() {
-                public void handle(WindowEvent we) {
-                    if (we.getEventType() == WindowEvent.WINDOW_CLOSE_REQUEST) {
-                        controller.onExit(we);
-                    }
-                }
-            });
-        } catch (Exception  e){
+            loadPopupScene("keyBindings.fxml",
+                    "Game Controls", Modality.WINDOW_MODAL);
+        } catch (IOException e) {
             e.printStackTrace();
         }
     }
 
-
-    public void tutorialStartPressed() throws IOException {
-        titleWrapper.setVisible(false);
-        parent.setGameType(4);
-        parent.beginGame();
-
+    public void tutorialStartPressed() throws IOException,
+            EventConstructionException {
+        App.gameType = 4;
+        HostGameController hgc = new HostGameController();
+        hgc.setCurrentMapIndex(4);
+        hgc.hostGamePressed();
     }
 
 }

racevisionGame/src/main/java/visualiser/app/App.java

@@ -3,19 +3,16 @@ package visualiser.app;
 import javafx.animation.FadeTransition;
 import javafx.application.Application;
 import javafx.application.Platform;
-import javafx.beans.property.ReadOnlyObjectProperty;
 import javafx.collections.FXCollections;
 import javafx.collections.ObservableList;
 import javafx.concurrent.Task;
 import javafx.concurrent.Worker;
-import javafx.event.EventHandler;
 import javafx.fxml.FXMLLoader;
 import javafx.geometry.Pos;
 import javafx.geometry.Rectangle2D;
 import javafx.scene.Parent;
 import javafx.scene.Scene;
 import javafx.scene.control.Label;
-import javafx.scene.control.ListView;
 import javafx.scene.control.ProgressBar;
 import javafx.scene.effect.DropShadow;
 import javafx.scene.image.Image;
@@ -26,25 +23,22 @@ import javafx.scene.paint.Color;
 import javafx.stage.Screen;
 import javafx.stage.Stage;
 import javafx.stage.StageStyle;
-import javafx.stage.WindowEvent;
 import javafx.util.Duration;
-import visualiser.Controllers.MainController;
-import visualiser.gameController.Keys.KeyFactory;
+import mock.app.Event;
 
 public class App extends Application {
-
     private static Stage stage;
+    public static Event game;
+    public static Boolean dayMode = true;
+    public static Integer gameType = 0;
     private Pane splashLayout;
     private ProgressBar loadProgress;
     private Label progressText;
     private static final int SPLASH_WIDTH = 676;
     private static final int SPLASH_HEIGHT = 227;
-    public static KeyFactory keyFactory = new KeyFactory();
-    public static App app;
 
     /**
      * Entry point for running the programme
-     *
      * @param args for starting the programme
      */
     public static void main(String[] args) {
@@ -53,9 +47,6 @@ public class App extends Application {
 
     @Override
     public void init() {
-        // load the user's personalised key bindings
-        keyFactory.load();
-
         ImageView splash = new ImageView(new Image(
                 getClass().getClassLoader().getResourceAsStream("images/splashScreen.png")
         ));
@@ -81,15 +72,15 @@ public class App extends Application {
 
     /**
      * Method that sets up and displays the splash screen
-     * @param initStage the inital stage
+     * @param stage the initial stage
      * @throws Exception if something wrong with title screen.
      */
-    public void start(Stage initStage) throws Exception {
+    public void start(Stage stage) throws Exception {
         final Task<ObservableList<String>> boatTask = new Task<ObservableList<String>>() {
             @Override
             protected ObservableList<String> call() throws InterruptedException {
                 ObservableList<String> addedFilling =
-                        FXCollections.<String>observableArrayList();
+                        FXCollections.observableArrayList();
                 ObservableList<String> burgerFilling =
                         FXCollections.observableArrayList(
                                 "Buns", "Patties", "Lettuce", "Onions", "Tomato",
@@ -107,69 +98,49 @@ public class App extends Application {
                 }
                 Thread.sleep(100);
                 updateMessage("Burger's done!");
-
                 return addedFilling;
             }
         };
-
         showSplash(
-                initStage,
+                stage,
                 boatTask,
                 () -> {
                     try {
-                        showMainStage(new Stage());
+                        loadTitleScreen();
                     } catch (Exception e) {
                         e.printStackTrace();
                     }
                 }
         );
         new Thread(boatTask).start();
-
     }
 
     /**
-     * Get main stage
-     * @return main stage
+     * Get the main stage to be shared for all regular game play scenes.
+     * @return shared stage
      */
     public static Stage getStage() {
         return App.stage;
     }
 
     /**
-     * Set main stage
-     * @param stage stage to set main stage
-     */
-    public static void setStage(Stage stage) {
-        App.stage = stage;
-    }
-
-    /**
-     * Show the main stage after the splash screen
-     * @param stage main stage for application
-     * @throws Exception Throws an exception on error
+     * Loads the title screen for the first time on app start.
+     * @throws Exception if there is a problem with a resource loaded
      */
-    public void showMainStage(Stage stage) throws Exception {
-        App.stage = stage;
-        App.app = this;
-        FXMLLoader loader = new FXMLLoader(getClass().getResource("/visualiser/scenes/main.fxml"));
+    private void loadTitleScreen() throws Exception {
+        stage = new Stage();
+        FXMLLoader loader = new FXMLLoader(getClass().getResource
+                ("/visualiser/scenes/title.fxml"));
         Parent root = loader.load();
         stage.setResizable(false);
-        MainController mc = (MainController) loader.getController();
-        mc.enterTitle();
         Scene scene = new Scene(root);
-
-        stage.setScene(scene);
-        stage.setTitle("RaceVision - Team 7");
+        stage.setTitle("The Boat Game - Burgers & Boats");
         stage.getIcons().add(new Image(getClass().getClassLoader().getResourceAsStream("images/SailIcon.png")));
-        mc.startCss();
-        setStage(stage);
+        stage.setScene(scene);
         stage.show();
-        stage.setOnCloseRequest(new EventHandler<WindowEvent>() {
-            @Override
-            public void handle(WindowEvent event) {
+        stage.setOnCloseRequest(event -> {
             Platform.exit();
             System.exit(0);
-            }
         });
     }
 

racevisionGame/src/main/java/visualiser/app/MatchBrowserSingleton.java

@@ -0,0 +1,37 @@
+package visualiser.app;
+
+import visualiser.network.MatchBrowserInterface;
+
+import java.io.IOException;
+import java.net.DatagramSocket;
+
+public class MatchBrowserSingleton {
+    private DatagramSocket udpSocket;
+    private MatchBrowserInterface matchBrowserInterface;
+
+    private static MatchBrowserSingleton instance = null;
+
+    public MatchBrowserSingleton() {
+        this.matchBrowserInterface = new MatchBrowserInterface();
+        try{
+            this.udpSocket = matchBrowserInterface.setupMatchBrowserConnection();
+        }catch (IOException e){
+            System.err.println("Error in setting up connection with match browser");
+        }
+    }
+
+    public static MatchBrowserSingleton getInstance() {
+        if (instance == null){
+            instance = new MatchBrowserSingleton();
+        }
+        return instance;
+    }
+
+    public DatagramSocket getUdpSocket() {
+        return udpSocket;
+    }
+
+    public MatchBrowserInterface getMatchBrowserInterface() {
+        return matchBrowserInterface;
+    }
+}

racevisionGame/src/main/java/visualiser/enums/TutorialState.java

@@ -1,12 +1,6 @@
 package visualiser.enums;
 
-import javafx.scene.input.KeyCode;
-import network.Messages.BoatAction;
 import network.Messages.Enums.BoatActionEnum;
-import visualiser.gameController.Keys.ControlKey;
-import static visualiser.app.App.keyFactory;
-
-import java.util.ArrayList;
 
 /**
  * State of which stage the tutorial is currently in

racevisionGame/src/main/java/visualiser/gameController/InputChecker.java

@@ -3,15 +3,14 @@ package visualiser.gameController;
 import javafx.animation.AnimationTimer;
 import javafx.scene.Scene;
 import visualiser.gameController.Keys.ControlKey;
-
+import visualiser.gameController.Keys.KeyFactory;
 import java.util.HashMap;
 
-import static visualiser.app.App.keyFactory;
-
 /**
  * Class for checking what keys are currently being used
  */
 public class InputChecker {
+    private KeyFactory keyFactory;
     private HashMap<String, Boolean> currentlyActiveKeys = new HashMap<>();
 
     /**
@@ -19,7 +18,8 @@ public class InputChecker {
      * @param scene Scene the controller is to run in parallel with.
      */
     public void runWithScene(Scene scene){
-//        KeyFactory keyFactory = KeyFactory.getFactory();
+        KeyFactory keyFactory = new KeyFactory();
+        keyFactory.load();
 
         scene.setOnKeyPressed(event -> {
             String codeString = event.getCode().toString();
@@ -27,7 +27,6 @@ public class InputChecker {
                 ControlKey controlKey = keyFactory.getKey(codeString);
                 if (controlKey != null) {
                     controlKey.onAction();
-//                    System.out.println(controlKey.toString() + " is Pressed.");
                 }
                 currentlyActiveKeys.put(codeString, true);
             }
@@ -38,7 +37,6 @@ public class InputChecker {
             ControlKey controlKey = keyFactory.getKey(codeString);
             if (controlKey != null) {
                 controlKey.onRelease();
-//                System.out.println(controlKey.toString() + " is Released.");
             }
             currentlyActiveKeys.remove(event.getCode().toString());
         });
@@ -50,15 +48,8 @@ public class InputChecker {
                     ControlKey controlKey = keyFactory.getKey(key);
                     if (controlKey != null){
                         controlKey.onHold();
-//                        System.out.println(controlKey.toString() + " is Held.");
                     }
                 }
-//                for (String key : InputKeys.stringKeysMap.keySet()){
-//                    if (removeActiveKey(key)) {
-//                        System.out.println(key);
-//                    }
-//                }
-
             }
         }.start();
     }

racevisionGame/src/main/java/visualiser/layout/Boundary3D.java

@@ -62,12 +62,12 @@ public class Boundary3D {
         double c = Math.sqrt(a * a + b * b);
 
 
-        Subject3D bound1 = new Subject3D(new Sphere(thickness * 2),0);
+        Subject3D bound1 = new Annotation3D(new Sphere(thickness * 2));
         bound1.setX(graphCoord1.getX());
         bound1.setZ(graphCoord1.getY());
         boundaryNodes.add(bound1);
 
-        Subject3D connector = new Subject3D(new Box(c, thickness, thickness),0);
+        Subject3D connector = new Annotation3D(new Box(c, thickness, thickness));
         connector.setX(avgCoord.getX());
         connector.setZ(avgCoord.getY());
         double angle = 90 + Math.toDegrees(GPSConverter.getAngle(graphCoord2, graphCoord1));

racevisionGame/src/main/java/visualiser/layout/Plane3D.java

@@ -8,6 +8,9 @@ import javafx.scene.shape.*;
 
 import java.util.ArrayList;
 import java.util.Arrays;
+import javafx.scene.shape.TriangleMesh;
+
+import java.util.ArrayList;
 import java.util.List;
 
 /**

racevisionGame/src/main/java/visualiser/layout/SeaSurface.java

@@ -18,8 +18,10 @@ import visualiser.utils.PerlinNoiseGenerator;
  */
 public class SeaSurface extends Subject3D {
     private static Image image;
+
     /**
      * Sea Surface Constructor
+     *
      * @param size size of the sea surface (has to be square for simplicity's sake)
      * @param freq frequency the perlin noise is to be generated at
      */
@@ -51,6 +53,7 @@ public class SeaSurface extends Subject3D {
 
     /**
      * Create texture for uv mapping
+     *
      * @param size  size of the image to make
      * @param noise array of noise
      * @return image that is created
@@ -90,6 +93,7 @@ public class SeaSurface extends Subject3D {
 
     /**
      * Nomalises the values so that the colours are correct
+     *
      * @param value  value to normalise
      * @param min    current min
      * @param max    current max
@@ -105,6 +109,7 @@ public class SeaSurface extends Subject3D {
 
     /**
      * clamps a value between a min and max
+     *
      * @param value value to clamp
      * @param min   minimum value it can be
      * @param max   maximum value it can be
@@ -123,8 +128,10 @@ public class SeaSurface extends Subject3D {
 
     /**
      * Prevent rescaling of sea surface
+     *
      * @param scale ignored
      */
     @Override
-    public void setScale(double scale) {}
+    public void setScale(double scale) {
+    }
 }

racevisionGame/src/main/java/visualiser/layout/Shockwave.java

@@ -0,0 +1,17 @@
+package visualiser.layout;
+
+import javafx.scene.paint.Color;
+import javafx.scene.paint.PhongMaterial;
+import javafx.scene.shape.Cylinder;
+import javafx.scene.transform.Rotate;
+
+/**
+ * Created by cbt24 on 14/09/17.
+ */
+public class Shockwave extends Subject3D {
+    public Shockwave(double radius) {
+        super(new Cylinder(radius,0),0);
+        getMesh().getTransforms().add(new Rotate(-90, Rotate.X_AXIS));
+        getMesh().setMaterial(new PhongMaterial(new Color(0,0,0,0)));
+    }
+}

racevisionGame/src/main/java/visualiser/layout/View3D.java

@@ -1,5 +1,6 @@
 package visualiser.layout;
 
+import javafx.animation.AnimationTimer;
 import javafx.beans.property.ObjectProperty;
 import javafx.beans.property.SimpleObjectProperty;
 import javafx.beans.value.ChangeListener;
@@ -71,21 +72,9 @@ public class View3D extends Pane {
      */
     private Rotate pitch;
     /**
-     * Single listener for subject heading changes
+     * Animation loop for camera tracking
      */
-    private ChangeListener<? super Number> pivotHeading = (o, prev, curr) -> yaw.setAngle((double)curr);
-    /**
-     * Single listener for subject position (x) changes
-     */
-    private ChangeListener<? super Number> pivotX = (o, prev, curr) -> pivot.setX((double)curr);
-    /**
-     * Single listener for subject position (y) changes
-     */
-    private ChangeListener<? super Number> pivotY = (o, prev, curr) -> pivot.setY((double)curr);
-    /**
-     * Single listener for subject position (z) changes
-     */
-    private ChangeListener<? super Number> pivotZ = (o, prev, curr) -> pivot.setZ((double)curr);
+    private AnimationTimer trackBoat;
     /**
      * Distance to switch from third person to bird's eye
      */
@@ -219,10 +208,7 @@ public class View3D extends Pane {
      */
     private void untrackSubject() {
         if(target.get() != null) {
-            target.get().getPosition().xProperty().removeListener(pivotX);
-            target.get().getPosition().yProperty().removeListener(pivotY);
-            target.get().getPosition().zProperty().removeListener(pivotZ);
-            target.get().getHeading().angleProperty().removeListener(pivotHeading);
+            trackBoat.stop();
             target.setValue(null);
         }
     }
@@ -234,13 +220,14 @@ public class View3D extends Pane {
     private void trackSubject(Subject3D subject) {
         target.set(subject);
 
+        this.trackBoat = new AnimationTimer() {
+            @Override
+            public void handle(long now) {
                 updatePivot(target.get().getPosition());
                 setYaw(target.get().getHeading().getAngle());
-
-        target.get().getPosition().xProperty().addListener(pivotX);
-        target.get().getPosition().yProperty().addListener(pivotY);
-        target.get().getPosition().zProperty().addListener(pivotZ);
-        target.get().getHeading().angleProperty().addListener(pivotHeading);
+            }
+        };
+        trackBoat.start();
     }
 
     public void setNearClip(double nearClip) {

racevisionGame/src/main/java/visualiser/model/Annotations.java

@@ -15,7 +15,7 @@ import java.util.Map;
  * Class that processes user selected annotation visibility options to
  * display the requested information on the
  * {@link ResizableRaceCanvas}. These are displayed
- * via the {@link visualiser.Controllers.RaceController}. <br>
+ * via the {@link visualiser.Controllers.RaceViewController}. <br>
  * Annotation options for a {@link VisualiserBoat} include: its name,
  * abbreviation, speed, the time since it passed the last
  * {@link shared.model.Mark}, estimated time to the next marker,

racevisionGame/src/main/java/visualiser/model/ResizableRaceCanvas.java

@@ -18,7 +18,7 @@ import java.util.List;
 /**
  * This JavaFX Canvas is used to update and display details for a
  * {@link RaceMap} via the
- * {@link visualiser.Controllers.RaceController}.<br>
+ * {@link visualiser.Controllers.RaceViewController}.<br>
  * It fills it's parent and cannot be downsized. <br>
  * Details displayed include:
  *  {@link VisualiserBoat}s (and their
@@ -325,18 +325,6 @@ public class ResizableRaceCanvas extends ResizableCanvas {
         }
 
 
-
-
-/*
-            //If the race hasn't started, we set the time since last mark to the current time, to ensure we don't start counting until the race actually starts.
-            if ((boat.getStatus() != BoatStatusEnum.RACING) && (boat.getStatus() == BoatStatusEnum.FINISHED)) {
-                boat.setTimeAtLastMark(visualiserRace.getVisualiserRaceState().getRaceClock().getCurrentTime());
-            }
-*/
-
-
-
-
     }
 
     /**
@@ -504,6 +492,52 @@ public class ResizableRaceCanvas extends ResizableCanvas {
     }
 
 
+    private void drawRoundingLines() {
+
+
+        //ugly hack
+        //rounding lines
+
+        //Boat is within an acceptable distance from the mark.
+        VisualiserBoat boat = null;
+        for (VisualiserBoat visualiserBoat : new ArrayList<>(raceState.getBoats())) {
+            if (visualiserBoat.isClientBoat()) {
+                boat = visualiserBoat;
+            }
+        }
+        if (boat == null) {
+            return;
+        }
+
+        Leg currentLeg = boat.getCurrentLeg();
+
+        MarkRoundingData roundingData = raceState.getMarkRoundingSequence().getRoundingData(currentLeg);
+
+
+
+        //To screen coords.
+        GraphCoordinate legEnd = map.convertGPS(roundingData.getMarkToRound().getPosition());
+        GraphCoordinate round1 = map.convertGPS(roundingData.getRoundCheck1());
+        GraphCoordinate round2 = map.convertGPS(roundingData.getRoundCheck2());
+
+
+        gc.strokeLine(
+                legEnd.getX(),
+                legEnd.getY(),
+                round1.getX(),
+                round1.getY()   );
+
+        gc.strokeLine(
+                legEnd.getX(),
+                legEnd.getY(),
+                round2.getX(),
+                round2.getY()   );
+
+        drawCircle(round1, 12, Color.ORANGE);
+        drawCircle(round2, 12, Color.GREEN);
+
+    }
+
 
     /**
      * Draws all of the {@link Mark}s on the canvas.
@@ -513,6 +547,7 @@ public class ResizableRaceCanvas extends ResizableCanvas {
         for (Mark mark : new ArrayList<>(raceState.getMarks())) {
             drawMark(mark);
         }
+
     }
 
 
@@ -621,6 +656,9 @@ public class ResizableRaceCanvas extends ResizableCanvas {
         //Marks.
         drawMarks();
 
+        //TEMP
+        drawRoundingLines();
+
     }
 
     /**
@@ -655,7 +693,7 @@ public class ResizableRaceCanvas extends ResizableCanvas {
 
         //finds the direction of the current leg as a bearing
         startDirectionLinePoint = legStartPoint;
-        GPSCoordinate tempEndDirectionLinePoint = legs.get(index).getEndCompoundMark().getAverageGPSCoordinate();
+        GPSCoordinate tempEndDirectionLinePoint = legs.get(index).getEndCompoundMark().getMark1Position();
 
         bearingOfDirectionLine = GPSCoordinate.calculateBearing(startDirectionLinePoint, tempEndDirectionLinePoint);
 

racevisionGame/src/main/java/visualiser/model/Sparkline.java

@@ -21,7 +21,7 @@ import java.util.Map;
  * placing position as they complete each {@link shared.model.Leg} by
  * passing a course {@link shared.model.Mark}. <br>
  * This sparkline is displayed using the
- * {@link visualiser.Controllers.RaceController}.
+ * {@link visualiser.Controllers.RaceViewController}.
  */
 public class Sparkline {
 

racevisionGame/src/main/java/visualiser/model/TrackPoint.java

@@ -8,8 +8,8 @@ import shared.model.GPSCoordinate;
  * {@link VisualiserBoat Boat} has travelled in a race. <br>
  * TrackPoints are displayed on a
  * {@link ResizableRaceCanvas}, via the
- * {@link visualiser.Controllers.RaceController}. <br>
- * Track points can be made visible or hidden via the RaceController's
+ * {@link visualiser.Controllers.RaceViewController}. <br>
+ * Track points can be made visible or hidden via the RaceViewController's
  * {@link Annotations}.
  */
 public class TrackPoint {

racevisionGame/src/main/java/visualiser/model/VisualiserBoat.java

@@ -1,6 +1,8 @@
 package visualiser.model;
 
+import javafx.beans.property.BooleanProperty;
 import javafx.beans.property.ObjectProperty;
+import javafx.beans.property.SimpleBooleanProperty;
 import javafx.beans.property.SimpleObjectProperty;
 import javafx.scene.paint.Color;
 import network.Messages.Enums.BoatStatusEnum;
@@ -17,7 +19,7 @@ import java.util.List;
  * This class is used to represent and store information about a boat which may
  * travel around in a race. It is displayed on the
  * {@link ResizableRaceCanvas ResizableRaceCanvas} via the
- * {@link visualiser.Controllers.RaceController RaceController}.
+ * {@link visualiser.Controllers.RaceViewController RaceViewController}.
  */
 public class VisualiserBoat extends Boat {
 
@@ -62,6 +64,7 @@ public class VisualiserBoat extends Boat {
 
     private ObjectProperty<GPSCoordinate> positionProperty;
     private ObjectProperty<Bearing> bearingProperty;
+    private BooleanProperty hasCollided;
 
 
     /**
@@ -74,6 +77,7 @@ public class VisualiserBoat extends Boat {
         super(boat.getSourceID(), boat.getName(), boat.getCountry());
 
         this.color = color;
+        this.hasCollided = new SimpleBooleanProperty(false);
     }
 
 
@@ -253,10 +257,6 @@ public class VisualiserBoat extends Boat {
         this.positionProperty.set(position);
     }
 
-    public ObjectProperty<GPSCoordinate> positionProperty() {
-        return positionProperty;
-    }
-
     @Override
     public Bearing getBearing() {
         return bearingProperty.get();
@@ -270,7 +270,15 @@ public class VisualiserBoat extends Boat {
         this.bearingProperty.set(bearing);
     }
 
-    public ObjectProperty<Bearing> bearingProperty() {
-        return bearingProperty;
+    public boolean hasCollided() {
+        return hasCollided.get();
+    }
+
+    public BooleanProperty hasCollidedProperty() {
+        return hasCollided;
+    }
+
+    public void setHasCollided(boolean hasCollided) {
+        this.hasCollided.set(hasCollided);
     }
 }

racevisionGame/src/main/java/visualiser/model/VisualiserRaceEvent.java

@@ -66,7 +66,7 @@ public class VisualiserRaceEvent {
 
 
         this.serverConnection = new ServerConnection(socket, visualiserRaceState, raceCommands, requestType);
-        this.serverConnectionThread = new Thread(serverConnection, "StartController.enterLobby()->serverConnection thread " + serverConnection);
+        this.serverConnectionThread = new Thread(serverConnection, "RaceStartController.enterLobby()->serverConnection thread " + serverConnection);
         this.serverConnectionThread.start();
 
 
@@ -112,8 +112,8 @@ public class VisualiserRaceEvent {
      * Terminates the server connection and race service.
      */
     public void terminate() {
-        this.serverConnectionThread.interrupt();
-
         this.visualiserRaceServiceThread.interrupt();
+        this.serverConnectionThread.interrupt();
+        serverConnection.terminate();
     }
 }

racevisionGame/src/main/java/visualiser/network/MatchBrowserClientRunnable.java

@@ -0,0 +1,34 @@
+package visualiser.network;
+
+import network.Messages.AC35Data;
+import shared.model.RunnableWithFramePeriod;
+
+import java.io.IOException;
+import java.net.DatagramSocket;
+
+public class MatchBrowserClientRunnable implements RunnableWithFramePeriod {
+    private MatchBrowserLobbyInterface matchBrowserLobbyInterface;
+    private DatagramSocket socket;
+
+    public MatchBrowserClientRunnable(MatchBrowserLobbyInterface matchBrowserInterface, DatagramSocket socket) {
+        this.matchBrowserLobbyInterface = matchBrowserInterface;
+        this.socket = socket;
+    }
+
+    @Override
+    public void run(){
+        long previousFrameTime = System.currentTimeMillis();
+
+        while (!Thread.interrupted()) {
+            try{
+                matchBrowserLobbyInterface.receiveGameInfo(socket);
+            }catch (IOException e){
+                System.err.println("HostGameMessage could not be received");
+            }
+
+            long currentFrameTime = System.currentTimeMillis();
+            waitForFramePeriod(previousFrameTime, currentFrameTime, 10000);
+            previousFrameTime = currentFrameTime;
+        }
+    }
+}

racevisionGame/src/main/java/visualiser/network/MatchBrowserHostRunnable.java

@@ -0,0 +1,40 @@
+package visualiser.network;
+
+import network.Exceptions.InvalidMessageException;
+import network.Messages.AC35Data;
+import network.Messages.HostGame;
+import shared.model.RunnableWithFramePeriod;
+
+import java.io.IOException;
+import java.net.DatagramSocket;
+
+
+public class MatchBrowserHostRunnable implements RunnableWithFramePeriod {
+
+    private MatchBrowserInterface matchBrowserInterface;
+    private DatagramSocket socket;
+    private AC35Data gameInfo;
+
+    public MatchBrowserHostRunnable(MatchBrowserInterface matchBrowserInterface, DatagramSocket socket, AC35Data gameInfo) {
+        this.matchBrowserInterface = matchBrowserInterface;
+        this.socket = socket;
+        this.gameInfo = gameInfo;
+    }
+
+    @Override
+    public void run(){
+        long previousFrameTime = System.currentTimeMillis();
+
+        while (!Thread.interrupted()) {
+            try{
+                matchBrowserInterface.sendOutGameInfo(gameInfo, socket);
+            }catch (IOException e){
+                System.err.println("HostGameMessage could not be sent");
+            }
+
+            long currentFrameTime = System.currentTimeMillis();
+            waitForFramePeriod(previousFrameTime, currentFrameTime, 10000);
+            previousFrameTime = currentFrameTime;
+        }
+    }
+}

racevisionGame/src/main/java/visualiser/network/MatchBrowserInterface.java

@@ -0,0 +1,93 @@
+package visualiser.network;
+
+import network.BinaryMessageEncoder;
+import network.Exceptions.InvalidMessageException;
+import network.MessageEncoders.HostGameMessageEncoder;
+import network.MessageEncoders.HostedGamesRequestEncoder;
+import network.Messages.AC35Data;
+import network.Messages.Enums.MessageType;
+import network.Messages.HostGamesRequest;
+
+import java.io.IOException;
+import java.net.DatagramPacket;
+import java.net.DatagramSocket;
+import java.net.InetAddress;
+import java.net.UnknownHostException;
+import java.util.ArrayList;
+
+/**
+ * UDP interface for the matchBrowser to send out hosted game info and get in other hosts info
+ */
+public class MatchBrowserInterface {
+    //ip of the server
+    private InetAddress IPAddress;
+    //port server is hosted on
+    private int port;
+
+    public MatchBrowserInterface() {
+        try {//132.181.16.13 is the ip of the CI as of 13/9/17
+            this.IPAddress = InetAddress.getByName("132.181.16.13"); //InetAddress.getLocalHost();
+        } catch (UnknownHostException e) {
+            e.printStackTrace();
+        }
+        this.port = 3779;
+    }
+
+    /**
+     * Used by host to send out race information to the server
+     * @param gameInfo the hostGame info for message
+     * @param socket the udp socket assigned on startup
+     * @throws IOException socket error
+     */
+    protected void sendOutGameInfo(AC35Data gameInfo, DatagramSocket socket) throws IOException{
+        byte[] fullMessageToSend;
+        try{
+            HostGameMessageEncoder encoder = new HostGameMessageEncoder();
+            byte[] message = encoder.encode(gameInfo);
+            BinaryMessageEncoder messageEncoder = new BinaryMessageEncoder(MessageType.HOST_GAME
+                    ,System.currentTimeMillis(), 1,(short) 13 ,message);
+            fullMessageToSend = messageEncoder.getFullMessage();
+
+            DatagramPacket sendPacket = new DatagramPacket(fullMessageToSend, fullMessageToSend.length, IPAddress, port);
+            socket.send(sendPacket);
+        }catch (InvalidMessageException e){
+            System.err.println("HostGameMessage could not be encoded");
+        }
+    }
+
+    /**
+     *  start to send these messages on repeat until game stopped
+     * @param gameInfo hostgame data
+     * @param socket socket to send to
+     */
+    public void startSendingHostData(AC35Data gameInfo, DatagramSocket socket){
+        MatchBrowserHostRunnable hostRunnable = new MatchBrowserHostRunnable(this, socket, gameInfo);
+        Thread hostRunnableThread = new Thread(hostRunnable, "Socket: " + socket.toString());
+        hostRunnableThread.start();
+    }
+
+    /**
+     * Used by a client to setup a connection with the match browser server
+     * @return the socket created for this connection
+     * @throws IOException socket error
+     */
+    public DatagramSocket setupMatchBrowserConnection() throws IOException{
+        DatagramSocket clientSocket = new DatagramSocket();
+
+        //creates and empty hostedGamesRequest packet that can be sent to the server
+        //this lets the server check the udp fields for ip and port to know that this client exists
+        try{
+            HostedGamesRequestEncoder encoder = new HostedGamesRequestEncoder();
+            byte[] message = encoder.encode(new HostGamesRequest(new ArrayList()));
+            BinaryMessageEncoder messageEncoder = new BinaryMessageEncoder(MessageType.HOSTED_GAMES_REQUEST
+                    ,System.currentTimeMillis(), 1,(short) 13 ,message);
+
+            DatagramPacket sendPacket = new DatagramPacket(messageEncoder.getFullMessage(), messageEncoder.getFullMessage().length, IPAddress, port);
+            clientSocket.send(sendPacket);
+        }catch (InvalidMessageException e){
+            System.err.println("HostedGamesRequestMessage could not be encoded");
+        }
+
+        return clientSocket;
+    }
+}

racevisionGame/src/main/java/visualiser/network/MatchBrowserLobbyInterface.java

@@ -0,0 +1,76 @@
+package visualiser.network;
+
+import network.Exceptions.InvalidMessageException;
+import network.MessageDecoders.HostedGamesRequestDecoder;
+import network.Messages.HostGame;
+import network.Messages.HostGamesRequest;
+
+import java.io.IOException;
+import java.net.DatagramPacket;
+import java.net.DatagramSocket;
+import java.util.ArrayList;
+import java.util.List;
+import java.util.Observable;
+
+/**
+ * Used to receive lobby information from server
+ */
+public class MatchBrowserLobbyInterface extends Observable {
+    private DatagramSocket socket;
+    private MatchBrowserClientRunnable clientRunnable;
+    private List<HostGame> games = new ArrayList<>();
+    private Thread clientRunnableThread;
+
+    public MatchBrowserLobbyInterface() {
+
+    }
+
+    /**
+     * start receiving game info
+     * @param socket to receive from
+     */
+    public void startReceivingHostData(DatagramSocket socket) {
+        this.socket = socket;
+        clientRunnable = new MatchBrowserClientRunnable(this, socket);
+        clientRunnableThread = new Thread(clientRunnable, "Socket: " + socket.toString());
+        clientRunnableThread.start();
+    }
+
+    /**
+     * Used by client to received race information from the server
+     * @param socket socket to read from
+     * @throws IOException socket error
+     */
+    protected void receiveGameInfo(DatagramSocket socket) throws IOException {
+        byte[] data = new byte[64];
+        DatagramPacket receivedPacket = new DatagramPacket(data, 64);
+        socket.receive(receivedPacket);
+
+        HostedGamesRequestDecoder hostedGamesRequestDecoder = new HostedGamesRequestDecoder();
+        try {
+            HostGamesRequest message = (HostGamesRequest) hostedGamesRequestDecoder.decode(data);
+            games = message.getKnownGames();
+//            System.out.println(games.get(0).getIp());
+            setChanged();
+            notifyObservers();
+        } catch (InvalidMessageException e) {
+            System.err.println("HostedGamesRequestMessage could not be decoded");
+        }
+    }
+
+    /**
+     * Gets the host games
+     * @return games to be returned in list
+     */
+    public List<HostGame> getGames() {
+        return games;
+    }
+
+    /**
+     * Used to close the socket and runnable once out of the lobby
+     */
+    public void closeSocket() {
+        clientRunnableThread.interrupt();
+        this.socket.close();
+    }
+}

racevisionGame/src/main/java/visualiser/network/ServerConnection.java

@@ -7,14 +7,12 @@ import network.MessageRouters.MessageRouter;
 import network.Messages.AC35Data;
 import network.Messages.Enums.MessageType;
 import network.Messages.Enums.RequestToJoinEnum;
-import network.Messages.LatestMessages;
 import network.StreamRelated.MessageDeserialiser;
 import network.StreamRelated.MessageSerialiser;
 import shared.model.RunnableWithFramePeriod;
-import visualiser.model.VisualiserRaceEvent;
-import visualiser.model.VisualiserRaceController;
 import visualiser.enums.ConnectionToServerState;
 import visualiser.gameController.ControllerClient;
+import visualiser.model.VisualiserRaceController;
 import visualiser.model.VisualiserRaceState;
 
 import java.io.IOException;
@@ -310,7 +308,7 @@ public class ServerConnection implements RunnableWithFramePeriod {
     }
 
 
-    //TODO create input controller here. RaceController should query for it, if it exists.
+    //TODO create input controller here. RaceViewController should query for it, if it exists.
     private void createPlayerInputController() {
 
         this.messageRouter.addRoute(MessageType.BOATACTION, messageSerialiser.getMessagesToSend());
@@ -468,7 +466,15 @@ public class ServerConnection implements RunnableWithFramePeriod {
             this.visualiserRaceControllerThread.interrupt();
         }
 
-
+        if (this.socket != null) {
+            try {
+                this.socket.getInputStream().close();
+                this.socket.getOutputStream().close();
+                this.socket.close();
+            } catch (IOException e) {
+                e.printStackTrace();
+            }
+        }
 
         //TODO input controller?
 

racevisionGame/src/main/resources/mock/mockXML/schema/raceSchema.xsd

@@ -15,7 +15,7 @@
                 <xs:element name="Participants">
                     <xs:complexType>
                         <xs:sequence>
-                            <xs:element name="Yacht" maxOccurs="unbounded">
+                            <xs:element name="Yacht" maxOccurs="unbounded" minOccurs="0">
                                 <xs:complexType>
                                     <xs:attribute name="SourceID" type="xs:int" use="required"/>
                                     <xs:attribute name="Entry" type="xs:string"/>

racevisionGame/src/main/resources/visualiser/scenes/connect.fxml

@@ -1,82 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-
-<?import javafx.geometry.Insets?>
-<?import javafx.scene.control.Button?>
-<?import javafx.scene.control.Label?>
-<?import javafx.scene.control.TableColumn?>
-<?import javafx.scene.control.TableView?>
-<?import javafx.scene.control.TextField?>
-<?import javafx.scene.layout.AnchorPane?>
-<?import javafx.scene.layout.ColumnConstraints?>
-<?import javafx.scene.layout.GridPane?>
-<?import javafx.scene.layout.RowConstraints?>
-<?import javafx.scene.text.Font?>
-
-<AnchorPane fx:id="connectionWrapper" maxHeight="-Infinity" maxWidth="-Infinity" minHeight="-Infinity" minWidth="-Infinity" prefHeight="600.0" prefWidth="780.0" visible="false" xmlns="http://javafx.com/javafx/8.0.112" xmlns:fx="http://javafx.com/fxml/1" fx:controller="visualiser.Controllers.ConnectionController">
-   <children>
-      <GridPane fx:id="connection" prefHeight="600.0" prefWidth="780.0" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
-         <columnConstraints>
-            <ColumnConstraints hgrow="SOMETIMES" maxWidth="600.0" minWidth="10.0" prefWidth="600.0" />
-            <ColumnConstraints hgrow="SOMETIMES" maxWidth="600.0" minWidth="10.0" prefWidth="600.0" />
-         </columnConstraints>
-         <rowConstraints>
-            <RowConstraints maxHeight="182.0" minHeight="10.0" prefHeight="182.0" vgrow="SOMETIMES" />
-            <RowConstraints maxHeight="434.0" minHeight="10.0" prefHeight="434.0" vgrow="SOMETIMES" />
-            <RowConstraints maxHeight="174.0" minHeight="10.0" prefHeight="174.0" vgrow="SOMETIMES" />
-            <RowConstraints maxHeight="80.0" minHeight="50.0" prefHeight="80.0" vgrow="SOMETIMES" />
-         </rowConstraints>
-         <children>
-            <TableView fx:id="connectionTable" prefHeight="200.0" prefWidth="1080.0" GridPane.columnSpan="2" GridPane.rowIndex="1">
-               <columns>
-                  <TableColumn fx:id="hostnameColumn" prefWidth="453.99998474121094" text="Host" />
-                  <TableColumn fx:id="statusColumn" prefWidth="205.0" text="Status" />
-               </columns>
-               <GridPane.margin>
-                  <Insets left="50.0" right="50.0" />
-               </GridPane.margin>
-            </TableView>
-            <Button mnemonicParsing="false" onAction="#checkConnections" text="Refresh" GridPane.halignment="RIGHT" GridPane.rowIndex="3">
-               <GridPane.margin>
-                  <Insets right="20.0" />
-               </GridPane.margin>
-            </Button>
-            <Button fx:id="connectButton" mnemonicParsing="false" onAction="#connectSocket" text="Connect" GridPane.columnIndex="1" GridPane.halignment="LEFT" GridPane.rowIndex="3">
-               <GridPane.margin>
-                  <Insets left="20.0" />
-               </GridPane.margin>
-            </Button>
-            <Label text="Welcome to RaceVision" GridPane.columnSpan="2" GridPane.halignment="CENTER">
-               <font>
-                  <Font size="36.0" />
-               </font>
-            </Label>
-            <GridPane GridPane.columnSpan="2" GridPane.rowIndex="2">
-              <columnConstraints>
-                <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
-                <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
-                  <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
-              </columnConstraints>
-              <rowConstraints>
-                  <RowConstraints minHeight="10.0" prefHeight="30.0" vgrow="SOMETIMES" />
-                <RowConstraints minHeight="10.0" prefHeight="30.0" vgrow="SOMETIMES" />
-              </rowConstraints>
-               <children>
-                  <TextField fx:id="urlField" GridPane.rowIndex="1">
-                     <GridPane.margin>
-                        <Insets bottom="10.0" left="10.0" right="10.0" top="10.0" />
-                     </GridPane.margin>
-                  </TextField>
-                  <TextField fx:id="portField" GridPane.columnIndex="1" GridPane.rowIndex="1">
-                     <GridPane.margin>
-                        <Insets bottom="10.0" left="10.0" right="10.0" top="10.0" />
-                     </GridPane.margin>
-                  </TextField>
-                  <Button mnemonicParsing="false" onAction="#addConnection" text="Add New Connection" GridPane.columnIndex="2" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="CENTER" />
-                  <Label text="Host Name:" GridPane.halignment="CENTER" GridPane.valignment="BOTTOM" />
-                  <Label text="Port:" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.valignment="BOTTOM" />
-               </children>
-            </GridPane>
-         </children>
-      </GridPane>
-   </children>
-</AnchorPane>

racevisionGame/src/main/resources/visualiser/scenes/controls.fxml

@@ -1,15 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-
-<?import javafx.scene.image.*?>
-<?import java.lang.*?>
-<?import javafx.scene.layout.*?>
-
-<AnchorPane maxHeight="-Infinity" maxWidth="-Infinity" minHeight="-Infinity" minWidth="-Infinity" prefHeight="350.0" prefWidth="600.0" xmlns="http://javafx.com/javafx/8" xmlns:fx="http://javafx.com/fxml/1">
-   <children>
-      <ImageView fitHeight="385.0" fitWidth="600.0" layoutY="-2.0" pickOnBounds="true" preserveRatio="true" AnchorPane.bottomAnchor="-1.9456787109375" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="-2.0">
-         <image>
-            <Image url="@../images/game_controls.png" />
-         </image>
-      </ImageView>
-   </children>
-</AnchorPane>

racevisionGame/src/main/resources/visualiser/scenes/gameLobby.fxml

@@ -0,0 +1,112 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<?import java.lang.*?>
+<?import javafx.geometry.*?>
+<?import javafx.scene.control.*?>
+<?import javafx.scene.image.*?>
+<?import javafx.scene.layout.*?>
+<?import javafx.scene.text.*?>
+<?import javafx.geometry.Insets?>
+<?import javafx.scene.control.Button?>
+<?import javafx.scene.control.Label?>
+<?import javafx.scene.control.SplitPane?>
+<?import javafx.scene.control.TableColumn?>
+<?import javafx.scene.control.TableView?>
+<?import javafx.scene.image.Image?>
+<?import javafx.scene.image.ImageView?>
+<?import javafx.scene.layout.AnchorPane?>
+<?import javafx.scene.layout.ColumnConstraints?>
+<?import javafx.scene.layout.GridPane?>
+<?import javafx.scene.layout.RowConstraints?>
+<?import javafx.scene.text.Font?>
+
+<AnchorPane fx:id="gameLobbyWrapper" maxHeight="-Infinity" maxWidth="-Infinity" minHeight="-Infinity" minWidth="-Infinity" prefHeight="600.0" prefWidth="780.0" style="-fx-background-color: rgba(100, 100, 100, 0.2);" xmlns="http://javafx.com/javafx/8" xmlns:fx="http://javafx.com/fxml/1" fx:controller="visualiser.Controllers.InGameLobbyController">
+    <children>
+      <GridPane style="-fx-background-color: rgba(0, 0, 0, 0.3);" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
+         <children>
+            <Button mnemonicParsing="false" onAction="#menuBtnPressed" text="Quit" GridPane.rowIndex="2">
+               <GridPane.margin>
+                  <Insets left="20.0" />
+               </GridPane.margin>
+            </Button>
+            <Label fx:id="countdownLabel" alignment="CENTER" contentDisplay="CENTER" textFill="WHITE" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.rowIndex="2">
+               <font>
+                  <Font size="16.0" />
+               </font>
+            </Label>
+            <GridPane fx:id="playerContainer" GridPane.columnSpan="3" GridPane.rowIndex="1">
+               <columnConstraints>
+                  <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+                  <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+                  <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+               </columnConstraints>
+               <rowConstraints>
+                  <RowConstraints minHeight="10.0" prefHeight="30.0" vgrow="SOMETIMES" />
+                  <RowConstraints minHeight="10.0" prefHeight="30.0" vgrow="SOMETIMES" />
+               </rowConstraints>
+               <children>
+                  <Label fx:id="playerLabel" text="No Player" GridPane.halignment="CENTER" GridPane.valignment="BOTTOM">
+                     <GridPane.margin>
+                        <Insets bottom="15.0" left="15.0" right="15.0" top="15.0" />
+                     </GridPane.margin>
+                  </Label>
+                  <Label fx:id="playerLabel4" text="No Player" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="BOTTOM">
+                     <GridPane.margin>
+                        <Insets bottom="15.0" left="15.0" right="15.0" top="15.0" />
+                     </GridPane.margin>
+                  </Label>
+                  <Label fx:id="playerLabel2" text="No Player" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.valignment="BOTTOM">
+                     <GridPane.margin>
+                        <Insets bottom="15.0" left="15.0" right="15.0" top="15.0" />
+                     </GridPane.margin>
+                  </Label>
+                  <Label fx:id="playerLabel3" text="No Player" GridPane.columnIndex="2" GridPane.halignment="CENTER" GridPane.valignment="BOTTOM">
+                     <GridPane.margin>
+                        <Insets bottom="15.0" left="15.0" right="15.0" top="15.0" />
+                     </GridPane.margin>
+                  </Label>
+                  <Label fx:id="playerLabel5" text="No Player" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="BOTTOM">
+                     <GridPane.margin>
+                        <Insets bottom="15.0" left="15.0" right="15.0" top="15.0" />
+                     </GridPane.margin>
+                  </Label>
+                  <Label fx:id="playerLabel6" text="No Player" GridPane.columnIndex="2" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="BOTTOM">
+                     <GridPane.margin>
+                        <Insets bottom="15.0" left="15.0" right="15.0" top="15.0" />
+                     </GridPane.margin>
+                  </Label>
+               </children>
+            </GridPane>
+            <Label text="Get Ready For The Next Race" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.valignment="CENTER">
+               <font>
+                  <Font name="Cabin-Bold" size="17.0" />
+               </font>
+            </Label>
+         </children>
+         <columnConstraints>
+            <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+            <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+            <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+         </columnConstraints>
+         <rowConstraints>
+            <RowConstraints maxHeight="80.0" minHeight="80.0" prefHeight="80.0" vgrow="SOMETIMES" />
+            <RowConstraints maxHeight="1.7976931348623157E308" minHeight="250.0" vgrow="SOMETIMES" />
+            <RowConstraints maxHeight="80.0" minHeight="80.0" prefHeight="80.0" vgrow="SOMETIMES" />
+         </rowConstraints>
+      </GridPane>
+      <AnchorPane fx:id="countdownTenPane" prefHeight="200.0" prefWidth="200.0" visible="false" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
+         <children>
+            <Label fx:id="countdownTenText" alignment="CENTER" text="COUNTDOWN" textFill="#ee0000" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
+               <font>
+                  <Font name="System Bold" size="41.0" />
+               </font>
+            </Label>
+            <Label fx:id="preRacelabel" alignment="CENTER" text="Entering Race In:" textFill="RED" AnchorPane.bottomAnchor="80.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
+               <font>
+                  <Font name="System Bold" size="18.0" />
+               </font>
+            </Label>
+         </children>
+      </AnchorPane>
+    </children>
+</AnchorPane>

racevisionGame/src/main/resources/visualiser/scenes/hostGame.fxml

@@ -0,0 +1,56 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<?import javafx.geometry.Insets?>
+<?import javafx.scene.control.Button?>
+<?import javafx.scene.control.Label?>
+<?import javafx.scene.image.ImageView?>
+<?import javafx.scene.layout.AnchorPane?>
+<?import javafx.scene.layout.ColumnConstraints?>
+<?import javafx.scene.layout.GridPane?>
+<?import javafx.scene.layout.RowConstraints?>
+<?import javafx.scene.text.Font?>
+
+<AnchorPane fx:id="hostWrapper" maxHeight="-Infinity" maxWidth="-Infinity" minHeight="-Infinity" minWidth="-Infinity" prefHeight="600.0" prefWidth="780.0" xmlns="http://javafx.com/javafx/8.0.111" xmlns:fx="http://javafx.com/fxml/1" fx:controller="visualiser.Controllers.HostGameController">
+    <children>
+        <GridPane layoutY="14.0" AnchorPane.bottomAnchor="-14.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="14.0">
+            <columnConstraints>
+                <ColumnConstraints hgrow="SOMETIMES" maxWidth="170.0" minWidth="10.0" prefWidth="170.0" />
+                <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+                <ColumnConstraints hgrow="SOMETIMES" maxWidth="170.0" minWidth="10.0" prefWidth="170.0" />
+            </columnConstraints>
+            <rowConstraints>
+                <RowConstraints maxHeight="60.0" minHeight="60.0" prefHeight="30.0" vgrow="SOMETIMES" />
+                <RowConstraints minHeight="10.0" prefHeight="435.0" vgrow="SOMETIMES" />
+                <RowConstraints maxHeight="80.0" minHeight="80.0" prefHeight="80.0" vgrow="SOMETIMES" />
+            </rowConstraints>
+            <children>
+                <Button fx:id="hostGameBtn" mnemonicParsing="false" onAction="#hostGamePressed" text="Start Game" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.rowIndex="2" GridPane.valignment="CENTER">
+                    <font>
+                        <Font size="20.0" />
+                    </font>
+                    <GridPane.margin>
+                        <Insets bottom="20.0" left="20.0" right="20.0" top="20.0" />
+                    </GridPane.margin>
+                </Button>
+                <Label text="Address: 127.0.0.1" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.valignment="TOP">
+                    <font>
+                        <Font size="17.0" />
+                    </font>
+                </Label>
+                <Label text="Port: 4942" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.valignment="BOTTOM">
+                    <font>
+                        <Font size="17.0" />
+                    </font>
+                </Label>
+                <Button mnemonicParsing="false" onAction="#menuBtnPressed" text="Main Menu" GridPane.halignment="LEFT" GridPane.valignment="TOP">
+                    <GridPane.margin>
+                        <Insets bottom="10.0" left="10.0" right="10.0" top="10.0" />
+                    </GridPane.margin>
+                </Button>
+                <ImageView fx:id="mapImage" pickOnBounds="true" preserveRatio="true" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.hgrow="ALWAYS" GridPane.rowIndex="1" GridPane.valignment="CENTER" GridPane.vgrow="ALWAYS" />
+                <Button fx:id="previousButton" maxHeight="80.0" maxWidth="80.0" mnemonicParsing="false" onAction="#previousImage" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="CENTER" />
+                <Button fx:id="nextButton" maxHeight="80.0" maxWidth="80.0" mnemonicParsing="false" onAction="#nextImage" GridPane.columnIndex="2" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="CENTER" />
+            </children>
+        </GridPane>
+    </children>
+</AnchorPane>

racevisionGame/src/main/resources/visualiser/scenes/hostgame.fxml

@@ -1,61 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-
-<?import java.lang.*?>
-<?import javafx.geometry.*?>
-<?import javafx.scene.control.*?>
-<?import javafx.scene.image.*?>
-<?import javafx.scene.layout.*?>
-<?import javafx.scene.text.*?>
-<?import javafx.geometry.Insets?>
-<?import javafx.scene.control.Button?>
-<?import javafx.scene.control.Label?>
-<?import javafx.scene.image.ImageView?>
-<?import javafx.scene.layout.AnchorPane?>
-<?import javafx.scene.layout.ColumnConstraints?>
-<?import javafx.scene.layout.GridPane?>
-<?import javafx.scene.layout.RowConstraints?>
-<?import javafx.scene.text.Font?>
-
-<AnchorPane fx:id="hostWrapper" maxHeight="-Infinity" maxWidth="-Infinity" minHeight="-Infinity" minWidth="-Infinity" prefHeight="600.0" prefWidth="780.0" visible="false" xmlns="http://javafx.com/javafx/8" xmlns:fx="http://javafx.com/fxml/1" fx:controller="visualiser.Controllers.HostController">
-   <children>
-      <GridPane layoutY="14.0" AnchorPane.bottomAnchor="-14.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="14.0">
-        <columnConstraints>
-            <ColumnConstraints hgrow="SOMETIMES" maxWidth="170.0" minWidth="10.0" prefWidth="170.0" />
-          <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
-          <ColumnConstraints hgrow="SOMETIMES" maxWidth="170.0" minWidth="10.0" prefWidth="170.0" />
-        </columnConstraints>
-        <rowConstraints>
-          <RowConstraints maxHeight="60.0" minHeight="60.0" prefHeight="30.0" vgrow="SOMETIMES" />
-          <RowConstraints minHeight="10.0" prefHeight="435.0" vgrow="SOMETIMES" />
-          <RowConstraints maxHeight="80.0" minHeight="80.0" prefHeight="80.0" vgrow="SOMETIMES" />
-        </rowConstraints>
-         <children>
-            <Button fx:id="hostGameBtn" mnemonicParsing="false" onAction="#hostGamePressed" text="Start Game" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.rowIndex="2" GridPane.valignment="CENTER">
-               <font>
-                  <Font size="20.0" />
-               </font>
-               <GridPane.margin>
-                  <Insets bottom="20.0" left="20.0" right="20.0" top="20.0" />
-               </GridPane.margin>
-            </Button>
-            <Label text="Address: 127.0.0.1" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.valignment="TOP">
-               <font>
-                  <Font size="17.0" />
-               </font>
-            </Label>
-            <Label text="Port: 4942" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.valignment="BOTTOM">
-               <font>
-                  <Font size="17.0" />
-               </font>
-            </Label>
-            <Button mnemonicParsing="false" onAction="#menuBtnPressed" text="Main Menu" GridPane.halignment="LEFT" GridPane.valignment="TOP">
-               <GridPane.margin>
-                  <Insets bottom="10.0" left="10.0" right="10.0" top="10.0" />
-               </GridPane.margin></Button>
-            <ImageView fx:id="mapImage" pickOnBounds="true" preserveRatio="true" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.hgrow="ALWAYS" GridPane.rowIndex="1" GridPane.valignment="CENTER" GridPane.vgrow="ALWAYS" />
-            <Button fx:id="previousButton" maxHeight="80.0" maxWidth="80.0" mnemonicParsing="false" onAction="#previousImage" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="CENTER" />
-            <Button fx:id="nextButton" maxHeight="80.0" maxWidth="80.0" mnemonicParsing="false" onAction="#nextImage" GridPane.columnIndex="2" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="CENTER" />
-         </children>
-      </GridPane>
-   </children>
-</AnchorPane>

racevisionGame/src/main/resources/visualiser/scenes/lobby.fxml

@@ -1,10 +1,5 @@
 <?xml version="1.0" encoding="UTF-8"?>
 
-<?import java.lang.*?>
-<?import javafx.geometry.*?>
-<?import javafx.scene.control.*?>
-<?import javafx.scene.layout.*?>
-<?import javafx.scene.text.*?>
 <?import javafx.geometry.Insets?>
 <?import javafx.scene.control.Button?>
 <?import javafx.scene.control.Label?>
@@ -17,7 +12,7 @@
 <?import javafx.scene.layout.RowConstraints?>
 <?import javafx.scene.text.Font?>
 
-<AnchorPane fx:id="lobbyWrapper" maxHeight="-Infinity" maxWidth="-Infinity" minHeight="-Infinity" minWidth="-Infinity" prefHeight="600.0" prefWidth="780.0" visible="false" xmlns="http://javafx.com/javafx/8" xmlns:fx="http://javafx.com/fxml/1" fx:controller="visualiser.Controllers.LobbyController">
+<AnchorPane fx:id="lobbyWrapper" maxHeight="-Infinity" maxWidth="-Infinity" minHeight="-Infinity" minWidth="-Infinity" prefHeight="600.0" prefWidth="780.0" xmlns="http://javafx.com/javafx/8.0.111" xmlns:fx="http://javafx.com/fxml/1" fx:controller="visualiser.Controllers.LobbyController">
    <children>
       <GridPane fx:id="connection" prefHeight="600.0" prefWidth="780.0" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
          <columnConstraints>

racevisionGame/src/main/resources/visualiser/scenes/main.fxml

@@ -1,14 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-
-<?import javafx.scene.layout.AnchorPane?>
-<AnchorPane fx:id="main" xmlns="http://javafx.com/javafx/8" xmlns:fx="http://javafx.com/fxml/1" fx:controller="visualiser.Controllers.MainController">
-    <children>
-        <fx:include fx:id="race" source="race.fxml" />
-        <fx:include fx:id="start" source="start.fxml" />
-        <fx:include fx:id="connection" source="connect.fxml" />
-        <fx:include fx:id="finish" source="finish.fxml" />
-        <fx:include fx:id="host" source="hostgame.fxml" />
-        <fx:include fx:id="title" source="titleScreen.fxml" />
-        <fx:include fx:id="lobby" source="lobby.fxml" />
-    </children>
-</AnchorPane>