Merge branch 'storyB-)' into 'master'

B) [V,M] As a player I would like to have the game run smoothly and have a unique game experience

Acceptance criteria:
*  Boat moves smoothly when executing command
*  The appearance of the game is unique and consistent

This merge request also closes issue #42.

See merge request !42

.idea/copyright/profiles_settings.xml

@@ -0,0 +1,3 @@
+<component name="CopyrightManager">
+  <settings default="" />
+</component>

racevisionGame/src/main/java/mock/app/Event.java

@@ -75,9 +75,6 @@ public class Event {
      * @throws EventConstructionException Thrown if we cannot create an Event for any reason.
      */
     public Event(boolean singlePlayer, int mapIndex) throws EventConstructionException {
-
-//        System.out.println(XMLUtilities.validateXML(this.getClass().getClassLoader().getResource("mock/mockXML/iMapLayout.xml").toString()
-//                , this.getClass().getClassLoader().getResource("mock/mockXML/schema/raceSchema.xsd")));
         this.mapIndex = mapIndex;
         String raceXMLFile;
         String boatsXMLFile = "mock/mockXML/boatTest.xml";

racevisionGame/src/main/java/mock/model/MockBoat.java

@@ -34,7 +34,10 @@ public class MockBoat extends Boat {
      */
     private boolean autoVMG = false;
 
-
+    /**
+     * Indicates whether boat velocity is determined by wind
+     */
+    private boolean velocityDefault = true;
 
     /**
      * Constructs a boat object with a given sourceID, name, country/team abbreviation, and polars table.
@@ -300,4 +303,12 @@ public class MockBoat extends Boat {
     public void setAutoVMG(boolean autoVMG) {
         this.autoVMG = autoVMG;
     }
+
+    public boolean isVelocityDefault() {
+        return velocityDefault;
+    }
+
+    public void setVelocityDefault(boolean velocityDefault) {
+        this.velocityDefault = velocityDefault;
+    }
 }

racevisionGame/src/main/java/mock/model/MockRace.java

@@ -1,5 +1,7 @@
 package mock.model;
 
+import mock.model.commandFactory.ActiveObserverCommand;
+import mock.model.commandFactory.ObserverCommand;
 import mock.model.wind.WindGenerator;
 import javafx.animation.AnimationTimer;
 import mock.model.collider.ColliderRegistry;
@@ -64,6 +66,8 @@ public class MockRace extends RaceState {
      */
     private Polars polars;
 
+    private ActiveObserverCommand activeObserverCommand;
+
 
 
     /**
@@ -81,6 +85,7 @@ public class MockRace extends RaceState {
         this.setRaceDataSource(raceDataSource);
         this.setRegattaDataSource(regattaDataSource);
 
+        this.activeObserverCommand = new ActiveObserverCommand();
         this.polars = polars;
         this.scaleFactor = timeScale;
 
@@ -355,70 +360,25 @@ public class MockRace extends RaceState {
         //Checks if the current boat has finished the race or not.
         boolean finish = this.isLastLeg(boat.getCurrentLeg());
 
-        if (!finish && totalElapsedMilliseconds >= updatePeriodMilliseconds && boat.isSailsOut()) {
+        if (!finish && totalElapsedMilliseconds >= updatePeriodMilliseconds) {
 
             checkPosition(boat, totalElapsedMilliseconds);
 
-            if (boat.getCurrentSpeed() == 0) {
-                newOptimalVMG(boat);
-                boat.setBearing(boat.calculateBearingToNextMarker());
-            }
-
-            setBoatSpeed(boat);
+            if(boat.isVelocityDefault()) setBoatSpeed(boat);
 
             //Calculates the distance travelled, in meters, in the current timeslice.
-            double distanceTravelledMeters = boat.calculateMetersTravelled(updatePeriodMilliseconds);
-
-            //Scale it.
-            distanceTravelledMeters = distanceTravelledMeters * this.scaleFactor;
-
+            double distanceTravelledMeters = boat.calculateMetersTravelled(updatePeriodMilliseconds) * this.scaleFactor;
 
             //Move the boat forwards that many meters, and advances its time counters by enough milliseconds.
             boat.moveForwards(distanceTravelledMeters);
             boat.setTimeSinceTackChange(boat.getTimeSinceTackChange() + updatePeriodMilliseconds);
-
-            if (boat.getAutoVMG()) {
-                newOptimalVMG(boat);
-                boat.setAutoVMG(false);
-            }
-
-        } else {
-            boat.setCurrentSpeed(0);
         }
 
         this.updateEstimatedTime(boat);
 
     }
 
-    private void newOptimalVMG(MockBoat boat) {
-        long tackPeriod = 1000;
-        if (boat.getTimeSinceTackChange() > tackPeriod) {
-            //System.out.println("optim called");
-            //Calculate the new VMG.
-//            VMG newVMG = boat.getPolars().calculateVMG(
-//                    this.getWindDirection(),
-//                    this.getWindSpeed(),
-//                    boat.calculateBearingToNextMarker(),
-//                    Bearing.fromDegrees(0d),
-//                    Bearing.fromDegrees(359.99999d));
-
-            VMG newVMG = NewPolars.setBestVMG(this.getWindDirection(), this.getWindSpeed(), boat.getBearing());
-            //System.out.println(newVMG);
-            //If the new vmg improves velocity, use it.
-            /*if (improvesVelocity(boat, newVMG)) {
-            }*/
-            boat.setVMG(newVMG);
-        }
-    }
-
     private void setBoatSpeed(MockBoat boat) {
-//        VMG vmg = boat.getPolars().calculateVMG(
-//                this.getWindDirection(),
-//                this.getWindSpeed(),
-//                boat.getBearing(),
-//                Bearing.fromDegrees(boat.getBearing().degrees() - 1),
-//                Bearing.fromDegrees(boat.getBearing().degrees() + 1));
-        //VMG vmg = boat.getPolars().setBestVMG(this.getWindDirection(), this.getWindSpeed(), boat.getBearing());
         VMG vmg = new VMG(NewPolars.calculateSpeed(
                 this.getWindDirection(),
                 this.getWindSpeed(),
@@ -754,4 +714,18 @@ public class MockRace extends RaceState {
 
     }
 
+    /**
+     * Made public, so race logic can control it
+     */
+    public void setChanged() {
+        super.setChanged();
+    }
+
+    public void addVelocityCommand(ObserverCommand c) {
+        this.activeObserverCommand.changeVelocityCommand(this, c);
+    }
+
+    public void addAngularCommand(ObserverCommand c) {
+        this.activeObserverCommand.changeAngularCommand(this, c);
+    }
 }

racevisionGame/src/main/java/mock/model/NewPolars.java

@@ -145,8 +145,6 @@ public class NewPolars {
      * @return the best vmg that the boat can change to
      */
     public static VMG setBestVMG(Bearing trueWindAngle, double trueWindSpeed, Bearing boatAngle){
-        //System.out.println("VMG AUTO CALLED");
-        //speed
         double closestSpeed = getClosest(trueWindSpeed, polars.keySet());
 
         double angle = modulateAngle(boatAngle.degrees() - trueWindAngle.degrees());
@@ -181,15 +179,29 @@ public class NewPolars {
 
     }
 
+    /**
+     * gets the angle bound between 0 and 360 following modular arithmetic
+     * @param angle angle to modulate
+     * @return resultant angle after modulation.
+     */
     public static double modulateAngle(double angle){
         return (angle % 360 + 360) % 360;
     }
 
+    /**
+     * DO NOT DELETE THIS FUNCTIONS THEY ARE USED FOR TESTING PURPOSES
+     * @return current polars map
+     */
+    @SuppressWarnings("unused")
     private Map<Double, TreeMap<Double, Double>> getPolars(){
         //this function is just for testing so therefore it is private
         return polars;
     }
 
+    /**
+     * DO NOT DELETE THESE FUNCTIONS THEY ARE USED FOR TESTING PURPOSES
+     */
+    @SuppressWarnings("unused")
     private void printOutLinearInterpolated(){
         for (double tws: polars.keySet()){
             System.out.println("==================================================");

racevisionGame/src/main/java/mock/model/RaceLogic.java

@@ -2,6 +2,7 @@ package mock.model;
 
 import javafx.animation.AnimationTimer;
 import mock.model.collider.Collision;
+import mock.model.commandFactory.CollisionCommand;
 import mock.model.commandFactory.Command;
 import mock.model.commandFactory.CompositeCommand;
 import mock.model.commandFactory.CommandFactory;
@@ -148,6 +149,10 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
             // Execute commands from clients.
             commands.execute();
 
+            // Notify Observers
+            race.setChanged();
+            race.notifyObservers();
+
             //Update race time.
             race.updateRaceTime(currentTime);
 
@@ -218,11 +223,9 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
 
     @Override
     public void update(Observable o, Object arg) {
-        Collision e = (Collision)arg;
-
-//        if(e.getBearing().degrees() == 0) System.out.println("Ahead");
-//        else if(e.getBearing().degrees() < 90) System.out.println("Starboard");
-//        else if(e.getBearing().degrees() > 270) System.out.println("Port");
-//        else System.out.println("Behind");
+        if(arg instanceof Collision) {
+            Collision collision = (Collision)arg;
+            commands.addCommand(new CollisionCommand(race, (MockBoat)collision.getBoat()));
+        }
     }
 }

racevisionGame/src/main/java/mock/model/collider/Collider.java

@@ -25,13 +25,9 @@ public abstract class Collider extends Observable implements Locatable {
         Bearing relative = Bearing.fromDegrees(absolute.degrees() - boat.getBearing().degrees());
 
         if(actualDistance <= distance) {
-            Collision collision = new Collision(relative, distance);
+            Collision collision = new Collision(boat, relative, distance);
             // Notify object of collision
-            onCollisionEnter(boat, collision);
-            // Notify observers of collision
-            notifyObservers(collision);
-            this.setChanged();
-
+            onCollisionEnter(collision);
             return true;
         } else return false;
     }
@@ -45,8 +41,7 @@ public abstract class Collider extends Observable implements Locatable {
 
     /**
      * Handle a collision event
-     * @param collider Boat that is colliding
      * @param e details of collision
      */
-    public abstract void onCollisionEnter(Boat collider, Collision e);
+    public abstract void onCollisionEnter(Collision e);
 }

racevisionGame/src/main/java/mock/model/collider/ColliderRegistry.java

@@ -1,5 +1,6 @@
 package mock.model.collider;
 
+import mock.model.MockBoat;
 import shared.model.Boat;
 import shared.model.GPSCoordinate;
 
@@ -39,7 +40,7 @@ public class ColliderRegistry extends Collider implements Observer {
     }
 
     @Override
-    public void onCollisionEnter(Boat collider, Collision e) {}
+    public void onCollisionEnter(Collision e) {}
 
     @Override
     public GPSCoordinate getPosition() {
@@ -60,7 +61,7 @@ public class ColliderRegistry extends Collider implements Observer {
     public void update(Observable o, Object arg) {
         Collision collision = (Collision)arg;
 
-        notifyObservers(collision);
         this.setChanged();
+        notifyObservers(collision);
     }
 }

racevisionGame/src/main/java/mock/model/collider/Collision.java

@@ -1,6 +1,7 @@
 package mock.model.collider;
 
 import shared.model.Bearing;
+import shared.model.Boat;
 
 /**
  * Data structure for holding collision details for ray casting and event handling.
@@ -14,13 +15,19 @@ public class Collision {
      * Distance from boat centre to target centre
      */
     private double distance;
+    /**
+     * Boat involved in the collision
+     */
+    private Boat boat;
 
     /**
      * Constructor for Collision structure
+     * @param boat involved in collision
      * @param bearing from boat heading to target
      * @param distance from boat centre to target centre
      */
-    public Collision(Bearing bearing, double distance) {
+    public Collision(Boat boat, Bearing bearing, double distance) {
+        this.boat = boat;
         this.bearing = bearing;
         this.distance = distance;
     }
@@ -32,4 +39,8 @@ public class Collision {
     public double getDistance() {
         return distance;
     }
+
+    public Boat getBoat() {
+        return boat;
+    }
 }

racevisionGame/src/main/java/mock/model/commandFactory/ActiveObserverCommand.java

@@ -0,0 +1,27 @@
+package mock.model.commandFactory;
+
+import java.util.Observable;
+
+/**
+ * Used to track the current active observer command. This is to ensure two commands that do similar things do not overlap.
+ */
+public class ActiveObserverCommand {
+    private ObserverCommand currentVelocityCommand;
+    private ObserverCommand currentAngularCommand;
+
+    public ActiveObserverCommand() {
+
+    }
+
+    public void changeVelocityCommand(Observable o, ObserverCommand c) {
+        o.deleteObserver(currentVelocityCommand);
+        o.addObserver(c);
+        currentVelocityCommand = c;
+    }
+
+    public void changeAngularCommand(Observable o, ObserverCommand c) {
+        o.deleteObserver(currentAngularCommand);
+        o.addObserver(c);
+        currentAngularCommand = c;
+    }
+}

racevisionGame/src/main/java/mock/model/commandFactory/CollisionCommand.java

@@ -0,0 +1,44 @@
+package mock.model.commandFactory;
+
+import mock.model.MockBoat;
+import mock.model.MockRace;
+import shared.model.Azimuth;
+import shared.model.GPSCoordinate;
+
+import java.util.Observable;
+
+/**
+ * Command class for collisions
+ */
+public class CollisionCommand extends ObserverCommand {
+    private GPSCoordinate startingPosition;
+    private Azimuth azimuth;
+    private double distance;
+
+    /**
+     * Constructor for class
+     * @param race race context
+     * @param boat boat controlled by command
+     */
+    public CollisionCommand(MockRace race, MockBoat boat) {
+        super(race, boat);
+    }
+
+    @Override
+    public void execute() {
+        this.azimuth = Azimuth.fromDegrees(boat.getBearing().degrees() - 180d);
+        this.startingPosition = boat.getPosition();
+        this.distance = 30;
+        boat.setVelocityDefault(false);
+    }
+
+    @Override
+    public void update(Observable o, Object arg) {
+        if(GPSCoordinate.calculateDistanceMeters(boat.getPosition(), startingPosition) < distance) {
+            boat.setPosition(GPSCoordinate.calculateNewPosition(boat.getPosition(), 2, azimuth));
+        } else {
+            race.deleteObserver(this);
+            boat.setVelocityDefault(true);
+        }
+    }
+}

racevisionGame/src/main/java/mock/model/commandFactory/Command.java

@@ -3,6 +3,8 @@ package mock.model.commandFactory;
 import mock.model.MockBoat;
 import mock.model.MockRace;
 
+import java.util.Observer;
+
 /**
  * Allows RaceLogic to control MockRace state according to the Command pattern
  */

racevisionGame/src/main/java/mock/model/commandFactory/ObserverCommand.java

@@ -0,0 +1,20 @@
+package mock.model.commandFactory;
+
+import mock.model.MockBoat;
+import mock.model.MockRace;
+
+import java.util.Observer;
+
+/**
+ * Command that can observe the race
+ */
+public abstract class ObserverCommand implements Command, Observer {
+    MockRace race;
+    MockBoat boat;
+
+    public ObserverCommand(MockRace race, MockBoat boat) {
+        this.race = race;
+        this.boat = boat;
+        boat.setAutoVMG(false);
+    }
+}

racevisionGame/src/main/java/mock/model/commandFactory/SailsCommand.java

@@ -2,20 +2,50 @@ package mock.model.commandFactory;
 
 import mock.model.MockBoat;
 import mock.model.MockRace;
+import mock.model.NewPolars;
+import mock.model.VMG;
 
-public class SailsCommand implements Command {
-    private MockRace race;
-    private MockBoat boat;
+import java.util.Observable;
+
+public class SailsCommand extends ObserverCommand {
     private boolean sailsOut;
+    private double goalVelocity;
 
-    public SailsCommand(MockRace race, MockBoat boat, Boolean sailsOut) {
-        this.race = race;
-        this.boat = boat;
+    public SailsCommand(MockRace race, MockBoat boat, boolean sailsOut) {
+        super(race, boat);
+        race.addVelocityCommand(this);
         this.sailsOut = sailsOut;
     }
 
     @Override
     public void execute() {
         this.boat.setSailsOut(this.sailsOut);
+        boat.setVelocityDefault(false);
+
+        if(sailsOut) {
+            // Accelerate to VMG speed
+            double polarSpeed = NewPolars.calculateSpeed(race.getWindDirection(), race.getWindSpeed(), boat.getBearing());
+            VMG vmg = new VMG(polarSpeed, boat.getBearing());
+            goalVelocity = vmg.getSpeed();
+        } else {
+            // Decelerate to 0
+            goalVelocity = 0;
+        }
+    }
+
+    @Override
+    public void update(Observable o, Object arg) {
+        double acceleration = 0.5;
+
+        if(sailsOut && boat.getCurrentSpeed() < goalVelocity) {
+            boat.setCurrentSpeed(Math.min(goalVelocity, boat.getCurrentSpeed() + acceleration));
+        } else if (!sailsOut && boat.getCurrentSpeed() > goalVelocity) {
+            // Apply deceleration to strictly 0 speed
+            boat.setCurrentSpeed(Math.max(0, boat.getCurrentSpeed() - acceleration));
+        } else {
+            // Release boat from SailsCommand control
+            if(sailsOut) boat.setVelocityDefault(true);
+            race.deleteObserver(this);
+        }
     }
 }

racevisionGame/src/main/java/mock/model/commandFactory/TackGybeCommand.java

@@ -4,12 +4,16 @@ import mock.model.MockBoat;
 import mock.model.MockRace;
 import shared.model.Bearing;
 
+import java.util.Observable;
+
 /**
  * Command class for tacking and gybing
  */
-public class TackGybeCommand implements Command {
-    private MockRace race;
-    private MockBoat boat;
+public class TackGybeCommand extends ObserverCommand {
+    private double goalRotation;
+    private double totalRotation = 0;
+    private int direction;  // -1 for anticlockwise, 1 for clockwise
+    private double goalAngle;
 
     /**
      * Constructor for class
@@ -17,24 +21,32 @@ public class TackGybeCommand implements Command {
      * @param boat mock boat to update
      */
     public TackGybeCommand(MockRace race, MockBoat boat) {
-        this.race = race;
-        this.boat = boat;
+        super(race, boat);
+        race.addAngularCommand(this);
     }
 
     @Override
     public void execute() {
-
-        boat.setAutoVMG(false);
-
         double boatAngle = boat.getBearing().degrees();
         double windAngle = race.getWindDirection().degrees();
         double differenceAngle = calcDistance(boatAngle, windAngle);
         double angleA = windAngle + differenceAngle;
         double angleB = windAngle - differenceAngle;
         if (angleA % 360 == boatAngle) {
-            boat.setBearing(Bearing.fromDegrees(angleB));
+            goalAngle = angleB % 360;
         } else {
-            boat.setBearing(Bearing.fromDegrees(angleA));
+            goalAngle = angleA % 360;
+        }
+
+        goalRotation = goalAngle - boatAngle;
+        if (goalRotation < 0) {
+            goalRotation += 360;
+        }
+        if (goalRotation > 180) {
+            goalRotation = 360 - goalRotation;
+            direction = -1;
+        } else {
+            direction = 1;
         }
     }
 
@@ -49,5 +61,16 @@ public class TackGybeCommand implements Command {
         return phi > 180 ? 360 - phi : phi;
     }
 
+    @Override
+    public void update(Observable o, Object arg) {
+        double offset = 3.0;
+        if (totalRotation < goalRotation) {
+            boat.setBearing(Bearing.fromDegrees(boat.getBearing().degrees() + offset * direction));
+            totalRotation += offset;
+        } else {
+            boat.setBearing(Bearing.fromDegrees(goalAngle));
+            race.deleteObserver(this);
+        }
+    }
 }
 

racevisionGame/src/main/java/mock/model/commandFactory/VMGCommand.java

@@ -2,13 +2,20 @@ package mock.model.commandFactory;
 
 import mock.model.MockBoat;
 import mock.model.MockRace;
+import mock.model.NewPolars;
+import mock.model.VMG;
+import shared.model.Bearing;
+
+import java.util.Observable;
 
 /**
  * Command class for autoVMG
  */
-public class VMGCommand implements Command {
-    private MockRace race;
-    private MockBoat boat;
+public class VMGCommand extends ObserverCommand {
+    private double goalAngle;
+    private double goalRotation;
+    private double totalRotation = 0;
+    private int direction;
 
     /**
      * Constructor for class
@@ -16,8 +23,8 @@ public class VMGCommand implements Command {
      * @param boat mock boat to update
      */
     public VMGCommand(MockRace race, MockBoat boat) {
-        this.race = race;
-        this.boat = boat;
+        super(race, boat);
+        race.addAngularCommand(this);
     }
 
     @Override
@@ -27,5 +34,37 @@ public class VMGCommand implements Command {
         } else {
             boat.setAutoVMG(true);
         }
+        newOptimalVMG(boat);
+
+        goalRotation = goalAngle - boat.getBearing().degrees();
+        if (goalRotation < 0) {
+            goalRotation += 360;
+        }
+        if (goalRotation > 180) {
+            goalRotation = 360 - goalRotation;
+            direction = -1;
+        } else {
+            direction = 1;
+        }
+    }
+
+    private void newOptimalVMG(MockBoat boat) {
+        long tackPeriod = 1000;
+        if (boat.getTimeSinceTackChange() > tackPeriod) {
+            VMG newVMG = NewPolars.setBestVMG(race.getWindDirection(), race.getWindSpeed(), boat.getBearing());
+            goalAngle = newVMG.getBearing().degrees();
+        }
+    }
+
+    @Override
+    public void update(Observable o, Object arg) {
+        double offset = 3.0;
+        if (totalRotation < goalRotation) {
+            boat.setBearing(Bearing.fromDegrees(boat.getBearing().degrees() + offset * direction));
+            totalRotation += offset;
+        } else {
+            boat.setBearing(Bearing.fromDegrees(goalAngle));
+            race.deleteObserver(this);
+        }
     }
 }

racevisionGame/src/main/java/mock/model/commandFactory/WindCommand.java

@@ -4,17 +4,23 @@ import mock.model.MockBoat;
 import mock.model.MockRace;
 import shared.model.Bearing;
 
+import java.util.Observable;
+
 /**
- * Created by connortaylorbrown on 4/08/17.
+ * Command class for upwind and downwind controls
  */
-public class WindCommand implements Command {
-    private MockRace race;
-    private MockBoat boat;
+public class WindCommand extends ObserverCommand {
     private int direction;
 
+    /**
+     * Constructor for class
+     * @param race race context
+     * @param boat boat controlled by command
+     * @param upwind if true, downwind if false
+     */
     public WindCommand(MockRace race, MockBoat boat, boolean upwind) {
-        this.race = race;
-        this.boat = boat;
+        super(race, boat);
+        race.addAngularCommand(this);
         this.direction = upwind? -1 : 1;
     }
 
@@ -34,4 +40,9 @@ public class WindCommand implements Command {
 
         boat.setBearing(Bearing.fromDegrees(heading + offset));
     }
+
+    @Override
+    public void update(Observable o, Object arg) {
+        race.deleteObserver(this);
+    }
 }

racevisionGame/src/main/java/mock/model/wind/ShiftingWindGenerator.java

@@ -105,7 +105,6 @@ public class ShiftingWindGenerator implements WindGenerator {
             if (shiftedSoFar >= 180){
                 shiftAnticlockwise = Math.random() > 0.5;
                 shiftedSoFar = 0;
-//                System.out.println("Swapping");
             }
 
             timeOfLastShift = System.currentTimeMillis();

racevisionGame/src/main/java/network/PacketDump/AC35DumpReader.java

@@ -41,7 +41,6 @@ public class AC35DumpReader {
             messLen[1] = dump[pointer + 13];
             messLen[0] = dump[pointer + 14];
             int messageLength = ByteBuffer.wrap(messLen).getShort();
-            //System.out.println(messageLength);
 
             packets.add(new AC35Packet(Arrays.copyOfRange(dump, pointer, pointer + messageLength + 19)));
 

racevisionGame/src/main/java/shared/model/Boat.java

@@ -403,10 +403,6 @@ public class Boat extends Collider {
     public boolean isSailsOut() {
         return sailsOut;
     }
-    public void bounce(double repulsionRadius) {
-        Azimuth reverseAzimuth = Azimuth.fromDegrees(getBearing().degrees() - 180d);
-        setPosition(GPSCoordinate.calculateNewPosition(getPosition(), 2 * repulsionRadius, reverseAzimuth));
-    }
 
     @Override
     public boolean rayCast(Boat boat) {
@@ -416,9 +412,11 @@ public class Boat extends Collider {
     }
 
     @Override
-    public void onCollisionEnter(Boat collider, Collision e) {
+    public void onCollisionEnter(Collision e) {
         if(e.getBearing().degrees() > 270 || e.getBearing().degrees() < 90) {
-            collider.bounce(100);
+            // Notify observers of collision
+            this.setChanged();
+            notifyObservers(e);
         }
     }
 }

racevisionGame/src/main/java/shared/model/Constants.java

@@ -5,7 +5,6 @@ package shared.model;
  * Created by Erika on 19-Mar-17.
  */
 public class Constants {
-
     /**
     * Multiply by this factor to convert nautical miles to meters.
     * <br>
@@ -15,8 +14,6 @@ public class Constants {
     */
     public static final int NMToMetersConversion = 1852;
 
-
-
     /**
     * Multiply by this factor to convert Knots to millimeters per second.
      * <br>
@@ -26,8 +23,6 @@ public class Constants {
     */
     public static final double KnotsToMMPerSecond = 514.444;
 
-
-
     /**
      * The scale factor of the race.
      * Frame periods are multiplied by this to get the amount of time a single frame represents.
@@ -36,23 +31,15 @@ public class Constants {
     public static final int RaceTimeScale = 2;//10;
 
     /**
-     * The race pre-start time, in milliseconds. 3 minutes (30 seconds for development).
+     * The race pre-start time, in milliseconds. 3 minutes.
      */
-//    public static final long RacePreStartTime = 30 * 1000;
-    public static final long RacePreStartTime = 1000;
-
+    public static final long RacePreStartTime = 3 * 60 * 1000;
 
     /**
      * The race preparatory time, in milliseconds. 1 minute.
      */
-//    public static final long RacePreparatoryTime = 60 * 1000;
     public static final long RacePreparatoryTime = 1 * 60 * 1000;
 
-
-
-
-
-
     /**
      * The number of milliseconds in one hour.
      * <br>
@@ -70,7 +57,4 @@ public class Constants {
      * Divide by this factor to convert hours to seconds.
      */
     public static long OneHourSeconds = 1 * 60 * 60;
-
-
-
 }

racevisionGame/src/main/java/shared/model/Mark.java

@@ -101,7 +101,8 @@ public class Mark extends Collider{
     }
 
     @Override
-    public void onCollisionEnter(Boat collider, Collision e) {
-        collider.bounce(repulsionRadius);
+    public void onCollisionEnter(Collision e) {
+        this.setChanged();
+        notifyObservers(e);
     }
 }

racevisionGame/src/main/java/shared/model/RaceState.java

@@ -13,6 +13,7 @@ import shared.dataInput.RegattaDataSource;
 import java.time.ZonedDateTime;
 import java.util.ArrayList;
 import java.util.List;
+import java.util.Observable;
 
 
 /**
@@ -20,7 +21,7 @@ import java.util.List;
  * This is a base class inherited by {@link mock.model.MockRace} and {@link visualiser.model.VisualiserRaceState}.
  * Has a course, state, wind, boundaries, etc.... Boats are added by inheriting classes (see {@link Boat}, {@link mock.model.MockBoat}, {@link visualiser.model.VisualiserBoat}.
  */
-public abstract class RaceState {
+public abstract class RaceState extends Observable{
 
 
 

racevisionGame/src/main/java/visualiser/gameController/InputChecker.java

@@ -27,7 +27,6 @@ public class InputChecker {
                 ControlKey controlKey = keyFactory.getKey(codeString);
                 if (controlKey != null) {
                     controlKey.onAction();
-//                    System.out.println(controlKey.toString() + " is Pressed.");
                 }
                 currentlyActiveKeys.put(codeString, true);
             }
@@ -38,7 +37,6 @@ public class InputChecker {
             ControlKey controlKey = keyFactory.getKey(codeString);
             if (controlKey != null) {
                 controlKey.onRelease();
-//                System.out.println(controlKey.toString() + " is Released.");
             }
             currentlyActiveKeys.remove(event.getCode().toString());
         });
@@ -50,15 +48,8 @@ public class InputChecker {
                     ControlKey controlKey = keyFactory.getKey(key);
                     if (controlKey != null){
                         controlKey.onHold();
-//                        System.out.println(controlKey.toString() + " is Held.");
                     }
                 }
-//                for (String key : InputKeys.stringKeysMap.keySet()){
-//                    if (removeActiveKey(key)) {
-//                        System.out.println(key);
-//                    }
-//                }
-
             }
         }.start();
     }

racevisionGame/src/test/java/shared/model/BearingTest.java

@@ -1,5 +0,0 @@
-package shared.model;
-
-public class BearingTest {
-//TODO
-}