Merge branch 'master' into network_on_VPS

racevisionGame/src/main/java/mock/app/Event.java

@@ -219,7 +219,6 @@ public class Event {
 
         long millisecondsToAdd = racePreStartTime + racePreparatoryTime;
 
-
         long secondsToAdd = millisecondsToAdd / 1000;
 
         DateTimeFormatter dateFormat = DateTimeFormatter.ofPattern("yyyy-MM-dd'T'HH:mm:ssZ");

racevisionGame/src/main/java/mock/model/MockRace.java

@@ -366,10 +366,8 @@ public class MockRace extends RaceState {
         //Checks if the current boat has finished the race or not.
         boolean finish = this.isLastLeg(boat.getCurrentLeg());
 
-        if (!finish && totalElapsedMilliseconds >= updatePeriodMilliseconds) {
+        if (!finish && totalElapsedMilliseconds >= updatePeriodMilliseconds && !boat.isColliding()) {
-
             if(boat.isVelocityDefault()) setBoatSpeed(boat);
-
             //Calculates the distance travelled, in meters, in the current timeslice.
             double distanceTravelledMeters = boat.calculateMetersTravelled(updatePeriodMilliseconds) * this.scaleFactor;
 

racevisionGame/src/main/java/mock/model/RaceLogic.java

@@ -12,6 +12,7 @@ import network.Messages.Enums.RaceStatusEnum;
 import network.Messages.LatestMessages;
 import shared.model.RunnableWithFramePeriod;
 
+import java.util.ArrayList;
 import java.util.Observable;
 import java.util.Observer;
 
@@ -90,7 +91,7 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
             server.parseSnapshot();
 
 
-            waitForFramePeriod(previousFrameTime, currentTime, 50);
+            waitForFramePeriod(previousFrameTime, currentTime, 16);
             previousFrameTime = currentTime;
         }
     }
@@ -127,7 +128,7 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
                 race.setBoatsStatusToRacing();
             }
 
-            waitForFramePeriod(previousFrameTime, currentTime, 50);
+            waitForFramePeriod(previousFrameTime, currentTime, 16);
             previousFrameTime = currentTime;
 
         }
@@ -139,6 +140,8 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
      */
     private void raceLoop() {
 
+        ArrayList<MockBoat> collisionBoats = new ArrayList<>();
+
         long previousFrameTime = System.currentTimeMillis();
 
         while (race.getRaceStatusEnum() != RaceStatusEnum.FINISHED && loopBool) {
@@ -168,9 +171,17 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
                     //If it is still racing, update its position.
                     if (boat.getStatus() == BoatStatusEnum.RACING) {
                         race.updatePosition(boat, framePeriod, race.getRaceClock().getDurationMilli());
-                        race.getColliderRegistry().rayCast(boat);
+
+                        if(race.getColliderRegistry().rayCast(boat)){
+                            //System.out.println("Collision!");
+                            //Add boat to list
+                            collisionBoats.add(boat);
+                        }
+
+                        //System.out.println(race.getColliderRegistry().rayCast(boat));
                     }
 
+
                 }
 
             } else {
@@ -183,14 +194,19 @@ public class RaceLogic implements RunnableWithFramePeriod, Observer {
                 // Change wind direction
                 race.changeWindDirection();
 
+                //Pass collision boats in
+                server.parseBoatCollisions(collisionBoats);
+
                 //Parse the race snapshot.
                 server.parseSnapshot();
 
+                collisionBoats.clear();
+
                 //Update the last frame time.
                 previousFrameTime = currentTime;
             }
 
-            waitForFramePeriod(previousFrameTime, currentTime, 50);
+            waitForFramePeriod(previousFrameTime, currentTime, 16);
             previousFrameTime = currentTime;
         }
     }

racevisionGame/src/main/java/mock/model/RaceServer.java

@@ -3,6 +3,7 @@ package mock.model;
 import network.AckSequencer;
 import network.Messages.*;
 import network.Messages.Enums.BoatLocationDeviceEnum;
+import network.Messages.Enums.YachtEventEnum;
 import network.Messages.Enums.XMLMessageType;
 import shared.model.Bearing;
 import shared.model.CompoundMark;
@@ -24,6 +25,7 @@ public class RaceServer {
     private MockRace race;
     private LatestMessages latestMessages;
     private static RaceServer server;
+    private List<YachtEvent> collisionEvents = new ArrayList<>();
 
 
     /**
@@ -75,9 +77,19 @@ public class RaceServer {
         //Parse the race status.
         snapshotMessages.add(parseRaceStatus());
 
+        //Parse collisions
+        if(collisionEvents.size()>0){
+            snapshotMessages.addAll(collisionEvents);
+        }
+
         latestMessages.setSnapshot(snapshotMessages);
 
         updateXMLFiles();
+
+        //Reset collision list
+        collisionEvents.clear();
+        //System.out.println(collisionEvents.size());
+
     }
 
     /**
@@ -314,4 +326,28 @@ public class RaceServer {
 
         return message;
     }
+
+    /**
+     * Parse the yacht event and return it
+     * @param boat yacht with event
+     * @param event event that happened
+     * @return yacht event
+     */
+    private YachtEvent parseYachtEvent(MockBoat boat, YachtEventEnum event){
+        YachtEvent yachtEvent = new YachtEvent(
+                System.currentTimeMillis(),
+                this.boatLocationSequenceNumber,
+                race.getRaceId(),
+                boat.getSourceID(),
+                1337,
+                event);
+        return yachtEvent;
+    }
+
+    public void parseBoatCollisions(ArrayList<MockBoat> boats){
+        for (MockBoat boat : boats){
+            collisionEvents.add(parseYachtEvent(boat, YachtEventEnum.COLLISION));
+        }
+    }
+
 }

racevisionGame/src/main/java/mock/model/collider/Collider.java

@@ -24,7 +24,8 @@ public abstract class Collider extends Observable implements Locatable {
         // Direction of collider from heading
         Bearing relative = Bearing.fromDegrees(absolute.degrees() - boat.getBearing().degrees());
 
-        if(actualDistance <= distance) {
+        if(!boat.isColliding() && actualDistance <= distance) {
+            boat.setColliding(true);
             Collision collision = new Collision(boat, relative, distance);
             // Notify object of collision
             onCollisionEnter(collision);

racevisionGame/src/main/java/mock/model/commandFactory/CollisionCommand.java

@@ -29,17 +29,18 @@ public class CollisionCommand extends ObserverCommand {
     public void execute() {
         this.azimuth = Azimuth.fromDegrees(boat.getBearing().degrees() - 180d);
         this.startingPosition = boat.getPosition();
-        this.distance = 30;
+        this.distance = 60;
         boat.setVelocityDefault(false);
     }
 
     @Override
     public void update(Observable o, Object arg) {
         if(GPSCoordinate.calculateDistanceMeters(boat.getPosition(), startingPosition) < distance) {
-            boat.setPosition(GPSCoordinate.calculateNewPosition(boat.getPosition(), 2, azimuth));
+            boat.setPosition(GPSCoordinate.calculateNewPosition(boat.getPosition(), 3, azimuth));
         } else {
             race.deleteObserver(this);
             boat.setVelocityDefault(true);
+            boat.setColliding(false);
         }
     }
 }

racevisionGame/src/main/java/mock/model/commandFactory/CompositeCommand.java

@@ -1,7 +1,7 @@
 package mock.model.commandFactory;
 
-import java.util.ArrayDeque;
 import java.util.Queue;
+import java.util.concurrent.ConcurrentLinkedDeque;
 
 /**
  * Wraps multiple commands into a composite to execute queued commands during a frame.
@@ -10,15 +10,15 @@ public class CompositeCommand implements Command {
     private Queue<Command> commands;
 
     public CompositeCommand() {
-        this.commands = new ArrayDeque<>();
+        this.commands = new ConcurrentLinkedDeque<>();
     }
 
     public void addCommand(Command command) {
-        commands.add(command);
+        commands.offer(command);
     }
 
     @Override
     public void execute() {
-        while(!commands.isEmpty()) commands.remove().execute();
+        while(commands.peek() != null) commands.poll().execute();
     }
 }

racevisionGame/src/main/java/mock/xml/RaceXMLCreator.java

@@ -103,7 +103,6 @@ public class RaceXMLCreator {
         }
     }
 
-
     /**
      * Rotate the features in a race such as the boundary, and the marks.
      * @param race the race to alter

racevisionGame/src/main/java/shared/model/Boat.java

@@ -98,6 +98,11 @@ public class Boat extends Collider {
      */
     private boolean sailsOut = true;
 
+    /**
+     * Indicates whether boat is currently involved in a collision
+     */
+    private boolean isColliding = false;
+
     /**
      * Constructs a boat object with a given sourceID, name, country/team abbreviation, and polars table.
      *
@@ -407,7 +412,7 @@ public class Boat extends Collider {
     @Override
     public boolean rayCast(Boat boat) {
         if(boat != this) {
-            return rayCast(boat, 100);
+            return rayCast(boat, 15);
         } else return false;
     }
 
@@ -419,4 +424,12 @@ public class Boat extends Collider {
             notifyObservers(e);
         }
     }
+
+    public boolean isColliding() {
+        return isColliding;
+    }
+
+    public void setColliding(boolean colliding) {
+        isColliding = colliding;
+    }
 }

racevisionGame/src/main/java/shared/model/Constants.java

@@ -28,7 +28,7 @@ public class Constants {
      * Frame periods are multiplied by this to get the amount of time a single frame represents.
      * E.g., frame period = 20ms, scale = 5, frame represents 20 * 5 = 100ms, and so boats are simulated for 100ms, even though only 20ms actually occurred.
      */
-    public static final int RaceTimeScale = 10;
+    public static final int RaceTimeScale = 2;
 
     /**
      * The race pre-start time, in milliseconds. 30 seconds.

racevisionGame/src/main/java/shared/model/Mark.java

@@ -29,11 +29,6 @@ public class Mark extends Collider{
      */
     private GPSCoordinate position;
 
-    /**
-     * Repulsion radius of the mark
-     */
-    private double repulsionRadius = 50;
-
     /**
      * Constructs a mark with a given source ID, name, and position.
      * @param sourceID The source ID of the mark.
@@ -97,7 +92,7 @@ public class Mark extends Collider{
 
     @Override
     public boolean rayCast(Boat boat) {
-        return rayCast(boat, repulsionRadius);
+        return rayCast(boat, 15);
     }
 
     @Override

racevisionGame/src/main/java/visualiser/Commands/VisualiserRaceCommands/BoatCollisionCommand.java

@@ -0,0 +1,46 @@
+package visualiser.Commands.VisualiserRaceCommands;
+
+import javafx.scene.media.AudioClip;
+import mock.model.commandFactory.Command;
+import network.Messages.YachtEvent;
+import shared.exceptions.BoatNotFoundException;
+import visualiser.model.VisualiserBoat;
+import visualiser.model.VisualiserRaceState;
+
+/**
+ * Created by zwu18 on 4/09/17.
+ */
+public class BoatCollisionCommand implements Command {
+
+    YachtEvent yachtEvent;
+
+    VisualiserRaceState visualiserRace;
+
+    public BoatCollisionCommand(YachtEvent yachtEvent, VisualiserRaceState visualiserRace){
+        this.yachtEvent = yachtEvent;
+        this.visualiserRace = visualiserRace;
+
+    }
+
+    @Override
+    public void execute() {
+
+        if(visualiserRace.getPlayerBoatID()==yachtEvent.getSourceID()){
+            //System.out.println("I crashed!");
+            AudioClip sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/collision.wav").toExternalForm());
+            sound.play();
+
+        } else {
+            //System.out.println("Someone else crashed!");
+            AudioClip sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/quietcollision.wav").toExternalForm());
+            sound.play();
+        }
+
+        try {
+            VisualiserBoat boat = visualiserRace.getBoat(yachtEvent.getSourceID());
+            boat.setHasCollided(true);
+        } catch (BoatNotFoundException e) {
+            e.printStackTrace();
+        }
+    }
+}

racevisionGame/src/main/java/visualiser/Commands/VisualiserRaceCommands/RaceStatusCommand.java

@@ -1,5 +1,6 @@
 package visualiser.Commands.VisualiserRaceCommands;
 
+import javafx.scene.media.AudioClip;
 import mock.model.commandFactory.Command;
 import network.Messages.BoatStatus;
 import network.Messages.Enums.BoatStatusEnum;
@@ -176,6 +177,10 @@ public class RaceStatusCommand implements Command {
         //Record order in which boat finished leg.
         visualiserRace.getLegCompletionOrder().get(boat.getCurrentLeg()).add(boat);
 
+        //play sound
+        AudioClip sound = new AudioClip(getClass().getResource("/visualiser/sounds/passmark.wav").toExternalForm());
+        sound.play();
+
         //Update boat.
         boat.setCurrentLeg(leg);
         boat.setTimeAtLastMark(visualiserRace.getRaceClock().getCurrentTime());

racevisionGame/src/main/java/visualiser/Commands/VisualiserRaceCommands/VisualiserRaceCommandFactory.java

@@ -23,7 +23,9 @@ public class VisualiserRaceCommandFactory {
 
         switch (message.getType()) {
 
-            case BOATLOCATION: return new BoatLocationCommand((BoatLocation) message, visualiserRace);
+            case BOATLOCATION:
+                //System.out.println("Boat location received");
+                return new BoatLocationCommand((BoatLocation) message, visualiserRace);
 
             case RACESTATUS: return new RaceStatusCommand((RaceStatus) message, visualiserRace);
 
@@ -31,6 +33,11 @@ public class VisualiserRaceCommandFactory {
 
             case ASSIGN_PLAYER_BOAT: return new AssignPlayerBoatCommand((AssignPlayerBoat) message, visualiserRace);
 
+            case YACHTEVENTCODE:
+                return new BoatCollisionCommand((YachtEvent) message, visualiserRace);
+
+
+
             default: throw new CommandConstructionException("Could not create VisualiserRaceCommand. Unrecognised or unsupported MessageType: " + message.getType());
 
         }

racevisionGame/src/main/java/visualiser/Controllers/InGameLobbyController.java

@@ -15,6 +15,7 @@ import javafx.scene.control.Label;
 import javafx.scene.image.ImageView;
 import javafx.scene.layout.AnchorPane;
 import javafx.scene.layout.GridPane;
+import javafx.scene.paint.PhongMaterial;
 import javafx.scene.shape.MeshView;
 import mock.app.Event;
 import network.Messages.Enums.RaceStatusEnum;
@@ -138,11 +139,15 @@ public class InGameLobbyController extends Controller {
                                         playerContainer.add(playerBoatToSet, (count % 3) , row);
                                         playerContainer.setMargin(playerBoatToSet, new Insets(10, 10, 10, 10));
 
-                                        SeaSurface sea = new SeaSurface(750, 200, 250, 0, 210);
+                                        SeaSurface sea = new SeaSurface(750, 200);
-                                        subjects.add(sea.getSurface());
+                                        sea.setX(250);
+                                        sea.setZ(210);
+                                        subjects.add(sea);
 
                                         MeshView mesh = new MeshView(importer.getImport());
-                                        Subject3D subject = new Subject3D(mesh);
+                                        PhongMaterial boatColorMat = new PhongMaterial(boat.getColor());
+                                        mesh.setMaterial(boatColorMat);
+                                        Subject3D subject = new Subject3D(mesh,0);
                                         subjects.add(subject);
 
                                         playerBoatToSet.setDistance(50);
@@ -159,7 +164,7 @@ public class InGameLobbyController extends Controller {
                                         };
                                         rotate.start();
 
-                                        allPlayerLabels.get(count).setText("Player: " + boat.getSourceID());
+                                        allPlayerLabels.get(count).setText(boat.getName());
                                         allPlayerLabels.get(count).toFront();
                                         count += 1;
                                         if (count > 2){
@@ -250,7 +255,7 @@ public class InGameLobbyController extends Controller {
                         visualiserRaceEvent.getVisualiserRaceState().getBoats().removeListener(lobbyUpdateListener);
 
                         RaceViewController rvc = (RaceViewController)
-                                loadScene("raceView.fxml");
+                                loadScene("newRaceView.fxml");
                         rvc.startRace(visualiserRaceEvent, controllerClient,
                                 isHost);
                     } catch (IOException e) {

racevisionGame/src/main/java/visualiser/Controllers/LobbyController.java

@@ -7,6 +7,8 @@ import javafx.scene.control.Button;
 import javafx.scene.control.TableColumn;
 import javafx.scene.control.TableView;
 import javafx.scene.control.TextField;
+import javafx.scene.layout.AnchorPane;
+import javafx.scene.media.AudioClip;
 import network.Messages.HostGame;
 import visualiser.app.MatchBrowserSingleton;
 import visualiser.model.RaceConnection;
@@ -34,6 +36,8 @@ public class LobbyController extends Controller {
     private ObservableList<RaceConnection> connections;
     private ObservableList<RaceConnection> customConnections;
 
+    private AudioClip sound;
+
     //the socket for match browser
     private DatagramSocket udpSocket;
     private MatchBrowserLobbyInterface matchBrowserLobbyInterface;
@@ -67,6 +71,8 @@ public class LobbyController extends Controller {
      * Refreshes the connections in the lobby
      */
     public void refreshBtnPressed(){
+        sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
+        sound.play();
         addServerGames();
         for(RaceConnection connection: connections) {
             connection.check();
@@ -92,6 +98,8 @@ public class LobbyController extends Controller {
     }
 
     public void menuBtnPressed() throws IOException {
+        sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
+        sound.play();
         matchBrowserLobbyInterface.closeSocket();
         loadScene("title.fxml");
     }
@@ -100,6 +108,8 @@ public class LobbyController extends Controller {
      * adds a new connection
      */
     public void addConnectionPressed(){
+        sound = new AudioClip(this.getClass().getResource("/visualiser/sounds/buttonpress.wav").toExternalForm());
+        sound.play();
         String hostName = addressFld.getText();
         String portString = portFld.getText();
         try {

racevisionGame/src/main/java/visualiser/Controllers/RaceViewController.java

@@ -8,27 +8,32 @@ import javafx.collections.ListChangeListener;
 import javafx.collections.ObservableList;
 import javafx.collections.transformation.SortedList;
 import javafx.fxml.FXML;
+import javafx.scene.AmbientLight;
+import javafx.scene.PointLight;
 import javafx.scene.chart.LineChart;
 import javafx.scene.control.*;
 import javafx.scene.input.KeyCode;
 import javafx.scene.input.KeyEvent;
+import javafx.scene.layout.AnchorPane;
 import javafx.scene.layout.GridPane;
 import javafx.scene.layout.StackPane;
+import javafx.scene.paint.Color;
+import javafx.scene.paint.Material;
+import javafx.scene.paint.PhongMaterial;
 import javafx.scene.shape.MeshView;
-import javafx.scene.shape.Sphere;
+import javafx.scene.shape.Shape3D;
 import javafx.scene.transform.Translate;
 import javafx.util.Callback;
 import network.Messages.Enums.RaceStatusEnum;
 import shared.dataInput.RaceDataSource;
-import shared.model.Leg;
+import shared.exceptions.BoatNotFoundException;
-import shared.model.Mark;
+import shared.model.*;
 import visualiser.app.App;
 import visualiser.enums.TutorialState;
 import visualiser.gameController.ControllerClient;
 import visualiser.gameController.Keys.ControlKey;
 import visualiser.gameController.Keys.KeyFactory;
-import visualiser.layout.Subject3D;
+import visualiser.layout.*;
-import visualiser.layout.View3D;
 import visualiser.model.Sparkline;
 import visualiser.model.VisualiserBoat;
 import visualiser.model.VisualiserRaceEvent;
@@ -61,6 +66,15 @@ public class RaceViewController extends Controller {
     private View3D view3D;
     private ObservableList<Subject3D> viewSubjects;
 
+    /**
+     * Arrow pointing to next mark in third person
+     */
+    private Subject3D nextMarkArrow;
+    /**
+     * Animation loop for rotating mark arrow
+     */
+    private AnimationTimer pointToMark;
+
     // note: it says it's not used but it is! do not remove :)
     private @FXML ArrowController arrowController;
     private @FXML GridPane canvasBase;
@@ -77,6 +91,8 @@ public class RaceViewController extends Controller {
     private @FXML TableColumn<VisualiserBoat, Number> boatSpeedColumn;
     private @FXML LineChart<Number, Number> sparklineChart;
     private @FXML Label tutorialText;
+    private @FXML AnchorPane infoWrapper;
+    private @FXML AnchorPane lineChartWrapper;
 
     /**
      * Displays a specified race.
@@ -121,9 +137,8 @@ public class RaceViewController extends Controller {
         }
     }
 
-    /**
+    private AnimationTimer arrowToNextMark;
-     * Sets up the listener and actions that occur when a key is pressed.
+
-     */
     private void initKeypressHandler() {
         racePane.addEventFilter(KeyEvent.KEY_PRESSED, event -> {
             String codeString = event.getCode().toString();
@@ -189,10 +204,23 @@ public class RaceViewController extends Controller {
      * Initialises the various UI components to listen to the {@link #visualiserRace}.
      */
     private void initialiseRaceVisuals() {
+
+        // Import arrow mesh
+        URL asset = this.getClass().getClassLoader().getResource("assets/arrow V1.0.4.stl");
+        StlMeshImporter importer = new StlMeshImporter();
+        importer.read(asset);
+
+        MeshView arrow = new MeshView(importer.getImport());
+        PhongMaterial arrowMat = new PhongMaterial(Color.RED);
+        arrow.setMaterial(arrowMat);
+
+        this.nextMarkArrow = new Annotation3D(arrow);
+        this.nextMarkArrow.setScale(0.1);
+
         // initialise displays
         initialiseFps();
         initialiseInfoTable();
-        initialiseView3D();
+        initialiseView3D(this.visualiserRace);
         initialiseRaceClock();
         raceTimer();    // start the timer
         new Sparkline(this.raceState, this.sparklineChart);
@@ -200,55 +228,124 @@ public class RaceViewController extends Controller {
         arrowController.setWindProperty(this.raceState.windProperty());
     }
 
-    private void initialiseView3D() {
+    private void initialiseView3D(VisualiserRaceEvent race) {
         viewSubjects = FXCollections.observableArrayList();
 
+        AmbientLight ambientLight = new AmbientLight(Color.web("#CCCCFF"));
+        ambientLight.setTranslateX(250);
+        ambientLight.setTranslateZ(210);
+        ambientLight.setLightOn(true);
+
+        PointLight pointLight = new PointLight(Color.web("#AAAAFF"));
+        pointLight.setTranslateX(250);
+        pointLight.setTranslateZ(210);
+        pointLight.setLightOn(true);
+
         // Import boat mesh
-        URL asset = RaceViewController.class.getClassLoader().getResource("assets/V1.2 " +
+        URL asset = RaceViewController.class.getClassLoader().getResource("assets/V1.2 Complete Boat.stl");
-                "Complete Boat.stl");
         StlMeshImporter importer = new StlMeshImporter();
         importer.read(asset);
 
         // Configure camera angles and control
-        view3D = new View3D();
+        URL markerAsset = RaceViewController.class.getClassLoader().getResource("assets/Bouy V1.1.stl");
+        StlMeshImporter importerMark = new StlMeshImporter();
+        importerMark.read(markerAsset);
+
+        URL alternateBoatAsset = RaceViewController.class.getClassLoader().getResource("assets/V1.3 BurgerBoat.stl");
+        StlMeshImporter importerBurgerBoat = new StlMeshImporter();
+        importerBurgerBoat.read(alternateBoatAsset);
+
+        view3D = new View3D(false);
+        view3D.setItems(viewSubjects);
         view3D.setDistance(1050);
-        view3D.setYaw(0);
+        view3D.setBirdsEye();
-        view3D.setPitch(60);
         view3D.enableTracking();
+        view3D.addAmbientLight(ambientLight);
+        view3D.addPointLight(pointLight);
         canvasBase.add(view3D, 0, 0);
 
         // Set up projection from GPS to view
-        RaceDataSource raceData = raceState.getRaceDataSource();
+        RaceDataSource raceData = visualiserRace.getVisualiserRaceState().getRaceDataSource();
         final GPSConverter gpsConverter = new GPSConverter(raceData, 450, 450);
 
-        view3D.setItems(viewSubjects);
+        SkyBox skyBox = new SkyBox(750, 200, 250, 0, 210);
+        viewSubjects.addAll(skyBox.getSkyBoxPlanes());
+
+        // Set up sea surface
+        SeaSurface sea = new SeaSurface(750, 200);
+        sea.setX(250);
+        sea.setZ(210);
+        viewSubjects.add(sea);
+
+        // Set up sea surface overlay
+        SeaSurface seaOverlay = new SeaSurface(4000, 200);
+        seaOverlay.setX(250);
+        seaOverlay.setZ(210);
+        viewSubjects.add(seaOverlay);
+
+        Boundary3D boundary3D = new Boundary3D(visualiserRace.getVisualiserRaceState().getRaceDataSource().getBoundary(), gpsConverter);
+        for (Subject3D subject3D: boundary3D.getBoundaryNodes()){
+            viewSubjects.add(subject3D);
+        }
         // Position and add each mark to view
-        for (Mark mark : raceState.getMarks()) {
+        for(Mark mark: race.getVisualiserRaceState().getMarks()) {
-            Subject3D subject = new Subject3D(new Sphere(2));
+            MeshView mesh = new MeshView(importerMark.getImport());
-            subject.setX(gpsConverter.convertGPS(mark.getPosition()).getX());
+            Subject3D markModel = new Subject3D(mesh, mark.getSourceID());
-            subject.setZ(gpsConverter.convertGPS(mark.getPosition()).getY());
+
+            markModel.setX(gpsConverter.convertGPS(mark.getPosition()).getX());
+            markModel.setZ(gpsConverter.convertGPS(mark.getPosition()).getY());
 
-            viewSubjects.add(subject);
+            viewSubjects.add(markModel);
         }
         // Position and add each boat to view
-        for (VisualiserBoat boat : raceState.getBoats()) {
+        for(VisualiserBoat boat: race.getVisualiserRaceState().getBoats()) {
-            MeshView mesh = new MeshView(importer.getImport());
+            MeshView mesh;
-            Subject3D subject = new Subject3D(mesh);
+            if(boat.getSourceID() == race.getVisualiserRaceState().getPlayerBoatID()) {
-            viewSubjects.add(subject);
+                mesh = new MeshView(importer.getImport());
+            } else {
+                mesh = new MeshView(importerBurgerBoat.getImport());
+            }
+            PhongMaterial boatColorMat = new PhongMaterial(boat.getColor());
+            mesh.setMaterial(boatColorMat);
+            Subject3D boatModel = new Subject3D(mesh, boat.getSourceID());
+
+            viewSubjects.add(boatModel);
 
             // Track this boat's movement with the new subject
             AnimationTimer trackBoat = new AnimationTimer() {
-                @Override public void handle(long now) {
+                @Override
-                    subject.setHeading(boat.getBearing().degrees());
+                public void handle(long now) {
-                    subject.setX(gpsConverter.convertGPS(boat.getPosition()).getX());
+                    boatModel.setHeading(boat.getBearing().degrees());
-                    subject.setZ(gpsConverter.convertGPS(boat.getPosition()).getY());
+                    boatModel.setX(gpsConverter.convertGPS(boat.getPosition()).getX());
+                    boatModel.setZ(gpsConverter.convertGPS(boat.getPosition()).getY());
                 }
             };
             trackBoat.start();
+
+            Material markColor = new PhongMaterial(new Color(0.15,0.9,0.2,1));
+            CompoundMark nextMark = boat.getCurrentLeg().getEndCompoundMark();
+            view3D.getShape(nextMark.getMark1().getSourceID()).getMesh().setMaterial(markColor);
+            if(nextMark.getMark2() != null) {
+                view3D.getShape(nextMark.getMark2().getSourceID()).getMesh().setMaterial(markColor);
+            }
+            Subject3D shockwave = new Shockwave(10);
+
+            viewSubjects.add(shockwave);
+
+            boat.legProperty().addListener((o, prev, curr) -> Platform.runLater(() -> swapColours(curr)));
+            boat.hasCollidedProperty().addListener((o, prev, curr) -> Platform.runLater(() -> showCollision(boat, shockwave)));
         }
         // Fix initial bird's-eye position
         view3D.updatePivot(new Translate(250, 0, 210));
 
+        view3D.targetProperty().addListener((o, prev, curr)-> {
+            if(curr != null && visualiserRace.getVisualiserRaceState().isVisualiserBoat(curr.getSourceID())) {
+                addThirdPersonAnnotations(curr);
+            } else {
+                removeThirdPersonAnnotations();
+            }
+        });
+
         // Bind zooming to scrolling
         view3D.setOnScroll(e -> {
             view3D.updateDistance(e.getDeltaY());
@@ -257,7 +354,7 @@ public class RaceViewController extends Controller {
         // Bind zooming to keypress (Z/X default)
         racePane.addEventFilter(KeyEvent.KEY_PRESSED, e -> {
             ControlKey key = keyFactory.getKey(e.getCode().toString());
-            if (key != null) {
+            if(key != null) {
                 switch (key.toString()) {
                     case "Zoom In":
                         //Check if race is a tutorial
@@ -294,6 +391,95 @@ public class RaceViewController extends Controller {
         });
     }
 
+    private void showCollision(VisualiserBoat boat, Subject3D shockwave) {
+        Subject3D boatModel = view3D.getShape(boat.getSourceID());
+        AnimationTimer shockFront = new AnimationTimer() {
+            double opacity = 1;
+
+            @Override
+            public void handle(long now) {
+                shockwave.setX(boatModel.getPosition().getX());
+                shockwave.setY(boatModel.getPosition().getY());
+                shockwave.setZ(boatModel.getPosition().getZ());
+
+                if(opacity <= 0) {
+                    shockwave.getMesh().setMaterial(new PhongMaterial(Color.TRANSPARENT));
+                    boat.setHasCollided(false);
+                    this.stop();
+                }
+                else {
+                    shockwave.getMesh().setMaterial(new PhongMaterial(new Color(1,0,0,opacity)));
+                    opacity -= 0.1;
+                }
+            }
+        };
+        shockFront.start();
+    }
+
+    private void addThirdPersonAnnotations(Subject3D subject3D) {
+        viewSubjects.add(nextMarkArrow);
+        final VisualiserBoat boat;
+        try {
+            boat = visualiserRace.getVisualiserRaceState().getBoat(subject3D.getSourceID());
+        } catch (BoatNotFoundException e) {
+            e.printStackTrace();
+            return;
+        }
+        arrowToNextMark = new AnimationTimer() {
+            @Override
+            public void handle(long now) {
+                CompoundMark target = boat.getCurrentLeg().getEndCompoundMark();
+                Bearing headingToMark = GPSCoordinate.calculateBearing(boat.getPosition(), target.getAverageGPSCoordinate());
+
+                nextMarkArrow.setX(view3D.getPivot().getX());
+                nextMarkArrow.setY(view3D.getPivot().getY());
+                nextMarkArrow.setZ(view3D.getPivot().getZ() + 15);
+                nextMarkArrow.setHeading(headingToMark.degrees());
+            }
+        };
+        arrowToNextMark.start();
+    }
+
+    private void removeThirdPersonAnnotations() {
+        viewSubjects.remove(nextMarkArrow);
+        if (arrowToNextMark != null) {
+            arrowToNextMark.stop();
+        }
+
+    }
+
+    /**
+     * Swap the colour of the next mark to pass with the last mark passed
+     * @param leg boat has started on
+     */
+    private void swapColours(Leg leg) {
+        CompoundMark start = leg.getStartCompoundMark();
+        CompoundMark end = leg.getEndCompoundMark();
+
+        //The last leg "finish" doesn't have compound marks.
+        if (start == null || end == null ) {
+            return;
+        }
+
+        Shape3D start1 = view3D.getShape(start.getMark1().getSourceID()).getMesh();
+        Shape3D end1 = view3D.getShape(end.getMark1().getSourceID()).getMesh();
+
+        Material nextMark = start1.getMaterial();
+        Material lastMark = end1.getMaterial();
+
+        start1.setMaterial(lastMark);
+        if(start.getMark2() != null) {
+            Shape3D start2 = view3D.getShape(start.getMark2().getSourceID()).getMesh();
+            start2.setMaterial(lastMark);
+        }
+
+        end1.setMaterial(nextMark);
+        if(end.getMark2() != null) {
+            Shape3D end2 = view3D.getShape(end.getMark2().getSourceID()).getMesh();
+            end2.setMaterial(nextMark);
+        }
+    }
+
     /**
      * Initialises the frame rate functionality. This allows for toggling the
      * frame rate, and connect the fps label to the race's fps property.
@@ -398,6 +584,7 @@ public class RaceViewController extends Controller {
 
     /**
      * Transition from the race view to the finish view.
+     * @throws IOException Thrown if the finish scene cannot be loaded.
      */
     private void finishRace() throws IOException {
         RaceFinishController fc =
@@ -442,23 +629,7 @@ public class RaceViewController extends Controller {
      * toggles if the info table is shown
      */
     private void toggleTable() {
-        double tablePercent = 1 - (boatPlacingColumn.getPrefWidth() +
+        infoWrapper.setVisible(infoTableShow);
-                boatTeamColumn.getPrefWidth() + boatMarkColumn.getPrefWidth()
-                + boatSpeedColumn.getPrefWidth())/racePane.getWidth();
-
-        if (infoTableShow) {
-            racePane.setDividerPositions(tablePercent);
-            arrowPane.setScaleX(0.5);
-            arrowPane.setScaleY(0.5);
-            arrowPane.setTranslateX(0 + (arrowPane.getScene().getWidth()/4)*tablePercent);
-            arrowPane.setTranslateY(0 - arrowPane.getScene().getHeight()/4);
-        } else {
-            racePane.setDividerPositions(1);
-            arrowPane.setScaleX(1);
-            arrowPane.setScaleY(1);
-            arrowPane.setTranslateX(0);
-            arrowPane.setTranslateY(0);
-        }
         boatInfoTable.refresh();
         infoTableShow = !infoTableShow;
     }
@@ -564,4 +735,4 @@ public class RaceViewController extends Controller {
         }
     }
 
-}
+}

racevisionGame/src/main/java/visualiser/Controllers/TitleController.java

@@ -6,11 +6,20 @@ import javafx.scene.control.RadioButton;
 import javafx.scene.image.Image;
 import javafx.scene.image.ImageView;
 import javafx.scene.layout.Pane;
+import javafx.scene.media.AudioClip;
+import javafx.scene.media.Media;
+import javafx.scene.media.MediaPlayer;
 import javafx.stage.Modality;
 import mock.exceptions.EventConstructionException;
 import visualiser.app.App;
 
+import java.io.File;
 import java.io.IOException;
+import java.net.URISyntaxException;
+import java.net.URL;
+import java.util.ResourceBundle;
+import java.util.logging.Level;
+import java.util.logging.Logger;
 
 /**
  * Controller for the opening title window.

racevisionGame/src/main/java/visualiser/gameController/ControllerServer.java

@@ -80,8 +80,9 @@ public class ControllerServer implements RunnableWithFramePeriod {
 
                     try {
                         Command command = CommandFactory.createCommand(raceState, boatAction);
-                        compositeCommand.addCommand(command);
+                        if(command != null) {
-
+                            compositeCommand.addCommand(command);
+                        }
                     } catch (CommandConstructionException e) {
                         Logger.getGlobal().log(Level.WARNING, "ControllerServer could not create a Command for BoatAction: " + boatAction + ".", e);
 

racevisionGame/src/main/java/visualiser/layout/Annotation3D.java

@@ -0,0 +1,24 @@
+package visualiser.layout;
+
+import javafx.scene.shape.Shape3D;
+
+/**
+ * Created by connortaylorbrown on 13/09/17.
+ */
+public class Annotation3D extends Subject3D {
+    /**
+     * Constructor for view subject wrapper
+     *
+     * @param mesh to be rendered
+     */
+    public Annotation3D(Shape3D mesh) {
+        super(mesh, 0);
+    }
+
+    /**
+     * Prevent rescaling of this subject
+     * @param scale ignored
+     */
+    @Override
+    public void setScale(double scale) {}
+}

racevisionGame/src/main/java/visualiser/layout/Boundary3D.java

@@ -0,0 +1,89 @@
+package visualiser.layout;
+
+import com.sun.corba.se.impl.orbutil.graph.Graph;
+import javafx.scene.shape.Box;
+import javafx.scene.shape.MeshView;
+import javafx.scene.shape.Rectangle;
+import javafx.scene.shape.Sphere;
+import shared.model.GPSCoordinate;
+import visualiser.model.GraphCoordinate;
+import visualiser.utils.GPSConverter;
+
+import java.util.ArrayList;
+import java.util.List;
+
+/**
+ * Class that creates a 3d boundary based on gps coordinates
+ */
+public class Boundary3D {
+
+    public static double thickness = 1;
+    private List<Subject3D> boundaryNodes = new ArrayList<>();
+    private List<Subject3D> boundaryConnectors = new ArrayList<>();
+    private GPSConverter gpsConverter;
+
+    public Boundary3D(List<GPSCoordinate> points, GPSConverter gpsConverter){
+        this.gpsConverter = gpsConverter;
+        setBoundaryNodes(points);
+    }
+
+    /**
+     * Splits up the list so that it generates a edge of the boundary
+     * @param points boundary gpscoordinate
+     */
+    private void setBoundaryNodes(List<GPSCoordinate> points){
+        if (points.size() < 2){
+            return;
+        }
+
+        for (int i = 0; i < points.size(); i++){
+            if (i + 1 != points.size()){
+                addBound(points.get(i), points.get(i + 1));
+            } else {
+                addBound(points.get(i), points.get(0));
+            }
+        }
+    }
+
+    /**
+     * Add a two point boundary this will create a sphere at coord1 and a line to coord 2
+     * this is to reduce double up (2 spheres in one point).
+     * @param coord1 point to make sphere and start the line.
+     * @param coord2 point to end the line.
+     */
+    private void addBound(GPSCoordinate coord1, GPSCoordinate coord2){
+        GraphCoordinate graphCoord1 = gpsConverter.convertGPS(coord1);
+        GraphCoordinate graphCoord2 = gpsConverter.convertGPS(coord2);
+        GraphCoordinate avgCoord = new GraphCoordinate((graphCoord1.getX() + graphCoord2.getX()) / 2,
+                (graphCoord1.getY() + graphCoord2.getY()) / 2);
+
+        double a = (graphCoord1.getX() - graphCoord2.getX());
+        double b = (graphCoord1.getY() - graphCoord2.getY());
+        double c = Math.sqrt(a * a + b * b);
+
+
+        Subject3D bound1 = new Annotation3D(new Sphere(thickness * 2));
+        bound1.setX(graphCoord1.getX());
+        bound1.setZ(graphCoord1.getY());
+        boundaryNodes.add(bound1);
+
+        Subject3D connector = new Annotation3D(new Box(c, thickness, thickness));
+        connector.setX(avgCoord.getX());
+        connector.setZ(avgCoord.getY());
+        double angle = 90 + Math.toDegrees(GPSConverter.getAngle(graphCoord2, graphCoord1));
+        connector.setHeading(angle);
+
+        boundaryConnectors.add(connector);
+    }
+
+    /**
+     * get the 3d objects to draw
+     * @return 3d boundary to draw
+     */
+    public List<Subject3D> getBoundaryNodes(){
+        //these two must be concatenated with nodes after connectors else the spheres will not overlap the lines
+        ArrayList<Subject3D> result = new ArrayList<>(boundaryConnectors);
+        result.addAll(boundaryNodes);
+        return result;
+    }
+}

racevisionGame/src/main/java/visualiser/layout/Plane3D.java

@@ -1,5 +1,13 @@
 package visualiser.layout;
 
+import com.sun.javafx.geom.PickRay;
+import com.sun.javafx.scene.input.PickResultChooser;
+import com.sun.javafx.sg.prism.NGNode;
+import javafx.scene.Node;
+import javafx.scene.shape.*;
+
+import java.util.ArrayList;
+import java.util.Arrays;
 import javafx.scene.shape.TriangleMesh;
 
 import java.util.ArrayList;
@@ -29,13 +37,13 @@ public class Plane3D extends TriangleMesh{
 
         for (float l = 0; l <= length; l += subLength) {
             for (float w = 0; w <= width; w += subWidth){
-                //add points
+                    //add points
-                pointsList.add(w + startW);
+                    pointsList.add(w + startW);
-                pointsList.add(l + startL);
+                    pointsList.add(l + startL);
-                pointsList.add(0f);
+                    pointsList.add(0f);
-                //addTexture coords
+                    //addTexture coords
-                textureCoord.add(1 - w/width);
+                    textureCoord.add(1 - w/width);
-                textureCoord.add(1 - l/length);
+                    textureCoord.add(1 - l/length);
             }
         }
 
@@ -92,6 +100,7 @@ public class Plane3D extends TriangleMesh{
         float x = this.getPoints().get(i);
         float y = this.getPoints().get(i + 1);
         float z = this.getPoints().get(i + 2);
+        System.out.println(String.format("Point at %d is x:%f, y:%f, z:%f", index, x, y, z));
     }
 
     /**
@@ -121,4 +130,4 @@ public class Plane3D extends TriangleMesh{
     }
 
 
-}
+}

racevisionGame/src/main/java/visualiser/layout/SeaSurface.java

@@ -1,65 +1,67 @@
 package visualiser.layout;
 
+import javafx.geometry.Point3D;
 import javafx.scene.image.Image;
+import javafx.scene.image.ImageView;
 import javafx.scene.image.PixelWriter;
 import javafx.scene.image.WritableImage;
 import javafx.scene.paint.Color;
 import javafx.scene.paint.PhongMaterial;
+import javafx.scene.shape.Box;
 import javafx.scene.shape.MeshView;
+import javafx.scene.shape.Shape3D;
+import javafx.scene.shape.TriangleMesh;
 import visualiser.utils.PerlinNoiseGenerator;
 
 /**
  * Creates a SeaSurface
  */
-public class SeaSurface {
+public class SeaSurface extends Subject3D {
-    private float[][] noiseArray;
+    private static Image image;
-    private Subject3D surface;
 
     /**
      * Sea Surface Constructor
+     *
      * @param size size of the sea surface (has to be square for simplicity's sake)
      * @param freq frequency the perlin noise is to be generated at
-     * @param x offset that the sea should be set at position-wise
-     * @param y offset that the sea should be set at position-wise
-     * @param z offset that the sea should be set at position-wise
      */
-    public SeaSurface(int size, double freq, double x, double y, double z){
+    public SeaSurface(int size, double freq) {
-        noiseArray = PerlinNoiseGenerator.createNoise(size, freq);
+        super(createSurface(size, freq), 0);
-        createSurface();
+        image = new Image(getClass().getClassLoader().getResourceAsStream("images/skybox/ThickCloudsWaterDown2048.png"));
-        surface.setZ(z);
-        surface.setY(y);
-        surface.setX(x);
     }
 
     /**
      * Creates the sea surface
+     * @param size size of sea noise array.
+     * @param freq frequency of sea noise array.
+     * @return The sea surface.
      */
-    private void createSurface(){
+    private static Shape3D createSurface(int size, double freq) {
-        Image diffuseMap = createImage(noiseArray.length, noiseArray);
+        float[][] noiseArray = PerlinNoiseGenerator.createNoise(size, freq);
+        Image diffuseMap = createImage(noiseArray.length, noiseArray); //image
 
         PhongMaterial material = new PhongMaterial();
+        material.setDiffuseColor(Color.web("#FFFFFF"));
+        material.setSpecularColor(Color.web("#000000"));
         material.setDiffuseMap(diffuseMap);
-        //material.setSpecularColor(Color.WHITE);
 
         Plane3D seaPlane = new Plane3D(noiseArray.length, noiseArray.length, 10, 10);
         MeshView seaSurface = new MeshView(seaPlane);
-//        Box seaSurface = new Box(noiseArray.length, 0.1, noiseArray.length);
         seaSurface.setMaterial(material);
         seaSurface.setMouseTransparent(true);
         seaSurface.toFront();
-        //seaSurface.setRotationAxis(new Point3D(1, 0, 0));
-        //seaSurface.setRotate(90);
 
-        surface = new Subject3D(seaSurface);
+        return seaSurface;
     }
 
     /**
      * Create texture for uv mapping
-     * @param size size of the image to make
+     *
+     * @param size  size of the image to make
      * @param noise array of noise
      * @return image that is created
      */
-    private Image createImage(double size, float[][] noise) {
+    private static Image createImage(double size, float[][] noise) {
 
         int width = (int) size;
         int height = (int) size;
@@ -94,9 +96,10 @@ public class SeaSurface {
 
     /**
      * Nomalises the values so that the colours are correct
-     * @param value value to normalise
+     *
-     * @param min current min
+     * @param value  value to normalise
-     * @param max current max
+     * @param min    current min
+     * @param max    current max
      * @param newMin new min
      * @param newMax new max
      * @return returns normalised value
@@ -109,9 +112,10 @@ public class SeaSurface {
 
     /**
      * clamps a value between a min and max
+     *
      * @param value value to clamp
-     * @param min minimum value it can be
+     * @param min   minimum value it can be
-     * @param max maximum value it can be
+     * @param max   maximum value it can be
      * @return result after clamp
      */
     private static double clamp(double value, double min, double max) {
@@ -126,11 +130,11 @@ public class SeaSurface {
     }
 
     /**
-     * Get surface
+     * Prevent rescaling of sea surface
-     * @return the surface so it can be drawn
+     *
+     * @param scale ignored
      */
-    public Subject3D getSurface(){
+    @Override
-        return surface;
+    public void setScale(double scale) {
     }
-
+}
-}

racevisionGame/src/main/java/visualiser/layout/Shockwave.java

@@ -0,0 +1,17 @@
+package visualiser.layout;
+
+import javafx.scene.paint.Color;
+import javafx.scene.paint.PhongMaterial;
+import javafx.scene.shape.Cylinder;
+import javafx.scene.transform.Rotate;
+
+/**
+ * Created by cbt24 on 14/09/17.
+ */
+public class Shockwave extends Subject3D {
+    public Shockwave(double radius) {
+        super(new Cylinder(radius,0),0);
+        getMesh().getTransforms().add(new Rotate(-90, Rotate.X_AXIS));
+        getMesh().setMaterial(new PhongMaterial(new Color(0,0,0,0)));
+    }
+}

racevisionGame/src/main/java/visualiser/layout/SkyBox.java

@@ -0,0 +1,163 @@
+package visualiser.layout;
+
+import javafx.geometry.Point3D;
+import javafx.scene.image.Image;
+import javafx.scene.paint.Color;
+import javafx.scene.paint.PhongMaterial;
+import javafx.scene.shape.MeshView;
+import javafx.scene.transform.Rotate;
+
+import java.util.ArrayList;
+import java.util.List;
+
+/**
+ * Creates a skyBox
+ */
+public class SkyBox {
+    private int size;
+    private double x;
+    private double y;
+    private double z;
+    private double freq;
+    private double yshift;
+    private double clipOverlap;
+    private List<Subject3D> skyBoxPlanes = new ArrayList<>();
+
+    public SkyBox(int edgeLength, double freq, double x, double y, double z) {
+        this.size = edgeLength;
+        this.x = x;
+        this.y = y;
+        this.z = z;
+        this.freq = freq;
+        this.yshift = -size/64;
+        clipOverlap = 0;
+        makeSkyBox();
+    }
+
+    private void makeSkyBox() {
+        addTop();
+        addFront();
+        addBack();
+        addLeft();
+        addRight();
+        //addSeaOverlay();
+    }
+
+    private void addTop() {
+        MeshView surface = makeSurface(new Image(getClass().getClassLoader().getResourceAsStream("images/skybox/ThickCloudsWaterUp2048.png")), size);
+
+        surface.setRotationAxis(new Point3D(0, 0, 1));
+        surface.setRotate(180);
+
+        surface.setTranslateX(x);
+        surface.setTranslateY(y - size + 1);
+        surface.setTranslateZ(z);
+
+        Subject3D top = new SkyBoxPlane(surface,0);
+        skyBoxPlanes.add(top);
+    }
+
+    private void addRight() {
+        MeshView surface = makeSurface(new Image(getClass().getClassLoader().getResourceAsStream("images/skybox/ThickCloudsWaterRight2048.png")), size + 1);
+
+        surface.setTranslateX(size/2);
+        surface.setTranslateY(size/2);
+        surface.setRotationAxis(new Point3D(1, 0, 0));
+        surface.setRotate(90);
+        surface.setTranslateX(-size/2);
+        surface.setTranslateY(-size/2);
+
+        surface.setTranslateX(x);
+        surface.setTranslateY(y + yshift);
+        surface.setTranslateZ(z + size/2 - clipOverlap);
+
+
+        Subject3D right = new SkyBoxPlane(surface,0);
+        skyBoxPlanes.add(right);
+    }
+
+    private void addLeft() {
+        MeshView surface = makeSurface(new Image(getClass().getClassLoader().getResourceAsStream("images/skybox/ThickCloudsWaterLeft2048.png")), size + 1);
+
+        surface.setTranslateX(size/2);
+        surface.setTranslateY(size/2);
+        surface.setRotationAxis(new Point3D(1, 0, 0));
+        surface.setRotate(-90);
+        surface.setTranslateX(-size/2);
+        surface.setTranslateY(-size/2);
+
+        surface.setScaleX(-1);
+        surface.setScaleZ(-1);
+
+        surface.setTranslateX(x);
+        surface.setTranslateY(y + yshift);
+        surface.setTranslateZ(z - size/2 + clipOverlap);
+
+
+        Subject3D left = new SkyBoxPlane(surface,0);
+        skyBoxPlanes.add(left);
+    }
+
+    private void addBack() {
+        MeshView surface = makeSurface(new Image(getClass().getClassLoader().getResourceAsStream("images/skybox/ThickCloudsWaterBack2048.png")), size);
+        surface.getTransforms().add(new Rotate(90, 0, 0));
+
+        surface.setRotationAxis(new Point3D(1, 0, 0));
+        surface.setRotate(-90);
+
+        surface.setScaleY(-1);
+        surface.setScaleZ(-1);
+
+        surface.setTranslateX(x - size/2 + clipOverlap);
+        surface.setTranslateY(y + yshift);
+        surface.setTranslateZ(z);
+
+        Subject3D back = new SkyBoxPlane(surface,0);
+        skyBoxPlanes.add(back);
+    }
+
+    private void addFront() {
+        MeshView surface = makeSurface(new Image(getClass().getClassLoader().getResourceAsStream("images/skybox/ThickCloudsWaterFront2048.png")), size);
+
+        surface.setTranslateX(size/2);
+        surface.setTranslateY(size/2);
+        surface.setRotationAxis(new Point3D(0, 0, 1));
+        surface.setRotate(-90);
+        surface.setTranslateX(-size/2);
+        surface.setTranslateY(-size/2);
+
+        surface.setTranslateX(x + size/2 - clipOverlap);
+        surface.setTranslateY(y + yshift);
+        surface.setTranslateZ(z);
+
+        Subject3D front = new SkyBoxPlane(surface,0);
+        skyBoxPlanes.add(front);
+    }
+
+    private MeshView makeSurface(Image diffuseMap, int size) {
+
+        PhongMaterial material = new PhongMaterial();
+        material.setDiffuseColor(Color.web("#FFFFFF"));
+        material.setSpecularColor(Color.web("#000000"));
+        material.setDiffuseMap(diffuseMap);
+
+        Plane3D plane = new Plane3D(size, size, 10, 10);
+        MeshView surface = new MeshView(plane);
+        surface.setMaterial(material);
+        surface.setMouseTransparent(true);
+        return surface;
+    }
+
+    private void addSeaOverlay() {
+        SeaSurface seaSurface = new SeaSurface(size * 3, freq);
+        seaSurface.setX(x);
+        seaSurface.setY(y - size/4 + 1);
+        seaSurface.setZ(z);
+        skyBoxPlanes.add(seaSurface);
+    }
+
+    public List<Subject3D> getSkyBoxPlanes() {
+        return skyBoxPlanes;
+    }
+}
+

racevisionGame/src/main/java/visualiser/layout/SkyBoxPlane.java

@@ -0,0 +1,14 @@
+package visualiser.layout;
+
+import javafx.scene.shape.Shape3D;
+
+public class SkyBoxPlane extends Subject3D {
+
+    public SkyBoxPlane(Shape3D mesh, int sourceID) {
+        super(mesh,sourceID);
+    }
+
+    @Override
+    public void setScale(double scale) {
+    }
+}

racevisionGame/src/main/java/visualiser/layout/Subject3D.java

@@ -2,6 +2,7 @@ package visualiser.layout;
 
 import javafx.scene.shape.Shape3D;
 import javafx.scene.transform.Rotate;
+import javafx.scene.transform.Scale;
 import javafx.scene.transform.Translate;
 
 /**
@@ -12,6 +13,10 @@ public class Subject3D {
      * Rendered mesh
      */
     private Shape3D mesh;
+    /**
+     * Source ID of subject in game model
+     */
+    private int sourceID;
 
     /**
      * Position translation updated by state listeners
@@ -23,22 +28,30 @@ public class Subject3D {
      */
     private Rotate heading;
 
+    private Scale scale;
+
     /**
      * Constructor for view subject wrapper
      * @param mesh to be rendered
+     * @param sourceID Source ID of the subject.
      */
-    public Subject3D(Shape3D mesh) {
+    public Subject3D(Shape3D mesh, int sourceID) {
         this.mesh = mesh;
+        this.sourceID = sourceID;
+        this.scale = new Scale();
         this.position = new Translate();
         this.heading = new Rotate(0, Rotate.Y_AXIS);
-
+        this.mesh.getTransforms().addAll(position, scale, heading, new Rotate(90, Rotate.X_AXIS), new Rotate(180, Rotate.Y_AXIS));
-        this.mesh.getTransforms().addAll(position, heading, new Rotate(90, Rotate.X_AXIS), new Rotate(180, Rotate.Y_AXIS));
     }
 
     public Shape3D getMesh() {
         return mesh;
     }
 
+    public int getSourceID() {
+        return sourceID;
+    }
+
     public Translate getPosition() {
         return this.position;
     }
@@ -47,6 +60,12 @@ public class Subject3D {
         return heading;
     }
 
+    public void setScale(double scale) {
+        this.scale.setX(scale);
+        this.scale.setY(scale);
+        this.scale.setZ(scale);
+    }
+
     public void setX(double x) {
         position.setX(x);
     }

racevisionGame/src/main/java/visualiser/layout/View3D.java

@@ -1,11 +1,12 @@
 package visualiser.layout;
 
+import javafx.animation.AnimationTimer;
+import javafx.beans.property.ObjectProperty;
+import javafx.beans.property.SimpleObjectProperty;
 import javafx.beans.value.ChangeListener;
 import javafx.collections.ListChangeListener;
 import javafx.collections.ObservableList;
-import javafx.scene.Group;
+import javafx.scene.*;
-import javafx.scene.PerspectiveCamera;
-import javafx.scene.SubScene;
 import javafx.scene.input.PickResult;
 import javafx.scene.layout.Pane;
 import javafx.scene.paint.Color;
@@ -33,11 +34,15 @@ public class View3D extends Pane {
     /**
      * Map for selecting Subject3D from Shape3D
      */
-    private Map<Shape3D, Subject3D> selectionMap;
+    private Map<Shape3D, Subject3D> shapeMap;
+    /**
+     * Map for selecting Subject3D from source ID
+     */
+    private Map<Integer, Subject3D> sourceMap;
     /**
      * Subject tracked by camera
      */
-    private Subject3D target;
+    private ObjectProperty<Subject3D> target;
     /**
      * Rendering container for shapes
      */
@@ -67,44 +72,43 @@ public class View3D extends Pane {
      */
     private Rotate pitch;
     /**
-     * Single listener for subject heading changes
+     * Animation loop for camera tracking
-     */
-    private ChangeListener<? super Number> pivotHeading = (o, prev, curr) -> yaw.setAngle((double)curr);
-    /**
-     * Single listener for subject position (x) changes
-     */
-    private ChangeListener<? super Number> pivotX = (o, prev, curr) -> pivot.setX((double)curr);
-    /**
-     * Single listener for subject position (y) changes
      */
-    private ChangeListener<? super Number> pivotY = (o, prev, curr) -> pivot.setY((double)curr);
+    private AnimationTimer trackBoat;
     /**
-     * Single listener for subject position (z) changes
+     * Distance to switch from third person to bird's eye
      */
-    private ChangeListener<? super Number> pivotZ = (o, prev, curr) -> pivot.setZ((double)curr);
+    private final double THIRD_PERSON_LIMIT = 100;
     /**
-     * Distance to switch from third person to bird's eye
+     * Distance to stop zoom
      */
-    private double THIRD_PERSON_LIMIT = 100;
+    private final double FIRST_PERSON_LIMIT = 2;
 
     /**
      * Default constructor for View3D. Sets up Scene and PerspectiveCamera.
+     * @param fill whether or not to fill the background of the view.
      */
-    public View3D() {
+    public View3D(boolean fill) {
         this.world = new Group();
-        this.selectionMap = new HashMap<>();
+        this.shapeMap = new HashMap<>();
-        this.target = null;
+        this.sourceMap = new HashMap<>();
+        this.target = new SimpleObjectProperty<>(null);
         this.scene = new SubScene(world, 300, 300);
 
         scene.widthProperty().bind(this.widthProperty());
         scene.heightProperty().bind(this.heightProperty());
-        scene.setFill(new Color(0.2, 0.6, 1, 1));
+        if (fill) {
-
+            scene.setFill(new Color(0.2, 0.6, 1, 1));
+        }
         scene.setCamera(buildCamera());
 
         this.getChildren().add(scene);
     }
 
+    public View3D(){
+        this(true);
+    }
+
     /**
      * Sets up camera view frustum and binds transformations
      * @return perspective camera
@@ -140,17 +144,23 @@ public class View3D extends Pane {
                 if (c.wasRemoved() || c.wasAdded()) {
                     for (Subject3D shape : c.getRemoved()) {
                         world.getChildren().remove(shape.getMesh());
-                        selectionMap.remove(shape.getMesh());
+                        shapeMap.remove(shape.getMesh());
+                        sourceMap.remove(shape.getSourceID());
                     }
                     for (Subject3D shape : c.getAddedSubList()) {
                         world.getChildren().add(shape.getMesh());
-                        selectionMap.put(shape.getMesh(), shape);
+                        shapeMap.put(shape.getMesh(), shape);
+                        sourceMap.put(shape.getSourceID(), shape);
                     }
                 }
             }
         });
     }
 
+    public Subject3D getShape(int sourceID) {
+        return sourceMap.get(sourceID);
+    }
+
     /**
      * Intercept mouse clicks on subjects in view. The applied listener cannot be removed.
      */
@@ -158,20 +168,48 @@ public class View3D extends Pane {
         scene.setOnMousePressed(e -> {
             PickResult result = e.getPickResult();
             if(result != null && result.getIntersectedNode() != null && result.getIntersectedNode() instanceof Shape3D) {
-                trackSubject(selectionMap.get(result.getIntersectedNode()));
+                untrackSubject();
+                trackSubject(shapeMap.get(result.getIntersectedNode()));
+                setThirdPerson();
             }
         });
     }
 
+    public ObjectProperty<Subject3D> targetProperty() {
+        return target;
+    }
+
+    /**
+     * Configures camera to third person view
+     */
+    public void setThirdPerson() {
+        this.setDistance(THIRD_PERSON_LIMIT / 2);
+        this.setPitch(10);
+
+        for(Subject3D item: items) {
+            item.setScale(0.1);
+        }
+    }
+
+    /**
+     * Configures camera to bird's eye view
+     */
+    public void setBirdsEye() {
+        this.setYaw(0);
+        this.setPitch(60);
+
+        for(Subject3D item: items) {
+            item.setScale(1);
+        }
+    }
+
     /**
      * Stop camera from following the last selected subject
      */
     private void untrackSubject() {
-        if(target != null) {
+        if(target.get() != null) {
-            target.getPosition().xProperty().removeListener(pivotX);
+            trackBoat.stop();
-            target.getPosition().yProperty().removeListener(pivotY);
+            target.setValue(null);
-            target.getPosition().zProperty().removeListener(pivotZ);
-            target.getHeading().angleProperty().removeListener(pivotHeading);
         }
     }
 
@@ -180,19 +218,16 @@ public class View3D extends Pane {
      * @param subject to track
      */
     private void trackSubject(Subject3D subject) {
-        untrackSubject();
+        target.set(subject);
-        target = subject;
-
-        updatePivot(target.getPosition());
-        setYaw(target.getHeading().getAngle());
-
-        target.getPosition().xProperty().addListener(pivotX);
-        target.getPosition().yProperty().addListener(pivotY);
-        target.getPosition().zProperty().addListener(pivotZ);
-        target.getHeading().angleProperty().addListener(pivotHeading);
 
-        this.setDistance(THIRD_PERSON_LIMIT);
+        this.trackBoat = new AnimationTimer() {
-        this.setPitch(20);
+            @Override
+            public void handle(long now) {
+                updatePivot(target.get().getPosition());
+                setYaw(target.get().getHeading().getAngle());
+            }
+        };
+        trackBoat.start();
     }
 
     public void setNearClip(double nearClip) {
@@ -203,6 +238,10 @@ public class View3D extends Pane {
         this.farClip = farClip;
     }
 
+    public Translate getPivot() {
+        return pivot;
+    }
+
     /**
      * Sets the coordinates of the camera pivot once.
      * @param pivot source of coordinates
@@ -230,13 +269,12 @@ public class View3D extends Pane {
     public void updateDistance(double delta) {
         double distance = -this.distance.getZ() + delta;
 
-        if(distance <= 0) {
+        if(distance <= FIRST_PERSON_LIMIT) {
-            this.setDistance(0);
+            this.setDistance(FIRST_PERSON_LIMIT);
         } else if(distance > THIRD_PERSON_LIMIT) {
-            untrackSubject();
-            this.setYaw(0);
-            this.setPitch(60);
             this.setDistance(distance);
+            untrackSubject();
+            setBirdsEye();
         } else {
             this.setDistance(distance);
         }
@@ -257,4 +295,12 @@ public class View3D extends Pane {
     public void setPitch(double pitch) {
         this.pitch.setAngle(-pitch);
     }
+
+    public void addAmbientLight(AmbientLight ambientLight) {
+        this.world.getChildren().add(ambientLight);
+    }
+
+    public void addPointLight(PointLight pointLight) {
+        this.world.getChildren().add(pointLight);
+    }
 }

racevisionGame/src/main/java/visualiser/model/VisualiserBoat.java

@@ -1,6 +1,8 @@
 package visualiser.model;
 
+import javafx.beans.property.BooleanProperty;
 import javafx.beans.property.ObjectProperty;
+import javafx.beans.property.SimpleBooleanProperty;
 import javafx.beans.property.SimpleObjectProperty;
 import javafx.scene.paint.Color;
 import network.Messages.Enums.BoatStatusEnum;
@@ -62,6 +64,7 @@ public class VisualiserBoat extends Boat {
 
     private ObjectProperty<GPSCoordinate> positionProperty;
     private ObjectProperty<Bearing> bearingProperty;
+    private BooleanProperty hasCollided;
 
 
     /**
@@ -74,6 +77,7 @@ public class VisualiserBoat extends Boat {
         super(boat.getSourceID(), boat.getName(), boat.getCountry());
 
         this.color = color;
+        this.hasCollided = new SimpleBooleanProperty(false);
     }
 
 
@@ -253,10 +257,6 @@ public class VisualiserBoat extends Boat {
         this.positionProperty.set(position);
     }
 
-    public ObjectProperty<GPSCoordinate> positionProperty() {
-        return positionProperty;
-    }
-
     @Override
     public Bearing getBearing() {
         return bearingProperty.get();
@@ -270,7 +270,15 @@ public class VisualiserBoat extends Boat {
         this.bearingProperty.set(bearing);
     }
 
-    public ObjectProperty<Bearing> bearingProperty() {
+    public boolean hasCollided() {
-        return bearingProperty;
+        return hasCollided.get();
+    }
+
+    public BooleanProperty hasCollidedProperty() {
+        return hasCollided;
+    }
+
+    public void setHasCollided(boolean hasCollided) {
+        this.hasCollided.set(hasCollided);
     }
 }

racevisionGame/src/main/java/visualiser/model/VisualiserRaceController.java

@@ -65,7 +65,7 @@ public class VisualiserRaceController implements RunnableWithFramePeriod {
                 compositeRaceCommand.addCommand(command);
 
             } catch (CommandConstructionException e) {
-                Logger.getGlobal().log(Level.WARNING, "VisualiserRaceController could not create a command for incoming message.");
+                //Logger.getGlobal().log(Level.WARNING, "VisualiserRaceController could not create a command for incoming message.");
 
             } catch (InterruptedException e) {
                 Logger.getGlobal().log(Level.SEVERE, "VisualiserRaceController was interrupted on thread: " + Thread.currentThread() + " while waiting for messages.");

racevisionGame/src/main/java/visualiser/utils/GPSConverter.java

@@ -101,4 +101,14 @@ public class GPSConverter {
         return convertGPS(coordinate.getLatitude(), coordinate.getLongitude());
     }
 
+    /**
+     * Gets the bearing between two coordinates
+     * @param coord1 coordinate 1
+     * @param coord2 coordinate 2
+     * @return return the bearing between the two.
+     */
+    public static double getAngle(GraphCoordinate coord1, GraphCoordinate coord2){
+        return Math.atan2(coord2.getX() - coord1.getX(), coord2.getY() - coord1.getY());
+    }
+
 }

racevisionGame/src/main/java/visualiser/utils/PerlinNoiseGenerator.java

@@ -85,4 +85,4 @@ public class PerlinNoiseGenerator {
         static { for (int i=0; i < 256 ; i++) p[256+i] = p[i] = permutation[i]; }
     }
 
-}
+}

racevisionGame/src/main/resources/css/dayMode.css

@@ -89,3 +89,15 @@
     -fx-focus-color: transparent;
     -fx-background-color: transparent;
 }
+
+#lineChartWrapper{
+    -fx-border-color: #02378c;
+    -fx-background-color: #4783e0;
+    -fx-border-width: 3;
+}
+
+#boatInfoTable{
+    -fx-border-color: #012256;
+    -fx-border-width: 3;
+}
+

racevisionGame/src/main/resources/css/nightMode.css

@@ -91,3 +91,14 @@
     -fx-focus-color: transparent;
     -fx-background-color: transparent;
 }
+
+#lineChartWrapper{
+    -fx-border-color: #02378c;
+    -fx-background-color: #012256;
+    -fx-border-width: 3;
+}
+
+#boatInfoTable{
+    -fx-border-color: #012256;
+    -fx-border-width: 3;
+}

racevisionGame/src/main/resources/mock/mockXML/raceThreePlayers.xml

@@ -0,0 +1,51 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<Race>
+    <RaceID>5326</RaceID>
+    <RaceType>FLEET</RaceType>
+    <CreationTimeDate>RACE_CREATION_TIME</CreationTimeDate>
+    <RaceStartTime Postpone="false" Time="RACE_START_TIME"/>
+    <Participants>
+    </Participants>
+    <CompoundMarkSequence>
+        <Corner SeqID="1" CompoundMarkID="1" Rounding="SP" ZoneSize="3" />
+        <Corner SeqID="2" CompoundMarkID="2" Rounding="Port" ZoneSize="3" />
+        <Corner SeqID="3" CompoundMarkID="4" Rounding="Port" ZoneSize="3" />
+        <Corner SeqID="4" CompoundMarkID="3" Rounding="Starboard" ZoneSize="3" />
+        <Corner SeqID="5" CompoundMarkID="4" Rounding="Port" ZoneSize="3" />
+        <Corner SeqID="6" CompoundMarkID="5" Rounding="SP" ZoneSize="3"/>
+    </CompoundMarkSequence>
+    <Course>
+        <CompoundMark CompoundMarkID="1" Name="Start Line">
+            <Mark SeqId="1" Name="PRO" TargetLat="32.296577" TargetLng="-64.854304" SourceID="101"/>
+            <Mark SeqId="2" Name="PIN" TargetLat="32.293771" TargetLng="-64.855242" SourceID="102"/>
+        </CompoundMark>
+        <CompoundMark CompoundMarkID="2" Name="Marker 1">
+            <Mark Name="Marker1" TargetLat="32.293039" TargetLng="-64.843983" SourceID="103"/>
+        </CompoundMark>
+        <CompoundMark CompoundMarkID="3" Name="Windward Gate">
+            <Mark Name="WGL" SeqId="1" TargetLat="32.28468" TargetLng="-64.850045" SourceID="104"/>
+            <Mark Name="WGR" SeqId="2" TargetLat="32.280164" TargetLng="-64.847591" SourceID="105"/>
+        </CompoundMark>
+        <CompoundMark CompoundMarkID="4" Name="Leeward Gate">
+            <Mark Name="LGL" SeqId="1" TargetLat="32.309693" TargetLng="-64.835249" SourceID="106"/>
+            <Mark Name="LGR" SeqId="2" TargetLat="32.308046" TargetLng="-64.831785" SourceID="107"/>
+        </CompoundMark>
+        <CompoundMark CompoundMarkID="5" Name="Finish Line">
+            <Mark Name="FL" SeqId="1" TargetLat="32.317379" TargetLng="-64.839291" SourceID="108"/>
+            <Mark Name="FR" SeqId="2" TargetLat="32.317257" TargetLng="-64.83626" SourceID="109"/>
+        </CompoundMark>
+    </Course>
+    <CourseLimit>
+        <Limit Lat="32.313922" Lon="-64.837168" SeqID="1"/>
+        <Limit Lat="32.317379" Lon="-64.839291" SeqID="2"/>
+        <Limit Lat="32.317911" Lon="-64.836996" SeqID="3"/>
+        <Limit Lat="32.317257" Lon="-64.83626" SeqID="4"/>
+        <Limit Lat="32.304273" Lon="-64.822834" SeqID="5"/>
+        <Limit Lat="32.279097" Lon="-64.841545" SeqID="6"/>
+        <Limit Lat="32.279604" Lon="-64.849871" SeqID="7"/>
+        <Limit Lat="32.289545" Lon="-64.854162" SeqID="8"/>
+        <Limit Lat="32.290198" Lon="-64.858711" SeqID="9"/>
+        <Limit Lat="32.297164" Lon="-64.856394" SeqID="10"/>
+        <Limit Lat="32.296148" Lon="-64.849184" SeqID="11"/>
+    </CourseLimit>
+</Race>

racevisionGame/src/main/resources/visualiser/scenes/newRaceView.fxml

@@ -0,0 +1,148 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<?import javafx.geometry.Insets?>
+<?import javafx.scene.chart.LineChart?>
+<?import javafx.scene.chart.NumberAxis?>
+<?import javafx.scene.control.Accordion?>
+<?import javafx.scene.control.Button?>
+<?import javafx.scene.control.CheckBox?>
+<?import javafx.scene.control.Label?>
+<?import javafx.scene.control.RadioButton?>
+<?import javafx.scene.control.Separator?>
+<?import javafx.scene.control.SplitPane?>
+<?import javafx.scene.control.TableColumn?>
+<?import javafx.scene.control.TableView?>
+<?import javafx.scene.control.TitledPane?>
+<?import javafx.scene.control.ToggleGroup?>
+<?import javafx.scene.layout.AnchorPane?>
+<?import javafx.scene.layout.ColumnConstraints?>
+<?import javafx.scene.layout.GridPane?>
+<?import javafx.scene.layout.Pane?>
+<?import javafx.scene.layout.RowConstraints?>
+<?import javafx.scene.layout.StackPane?>
+<?import javafx.scene.text.Font?>
+
+<SplitPane fx:id="racePane" prefHeight="431.0" prefWidth="610.0" visible="true" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0" xmlns="http://javafx.com/javafx/8.0.65" xmlns:fx="http://javafx.com/fxml/1" fx:controller="visualiser.Controllers.RaceViewController">
+    <items>
+        <StackPane fx:id="newPane" prefHeight="150.0" prefWidth="200.0">
+            <children>
+                <AnchorPane focusTraversable="true">
+                    <children>
+                        <GridPane fx:id="canvasBase" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
+                            <columnConstraints>
+                                <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" />
+                            </columnConstraints>
+                            <rowConstraints>
+                                <RowConstraints minHeight="10.0" vgrow="SOMETIMES" />
+                            </rowConstraints>
+                        </GridPane>
+                        <Pane prefHeight="200.0" prefWidth="400.0" visible="false">
+                            <children>
+                                <Accordion>
+                                    <panes>
+                                        <TitledPane animated="false" prefHeight="395.0" prefWidth="222.0" text="Annotation Control">
+                                            <content>
+                                                <AnchorPane fx:id="annotationPane" minHeight="0.0" minWidth="0.0">
+                                                    <children>
+                                                        <CheckBox fx:id="showName" layoutY="39.0" mnemonicParsing="false" selected="true" text="Show Boat Name" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="0.0" />
+                                                        <CheckBox fx:id="showAbbrev" layoutY="61.0" mnemonicParsing="false" selected="true" text="Show Boat Abbreviation" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="25.0" />
+                                                        <CheckBox fx:id="showSpeed" layoutY="90.0" mnemonicParsing="false" selected="true" text="Show Boat Speed" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="50.0" />
+                                                        <CheckBox fx:id="showBoatPath" mnemonicParsing="false" selected="true" text="Show Boat Paths" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="75.0" />
+                                                        <CheckBox fx:id="showTime" mnemonicParsing="false" selected="true" text="Show Boat Leg Time" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="100.0" />
+                                                        <CheckBox fx:id="showEstTime" mnemonicParsing="false" selected="true" text="Show Est. Time to Next Mark" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="125.0" />
+                                                        <CheckBox fx:id="showGuideline" mnemonicParsing="false" text="Show Guideline" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="150.0" />
+                                                        <Separator layoutX="19.6" layoutY="175.6" prefHeight="0.0" prefWidth="200.0" AnchorPane.leftAnchor="10.0" AnchorPane.topAnchor="175.0" />
+                                                        <Label text="Annotations" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="175.0" />
+                                                        <RadioButton fx:id="hideAnnoRBtn" mnemonicParsing="false" text="Hidden" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="200.0">
+                                                            <toggleGroup>
+                                                                <ToggleGroup fx:id="annoToggleGroup" />
+                                                            </toggleGroup>
+                                                        </RadioButton>
+                                                        <RadioButton fx:id="showAnnoRBtn" mnemonicParsing="false" text="Visible" toggleGroup="$annoToggleGroup" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="225.0" />
+                                                        <RadioButton fx:id="partialAnnoRBtn" mnemonicParsing="false" text="Partial" toggleGroup="$annoToggleGroup" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="250.0" />
+                                                        <RadioButton fx:id="importantAnnoRBtn" mnemonicParsing="false" text="Important" toggleGroup="$annoToggleGroup" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="275.0" />
+                                                        <Button fx:id="saveAnno" layoutX="11.0" layoutY="126.0" mnemonicParsing="false" text="Save Important Annotations" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="300.0" />
+                                                    </children>
+                                                </AnchorPane>
+                                            </content>
+                                        </TitledPane>
+                                        <TitledPane animated="false" text="FPS Control">
+                                            <content>
+                                                <AnchorPane minHeight="0.0" minWidth="0.0" prefHeight="180.0" prefWidth="200.0">
+                                                    <children>
+                                                        <CheckBox fx:id="showFPS" layoutX="-14.0" layoutY="13.0" mnemonicParsing="false" selected="true" text="Show FPS" AnchorPane.leftAnchor="0.0" AnchorPane.topAnchor="0.0" />
+                                                    </children>
+                                                </AnchorPane>
+                                            </content>
+                                        </TitledPane>
+                                    </panes>
+                                </Accordion>
+                            </children>
+                        </Pane>
+                        <Label fx:id="timer" maxHeight="20.0" text="0:0" AnchorPane.bottomAnchor="0.0" AnchorPane.rightAnchor="0.0">
+                            <font>
+                                <Font name="System Bold" size="15.0" />
+                            </font>
+                        </Label>
+                        <Label fx:id="FPS" text="FPS: 0" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0">
+                            <font>
+                                <Font name="System Bold" size="15.0" />
+                            </font>
+                        </Label>
+                        <Label fx:id="timeZone" text="Label" AnchorPane.bottomAnchor="0.0" AnchorPane.rightAnchor="0.0">
+                            <font>
+                                <Font name="System Bold" size="15.0" />
+                            </font>
+                            <padding>
+                                <Insets bottom="20.0" />
+                            </padding>
+                        </Label>
+                        <StackPane fx:id="arrowPane" alignment="TOP_RIGHT" mouseTransparent="true" prefHeight="150.0" prefWidth="150.0" snapToPixel="false" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
+                            <children>
+                                <fx:include fx:id="arrow" source="arrow.fxml" />
+                            </children>
+                        </StackPane>
+                        <Label fx:id="tutorialText" alignment="CENTER" maxHeight="-Infinity" maxWidth="-Infinity" minHeight="-Infinity" minWidth="-Infinity" style="-fx-border-color: orange; -fx-border-radius: 5px; -fx-background-color: #ffffcc; -fx-text-fill: #3399ff; -fx-border-width: 3; -fx-border-insets: -3;" text="This is the tutorial text" visible="false" AnchorPane.leftAnchor="150.0" AnchorPane.rightAnchor="150.0" AnchorPane.topAnchor="100.0" />
+                    </children>
+                </AnchorPane>
+              <AnchorPane fx:id="infoWrapper" focusTraversable="true" minHeight="0.0" minWidth="0.0" prefHeight="160.0" prefWidth="200.0" visible="false">
+                  <children>
+                  <GridPane layoutX="-2.0" AnchorPane.bottomAnchor="40.0" AnchorPane.leftAnchor="40.0" AnchorPane.rightAnchor="40.0" AnchorPane.topAnchor="40.0">
+                     <columnConstraints>
+                        <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+                        <ColumnConstraints hgrow="SOMETIMES" maxWidth="475.0" minWidth="475.0" prefWidth="475.0" />
+                        <ColumnConstraints hgrow="SOMETIMES" minWidth="10.0" prefWidth="100.0" />
+                     </columnConstraints>
+                     <rowConstraints>
+                        <RowConstraints maxHeight="330.0" minHeight="10.0" prefHeight="214.0" vgrow="SOMETIMES" />
+                        <RowConstraints maxHeight="150.0" minHeight="10.0" prefHeight="135.0" vgrow="SOMETIMES" />
+                     </rowConstraints>
+                     <children>
+                            <TableView fx:id="boatInfoTable" minWidth="475.0" prefHeight="214.0" prefWidth="475.0" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.valignment="CENTER">
+                                <columns>
+                                    <TableColumn fx:id="boatPlacingColumn" prefWidth="50.0" text="Place" />
+                                    <TableColumn fx:id="boatTeamColumn" prefWidth="200.0" text="Team" />
+                                    <TableColumn fx:id="boatMarkColumn" prefWidth="150.0" text="Mark" />
+                                    <TableColumn fx:id="boatSpeedColumn" prefWidth="75.0" text="Speed" />
+                                </columns>
+                            </TableView>
+                            <AnchorPane fx:id="lineChartWrapper" prefHeight="167.0" prefWidth="178.0" GridPane.columnIndex="1" GridPane.halignment="CENTER" GridPane.rowIndex="1" GridPane.valignment="CENTER">
+                                <children>
+                                    <LineChart fx:id="sparklineChart" layoutX="-211.0" layoutY="-186.0" mouseTransparent="true" prefHeight="167.0" prefWidth="178.0" titleSide="LEFT" AnchorPane.bottomAnchor="0.0" AnchorPane.leftAnchor="0.0" AnchorPane.rightAnchor="0.0" AnchorPane.topAnchor="0.0">
+                                        <xAxis>
+                                            <NumberAxis side="BOTTOM" fx:id="xAxis" />
+                                        </xAxis>
+                                        <yAxis>
+                                            <NumberAxis fx:id="yAxis" side="LEFT" />
+                                        </yAxis>
+                                    </LineChart>
+                                </children>
+                            </AnchorPane>
+                     </children>
+                  </GridPane>
+                  </children>
+              </AnchorPane>
+            </children>
+        </StackPane>
+    </items>
+</SplitPane>